解决安卓扫码问题
diff --git a/platforms/android/CordovaLib/AndroidManifest.xml b/platforms/android/CordovaLib/AndroidManifest.xml
index 1625b89..320c253 100755
--- a/platforms/android/CordovaLib/AndroidManifest.xml
+++ b/platforms/android/CordovaLib/AndroidManifest.xml
@@ -19,5 +19,4 @@
 -->
 <manifest xmlns:android="http://schemas.android.com/apk/res/android"
       package="org.apache.cordova" android:versionName="1.0" android:versionCode="1">
-    <uses-sdk android:minSdkVersion="19" />
 </manifest>
diff --git a/platforms/android/CordovaLib/CordovaLib.iml b/platforms/android/CordovaLib/CordovaLib.iml
index b80b08f..da4f936 100644
--- a/platforms/android/CordovaLib/CordovaLib.iml
+++ b/platforms/android/CordovaLib/CordovaLib.iml
@@ -15,6 +15,7 @@
           <task>generateDebugSources</task>
         </afterSyncTasks>
         <option name="ALLOW_USER_CONFIGURATION" value="false" />
+        <option name="RES_FOLDERS_RELATIVE_PATH" value="" />
         <option name="PROJECT_TYPE" value="1" />
       </configuration>
     </facet>
diff --git a/platforms/android/android.json b/platforms/android/android.json
index 6103bb9..f654e07 100644
--- a/platforms/android/android.json
+++ b/platforms/android/android.json
@@ -55,6 +55,10 @@
             {
               "xml": "<feature name=\"JPushPlugin\"><param name=\"android-package\" value=\"cn.jiguang.cordova.push.JPushPlugin\" /></feature>",
               "count": 1
+            },
+            {
+              "xml": "<feature name=\"AppVersion\"><param name=\"android-package\" value=\"uk.co.whiteoctober.cordova.AppVersion\" /></feature>",
+              "count": 1
             }
           ]
         }
@@ -221,7 +225,7 @@
               "count": 1
             },
             {
-              "xml": "<meta-data android:name=\"JPUSH_APPKEY\" android:value=\"your_jpush_appkey\" />",
+              "xml": "<meta-data android:name=\"JPUSH_APPKEY\" android:value=\"d644d997f2cab0551ff704a3\" />",
               "count": 1
             }
           ]
@@ -236,6 +240,14 @@
               "mode": "merge",
               "id": "config.xml"
             }
+          ],
+          "NSPhotoLibraryUsageDescription": [
+            {
+              "xml": "<string>APP需要使用您的相册权限,没有该权限将无法完成扫一扫功能</string>",
+              "count": 1,
+              "mode": "merge",
+              "id": "config.xml"
+            }
           ]
         }
       }
@@ -286,9 +298,15 @@
       "PACKAGE_NAME": "com.supwisdom.dlapp"
     },
     "jpush-phonegap-plugin": {
-      "APP_KEY": "your_jpush_appkey",
+      "APP_KEY": "d644d997f2cab0551ff704a3",
       "CHANNEL": "developer-default",
       "PACKAGE_NAME": "com.supwisdom.dlapp"
+    },
+    "cordova-plugin-app-version": {
+      "PACKAGE_NAME": "com.supwisdom.dlapp"
+    },
+    "cordova-plugin-wkwebview-engine": {
+      "PACKAGE_NAME": "com.dalicitycard.app"
     }
   },
   "dependent_plugins": {},
@@ -620,6 +638,14 @@
       "clobbers": [
         "JPush"
       ]
+    },
+    {
+      "id": "cordova-plugin-app-version.AppVersionPlugin",
+      "file": "plugins/cordova-plugin-app-version/www/AppVersionPlugin.js",
+      "pluginId": "cordova-plugin-app-version",
+      "clobbers": [
+        "cordova.getAppVersion"
+      ]
     }
   ],
   "plugin_metadata": {
@@ -637,6 +663,8 @@
     "cordova-plugin-device": "2.0.2",
     "cordova-plugin-themeablebrowser": "0.2.17",
     "cordova-plugin-jcore": "1.3.0",
-    "jpush-phonegap-plugin": "3.7.2"
+    "jpush-phonegap-plugin": "3.7.2",
+    "cordova-plugin-app-version": "0.1.9",
+    "cordova-plugin-wkwebview-engine": "1.2.1"
   }
 }
diff --git a/platforms/android/app/app.iml b/platforms/android/app/app.iml
index 2f4beb8..f1a0fda 100644
--- a/platforms/android/app/app.iml
+++ b/platforms/android/app/app.iml
@@ -17,6 +17,7 @@
         <option name="ALLOW_USER_CONFIGURATION" value="false" />
         <option name="MANIFEST_FILE_RELATIVE_PATH" value="/src/main/AndroidManifest.xml" />
         <option name="RES_FOLDER_RELATIVE_PATH" value="/src/main/res" />
+        <option name="RES_FOLDERS_RELATIVE_PATH" value="file://$MODULE_DIR$/src/main/res" />
         <option name="ASSETS_FOLDER_RELATIVE_PATH" value="/src/main/assets" />
       </configuration>
     </facet>
@@ -81,6 +82,7 @@
       <sourceFolder url="file://$MODULE_DIR$/src/androidTest/java" isTestSource="true" />
       <sourceFolder url="file://$MODULE_DIR$/src/androidTest/rs" isTestSource="true" />
       <sourceFolder url="file://$MODULE_DIR$/src/androidTest/shaders" isTestSource="true" />
+      <excludeFolder url="file://$MODULE_DIR$/build/.DS_Store" />
       <excludeFolder url="file://$MODULE_DIR$/build/intermediates/annotation_processor_list" />
       <excludeFolder url="file://$MODULE_DIR$/build/intermediates/apk_list" />
       <excludeFolder url="file://$MODULE_DIR$/build/intermediates/blame" />
@@ -106,6 +108,7 @@
       <excludeFolder url="file://$MODULE_DIR$/build/intermediates/symbols" />
       <excludeFolder url="file://$MODULE_DIR$/build/intermediates/transforms" />
       <excludeFolder url="file://$MODULE_DIR$/build/outputs" />
+      <excludeFolder url="file://$MODULE_DIR$/build/reports" />
       <excludeFolder url="file://$MODULE_DIR$/build/tmp" />
     </content>
     <orderEntry type="jdk" jdkName="Android API 24 Platform" jdkType="Android SDK" />
@@ -113,6 +116,8 @@
     <orderEntry type="library" name="Gradle: com.android.support:support-annotations:24.1.1@jar" level="project" />
     <orderEntry type="library" name="Gradle: com.squareup.okio:okio:1.14.0@jar" level="project" />
     <orderEntry type="library" name="Gradle: com.google.zxing:core:3.2.1@jar" level="project" />
+    <orderEntry type="library" name="Gradle: __local_aars__:/Users/shuwei/works2/cordova/dlapp/platforms/android/app/libs/jcore-android-2.1.2.jar:unspecified@jar" level="project" />
+    <orderEntry type="library" name="Gradle: __local_aars__:/Users/shuwei/works2/cordova/dlapp/platforms/android/app/libs/jpush-android-3.3.4.jar:unspecified@jar" level="project" />
     <orderEntry type="library" name="Gradle: com.journeyapps:zxing-android-embedded-3.3.0" level="project" />
     <orderEntry type="library" name="Gradle: com.squareup.okhttp3:okhttp-urlconnection:3.10.0@jar" level="project" />
     <orderEntry type="library" name="Gradle: com.android.support:appcompat-v7-23.1.0" level="project" />
diff --git a/platforms/android/app/build.gradle b/platforms/android/app/build.gradle
index 3ce2e04..26cd3f9 100644
--- a/platforms/android/app/build.gradle
+++ b/platforms/android/app/build.gradle
@@ -165,80 +165,37 @@
 
 android {
     defaultConfig {
-        versionCode cdvVersionCode ?: new BigInteger("" + privateHelpers.extractIntFromManifest("versionCode"))
         applicationId privateHelpers.extractStringFromManifest("package")
-
         if (cdvMinSdkVersion != null) {
             minSdkVersion cdvMinSdkVersion
         }
+        minSdkVersion 19
+        ndk {
+            abiFilters "armeabi"
+        }
     }
-
     lintOptions {
-      abortOnError false;
+        abortOnError false;
     }
-
     compileSdkVersion 24
     buildToolsVersion '28.0.3'
-
     // This code exists for Crosswalk and other Native APIs.
     // By default, we multiply the existing version code in the
     // Android Manifest by 10 and add a number for each architecture.
     // If you are not using Crosswalk or SQLite, you can
     // ignore this chunk of code, and your version codes will be respected.
 
-    if (Boolean.valueOf(cdvBuildMultipleApks)) {
-        flavorDimensions "default"
-
-        productFlavors {
-            armeabi {
-                versionCode defaultConfig.versionCode*10 + 1
-                ndk {
-                    abiFilters = ["armeabi"]
-                }
-            }
-            armv7 {
-                versionCode defaultConfig.versionCode*10 + 2
-                ndk {
-                    abiFilters = ["armeabi-v7a"]
-                }
-            }
-            arm64 {
-                versionCode defaultConfig.versionCode*10 + 3
-                ndk {
-                    abiFilters = ["arm64-v8a"]
-                }
-            }
-            x86 {
-                versionCode defaultConfig.versionCode*10 + 4
-                ndk {
-                    abiFilters = ["x86"]
-                }
-            }
-            x86_64 {
-                versionCode defaultConfig.versionCode*10 + 5
-                ndk {
-                    abiFilters = ["x86_64"]
-                }
-            }
-        }
-    } else if (Boolean.valueOf(cdvVersionCodeForceAbiDigit)) {
-        // This provides compatibility to the default logic for versionCode before cordova-android 5.2.0
-        defaultConfig {
-            versionCode defaultConfig.versionCode*10
-        }
-    }
-
     compileOptions {
         sourceCompatibility JavaVersion.VERSION_1_8
         targetCompatibility JavaVersion.VERSION_1_8
     }
-
     if (cdvReleaseSigningPropertiesFile) {
         signingConfigs {
             release {
                 // These must be set or Gradle will complain (even if they are overridden).
                 keyAlias = ""
-                keyPassword = "__unset" // And these must be set to non-empty in order to have the signing step added to the task graph.
+                keyPassword = "__unset"
+                // And these must be set to non-empty in order to have the signing step added to the task graph.
                 storeFile = null
                 storePassword = "__unset"
             }
@@ -250,10 +207,11 @@
         }
         addSigningProps(cdvReleaseSigningPropertiesFile, signingConfigs.release)
     }
-
     if (cdvDebugSigningPropertiesFile) {
         addSigningProps(cdvDebugSigningPropertiesFile, signingConfigs.debug)
     }
+    productFlavors {
+    }
 }
 
 /*
@@ -266,9 +224,9 @@
 dependencies {
     implementation fileTree(include: '*.jar', dir: 'libs')
     // SUB-PROJECT DEPENDENCIES START
-    implementation(project(path: ":CordovaLib"))
-    implementation "com.squareup.okhttp3:okhttp-urlconnection:3.10.0"
-    implementation "com.android.support:support-v4:24.1.1+"
+    implementation project(path: ':CordovaLib')
+    implementation 'com.squareup.okhttp3:okhttp-urlconnection:3.10.0'
+    implementation 'com.android.support:support-v4:24.1.1+'
     // SUB-PROJECT DEPENDENCIES END
 }
 
diff --git a/platforms/android/app/release/app-release.apk b/platforms/android/app/release/app-release.apk
new file mode 100644
index 0000000..8664e26
--- /dev/null
+++ b/platforms/android/app/release/app-release.apk
Binary files differ
diff --git a/platforms/android/app/release/output.json b/platforms/android/app/release/output.json
new file mode 100644
index 0000000..6e993a2
--- /dev/null
+++ b/platforms/android/app/release/output.json
@@ -0,0 +1 @@
+[{"outputType":{"type":"APK"},"apkInfo":{"type":"MAIN","splits":[],"versionCode":10004,"versionName":"1.0.4","enabled":true,"outputFile":"app-release.apk","fullName":"release","baseName":"release"},"path":"app-release.apk","properties":{}}]
\ No newline at end of file
diff --git a/platforms/android/app/src/main/AndroidManifest.xml b/platforms/android/app/src/main/AndroidManifest.xml
index 0bc45cf..823d9b5 100644
--- a/platforms/android/app/src/main/AndroidManifest.xml
+++ b/platforms/android/app/src/main/AndroidManifest.xml
@@ -1,5 +1,5 @@
 <?xml version='1.0' encoding='utf-8'?>
-<manifest android:hardwareAccelerated="true" android:versionCode="10000" android:versionName="1.0.0" package="com.supwisdom.dlapp" xmlns:android="http://schemas.android.com/apk/res/android">
+<manifest android:hardwareAccelerated="true" android:versionCode="10004" android:versionName="1.0.4" package="com.dalicitycard.app" xmlns:android="http://schemas.android.com/apk/res/android">
     <supports-screens android:anyDensity="true" android:largeScreens="true" android:normalScreens="true" android:resizeable="true" android:smallScreens="true" android:xlargeScreens="true" />
     <application android:hardwareAccelerated="true" android:icon="@mipmap/ic_launcher" android:label="@string/launcher_name" android:supportsRtl="true">
         <activity android:configChanges="orientation|keyboardHidden|keyboard|screenSize|locale" android:label="@string/activity_name" android:launchMode="singleTop" android:name="MainActivity" android:screenOrientation="portrait" android:theme="@android:style/Theme.DeviceDefault.NoActionBar" android:windowSoftInputMode="adjustResize">
@@ -79,9 +79,8 @@
             </intent-filter>
         </receiver>
         <meta-data android:name="JPUSH_CHANNEL" android:value="developer-default" />
-        <meta-data android:name="JPUSH_APPKEY" android:value="your_jpush_appkey" />
+        <meta-data android:name="JPUSH_APPKEY" android:value="d644d997f2cab0551ff704a3" />
     </application>
-    <uses-sdk android:minSdkVersion="19" android:targetSdkVersion="28" />
     <uses-permission android:name="android.permission.USE_FINGERPRINT" />
     <uses-permission android:name="android.permission.WRITE_EXTERNAL_STORAGE" />
     <uses-permission android:name="android.permission.CAMERA" android:required="false" />
@@ -93,7 +92,6 @@
     <uses-permission android:name="android.permission.RECEIVE_USER_PRESENT" />
     <uses-permission android:name="android.permission.READ_PHONE_STATE" />
     <uses-permission android:name="android.permission.READ_EXTERNAL_STORAGE" />
-    <uses-permission android:name="android.permission.MOUNT_UNMOUNT_FILESYSTEMS" />
     <uses-permission android:name="android.permission.ACCESS_NETWORK_STATE" />
     <uses-permission android:name="android.permission.ACCESS_WIFI_STATE" />
     <uses-permission android:name="android.permission.VIBRATE" />
diff --git a/platforms/android/app/src/main/assets/www/billdetail.html b/platforms/android/app/src/main/assets/www/billdetail.html
index e419a98..8289dbf 100644
--- a/platforms/android/app/src/main/assets/www/billdetail.html
+++ b/platforms/android/app/src/main/assets/www/billdetail.html
@@ -16,7 +16,7 @@
 
 <body>
     <header class="aui-bar aui-bar-nav" style="padding-top:25px;">
-        <a class="aui-pull-left" href="javascript:window.history.go(-1)">
+        <a class="aui-pull-left" href="javascript:app.toBack();">
             <span class="aui-iconfont aui-icon-left"></span>
         </a>
         <div class="aui-title">账单详情</div>
diff --git a/platforms/android/app/src/main/assets/www/cordova_plugins.js b/platforms/android/app/src/main/assets/www/cordova_plugins.js
index 595ecb1..ee6832d 100644
--- a/platforms/android/app/src/main/assets/www/cordova_plugins.js
+++ b/platforms/android/app/src/main/assets/www/cordova_plugins.js
@@ -327,6 +327,14 @@
       "clobbers": [
         "JPush"
       ]
+    },
+    {
+      "id": "cordova-plugin-app-version.AppVersionPlugin",
+      "file": "plugins/cordova-plugin-app-version/www/AppVersionPlugin.js",
+      "pluginId": "cordova-plugin-app-version",
+      "clobbers": [
+        "cordova.getAppVersion"
+      ]
     }
   ];
   module.exports.metadata = {
@@ -344,6 +352,8 @@
     "cordova-plugin-device": "2.0.2",
     "cordova-plugin-themeablebrowser": "0.2.17",
     "cordova-plugin-jcore": "1.3.0",
-    "jpush-phonegap-plugin": "3.7.2"
+    "jpush-phonegap-plugin": "3.7.2",
+    "cordova-plugin-app-version": "0.1.9",
+    "cordova-plugin-wkwebview-engine": "1.2.1"
   };
 });
\ No newline at end of file
diff --git a/platforms/android/app/src/main/assets/www/js/billdetail.js b/platforms/android/app/src/main/assets/www/js/billdetail.js
index 3615234..51579aa 100644
--- a/platforms/android/app/src/main/assets/www/js/billdetail.js
+++ b/platforms/android/app/src/main/assets/www/js/billdetail.js
@@ -9,7 +9,8 @@
         this.loadBill()
     },
     toBack: function (){
-        window.history.back();
+        //window.history.back();
+        window.history.go(-1)
     },
     loadBill: function() {
         var refno = window.localStorage.getItem("currentrefno");
diff --git a/platforms/android/app/src/main/assets/www/js/index.js b/platforms/android/app/src/main/assets/www/js/index.js
index 112a927..db3d7ce 100644
--- a/platforms/android/app/src/main/assets/www/js/index.js
+++ b/platforms/android/app/src/main/assets/www/js/index.js
@@ -34,15 +34,10 @@
                 console.log(ret)
                 if (ok) {
                     if(ret.code==200){
-                        var exp =  window.localStorage.getItem("tokenexpire");
-                        var t = parseInt(exp);
-                        //token 小于10分钟了,需要刷新
-                        console.log((ret.now-t))
-                        if(ret.now-t>1000*60*10){
-                             window.location = "login.html";
-                        }else{
-                             window.location = "main.html";
+                        if(!isEmpty(ret.token)){
+                             window.localStorage.setItem("token",ret.token); 
                         }
+                        window.location = "main.html";
                     }else{
                         window.location = "login.html";
                     }
diff --git a/platforms/android/app/src/main/assets/www/js/login.js b/platforms/android/app/src/main/assets/www/js/login.js
index 77b8b2a..7931a48 100644
--- a/platforms/android/app/src/main/assets/www/js/login.js
+++ b/platforms/android/app/src/main/assets/www/js/login.js
@@ -33,7 +33,8 @@
         $.showLoading("登录中");
         var param={
             "username":phone,
-            "password":pwd
+            "password":pwd,
+            "platform":device.platform
         }
         Login(param,function(ok,ret){
             console.log(ret)
@@ -47,6 +48,7 @@
                  window.localStorage.setItem("phone",phone); 
                  window.localStorage.setItem("phoneX",ret.phone);
                  window.localStorage.setItem("token",ret.token); 
+                 window.localStorage.setItem("uid",ret.uid); 
                  window.localStorage.setItem("tenantid",ret.tenantid); 
                  window.localStorage.setItem("tokenexpire",ret.expire); 
                  window.localStorage.setItem("tokentime",ret.now); 
diff --git a/platforms/android/app/src/main/assets/www/js/main.js b/platforms/android/app/src/main/assets/www/js/main.js
index 3b01a2a..da93b6c 100644
--- a/platforms/android/app/src/main/assets/www/js/main.js
+++ b/platforms/android/app/src/main/assets/www/js/main.js
@@ -4,11 +4,52 @@
     initialize: function() {
         this.initTab();
         document.addEventListener('deviceready', this.onDeviceReady.bind(this), false);
+        document.addEventListener('jpush.receiveRegistrationId', function(event) {
+             console.log(event.registrationId)
+        }, false)
+        document.addEventListener("jpush.openNotification", function (event) {
+          var refno
+          console.log("openNotify:"+event);
+          if(device.platform == "Android") {
+            refno = event.extras.refno
+          } else {
+            refno = event.refno
+            window.JPush.setApplicationIconBadgeNumber(0);
+          }
+          app.openBill(refno);
+          console.log("openNotify:"+refno);
+        }, false)
+    },
+    openBill:function(billno){
+        window.localStorage.setItem("currentrefno",billno);
+        window.location='billdetail.html';
+    },
+    initJpush: function() {
+        if(device.platform == "Android") {
+        } else {
+         window.JPush.setApplicationIconBadgeNumber(0);
+        }
+        window.JPush.init();
+        window.JPush.setDebugMode(true);
+        window.JPush.isPushStopped(function(result) {
+            if (result == 0) {
+                //window.JPush.resumePush();
+            } else {
+                window.JPush.resumePush();
+            }
+        });
+        window.JPush.getUserNotificationSettings(function(result) {
+          if(result == 0) {
+          } else if(result > 0) {
+          }
+         });
+        var uid = window.localStorage.getItem("uid");
+
     },
 
     onDeviceReady: function() {
         var uid = window.localStorage.getItem("token");
-        console.log(CURRENT_INDEX);
+        this.initJpush();
         $('#scanBtn').click(function() {
             //window.location = "scan.html";
             app.checkBefore(function() {
@@ -42,11 +83,12 @@
             })
         });
         $('#secBtn').click(function() {
-            app.checkBefore(function() {
+            window.location = "security.html";
+            /*app.checkBefore(function() {
                 app.checkOther(function() {
                     window.location = "security.html";
                 })
-            })
+            })*/
         });
         $('#usersec').click(function() {
             app.checkBefore(function() {
@@ -57,22 +99,23 @@
         });
         this.initData();
     },
-    initTab:function(){
+    initTab: function() {
         $("#maincontent").css("top", $("#maintop").height())
         var tab = new auiTab({
             element: document.getElementById("footer"),
         }, function(ret) {
-            window.localStorage.setItem("tabindex",ret.index); 
-            
+            window.localStorage.setItem("tabindex", ret.index);
+
             changeTab(ret.index);
         });
-        var tabindex =  window.localStorage.getItem("tabindex"); 
-        if(!tabindex||tabindex==0){
+        var tabindex = window.localStorage.getItem("tabindex");
+        if (!tabindex || tabindex == 0) {
             tabindex = 1
         }
         changeTab(tabindex);
         tab.setActive(tabindex)
-        function changeTab(index){
+
+        function changeTab(index) {
             if (index == 1) {
                 $("#main1").show();
                 $("#main2").hide();
@@ -93,8 +136,9 @@
         }
         V1Bills(param, function(ok, ret) {
             if (ok) {
-                console.log(ret)
+                //console.log(ret)
                 if (ret.code == 200) {
+                    app.checkVersion(ret.version,ret.minversion,ret.versionmsg);
                     $("#maingt").text(ret.t + "!")
                     $("#user-amount").text(ret.amount)
                     $("#user-point").text(ret.point)
@@ -131,7 +175,17 @@
             }
         })
     },
-
+    checkVersion:function(ver,minver,msg){
+        cordova.getAppVersion.getVersionNumber(function (version) {
+            //alert(version);
+            if(version<minver){
+                //TODO 强制升级
+                alert("当前版本过低,为了不影响您的使用,请先升级");
+            }else if(ver>version){
+                alert("有新的版本");    
+            }
+        });
+    },
     initBillView: function(page) {
         var html = '';
         for (var i = 0; i < page.data.length; i++) {
@@ -255,4 +309,4 @@
         }
     }
 };
-app.initialize();
\ No newline at end of file
+app.initialize();
diff --git a/platforms/android/app/src/main/assets/www/js/register.js b/platforms/android/app/src/main/assets/www/js/register.js
index e0214ab..d10558e 100644
--- a/platforms/android/app/src/main/assets/www/js/register.js
+++ b/platforms/android/app/src/main/assets/www/js/register.js
@@ -33,7 +33,6 @@
                 $.hideLoading();
                 console.log(ret)
                 if(ret.code==200){
-                     
                      window.localStorage.setItem("phone",phone); 
                      window.localStorage.setItem("uid",ret.uid); 
                      window.localStorage.setItem("code",ret.randcode); 
diff --git a/platforms/android/app/src/main/assets/www/js/scan.js b/platforms/android/app/src/main/assets/www/js/scan.js
index e75eba8..cc50c0b 100644
--- a/platforms/android/app/src/main/assets/www/js/scan.js
+++ b/platforms/android/app/src/main/assets/www/js/scan.js
@@ -32,9 +32,9 @@
                         $.alert('扫描出错,请稍后再试:' + JSON.stringify(err), '提示');
                     } else {
                         // The scan completed, display the contents of the QR code:
+                        QRScanner.destroy();
                         //$.alert(text, '提示');
                         showRet(text);
-                        QRScanner.destroy();
                     }
                 }
                 //开始扫描,需要将页面的背景设置成透明
@@ -66,22 +66,55 @@
         });
     },
     goPage: function() {
-        QRScanner.destroy();
         window.location = "main.html"
     }
 };
 app.initialize();
 var inAppBrowserRef;
-function showRet(url) {
+function showRet(url){
+  if(isEmpty(url)){
+      return;
+  }
+  var userid = window.localStorage.getItem("userid");
+  if (url.indexOf("yy.dlsmk.cn")>=0) {
+    if(url.indexOf("?")>0){
+        url=url+'&userid='+userid;
+    }else{
+        url=url+'?userid='+userid;
+    }
+  }
+  var ref = cordova.InAppBrowser.open(url, '_blank',"location=yes,beforeload=yes");
+  ref.addEventListener('loadstart', function(params){
+     if (params.url.indexOf("yy.dlsmk.cn")>=0) {
+       if (params.url.indexOf("userid")<0) {
+           if(params.url.indexOf("?")>0){
+               params.url=params.url+'&userid='+userid;
+           }else{
+               params.url=params.url+'?userid='+userid;
+           }
+           ref.hide();
+           var neRef = cordova.InAppBrowser.open(params.url, '_blank',"location=yes,beforeload=yes");
+           neRef.addEventListener('exit', function(e){
+               ref.close();
+               window.location = "main.html"
+           });
+       }
+     }
+  });
+  //ref.show();
+}
+
+function showRet1(url) {
     if(isEmpty(url)){
         return;
     }
     var userid = window.localStorage.getItem("userid"); 
     if(url.indexOf("?")>0){
-        url=url+'&uid='+userid;
+        url=url+'&userid='+userid;
     }else{
-        url=url+'?uid='+userid;
+        url=url+'?userid='+userid;
     }
+    console.log(url)
     inAppBrowserRef = cordova.ThemeableBrowser.open(url, '_blank', {
         statusbar: {
             color: '#03a9f4ff'
@@ -95,14 +128,14 @@
             showPageTitle: true
         },
         backButton: {
-            image: 'back.png',
-            imagePressed: 'back.png',
+            wwwImage: 'img/back.png',
+            wwwImagePressed: 'img/back.png',
             align: 'left',
             event: 'backPressed'
         },
         closeButton: {
-            image: 'close.png',
-            imagePressed: 'close.png',
+            wwwImage: 'img/close.png',
+            wwwImagePressed: 'img/close.png',
             align: 'left',
             event: 'closePressed'
         },
@@ -117,13 +150,60 @@
         console.error(e.message);
     }).addEventListener(cordova.ThemeableBrowser.EVT_WRN, function(e) {
         console.log(e.message);
+    }).addEventListener('loadstart', function(params,e){
+      console.log("11111111"+JSON.stringify(params));
+      if (params.url.indexOf("yy.dlsmk.cn")>=0) {
+        if (params.url.indexOf("userid")<0) {
+            if(params.url.indexOf("?")>0){
+                params.url=params.url+'&userid='+userid;
+            }else{
+                params.url=params.url+'?userid='+userid;
+            }
+            inAppBrowserRef.close();
+            inAppBrowserRef = null;
+            openUrl(params.url);
+        }
+      }
     });
-    inAppBrowserRef.addEventListener('loadstart', loadStartCallBack);
-    inAppBrowserRef.addEventListener('beforeload', beforeloadCallBack);
+    //inAppBrowserRef.addEventListener('loadstart', loadStartCallBack);
+    //inAppBrowserRef.addEventListener('beforeload', beforeloadCallBack);
 }
-function loadStartCallBack(params,callback) {
-    console.log("1",params.url);
-}
-function beforeloadCallBack(params,callback) {
-    console.log("2",params.url);
+
+function openUrl(url){
+      inAppBrowserRef = cordova.ThemeableBrowser.open(url, '_blank', {
+          statusbar: {
+              color: '#03a9f4ff'
+          },
+          toolbar: {
+              height: 44,
+              color: '#03a9f4ff'
+          },
+          title: {
+              color: '#ffffffff',
+              showPageTitle: true
+          },
+          backButton: {
+              wwwImage: 'img/back.png',
+              wwwImagePressed: 'img/back.png',
+              align: 'left',
+              event: 'backPressed'
+          },
+          closeButton: {
+              wwwImage: 'img/close.png',
+              wwwImagePressed: 'img/close.png',
+              align: 'left',
+              event: 'closePressed'
+          },
+          backButtonCanClose: true
+      }).addEventListener('backPressed', function(e) {
+      }).addEventListener('closePressed', function(e) {
+          inAppBrowserRef.close();
+          window.location = "main.html"
+      }).addEventListener(cordova.ThemeableBrowser.EVT_ERR, function(e) {
+          console.error(e.message);
+      }).addEventListener(cordova.ThemeableBrowser.EVT_WRN, function(e) {
+          console.log(e.message);
+      }).addEventListener('loadstart', function(params,e){
+          console.log("333333"+JSON.stringify(params));
+      });
 }
diff --git a/platforms/android/app/src/main/assets/www/js/server.js b/platforms/android/app/src/main/assets/www/js/server.js
index 2bd6a73..c8eb688 100644
--- a/platforms/android/app/src/main/assets/www/js/server.js
+++ b/platforms/android/app/src/main/assets/www/js/server.js
@@ -1,11 +1,12 @@
-var dev = true;
-var SERVER = "http://ykt.supwisdom.com:10010/payapi/mobileapi";
+var dev = false;
+var SERVER = "https://yy.dlsmk.cn/payapi/mobileapi";
 var GLOBAL_TODAY="";
 var GLOBAL_YESTERDAY="";
 var CURRENT_INDEX=1;
 if (dev) {
-    SERVER = "http://172.28.43.3:8099/payapi/mobileapi";
+    SERVER = "http://172.28.201.70:10010/payapi/mobileapi";
 }
+
 function V1Qrcode(callback) {
     ajaxPost("/v1/qrcode", {}, callback)
 }
diff --git a/platforms/android/app/src/main/assets/www/register.html b/platforms/android/app/src/main/assets/www/register.html
index 640b3ee..34e5998 100644
--- a/platforms/android/app/src/main/assets/www/register.html
+++ b/platforms/android/app/src/main/assets/www/register.html
@@ -15,7 +15,7 @@
 </head>
 <body>
     <header class="aui-bar aui-bar-nav" style="padding-top:25px;">
-        <a class="aui-pull-left" href="javascript:window.history.back()">
+        <a class="aui-pull-left" href="login.html">
             <span class="aui-iconfont aui-icon-left"></span>
         </a>
         <div class="aui-title">注册</div>
diff --git a/platforms/android/app/src/main/assets/www/security.html b/platforms/android/app/src/main/assets/www/security.html
index 049a988..39a40ca 100644
--- a/platforms/android/app/src/main/assets/www/security.html
+++ b/platforms/android/app/src/main/assets/www/security.html
@@ -50,7 +50,7 @@
                 </div>
             </li>
         </ul>
-         <div style="padding: 20px;margin-top: 40px;">
+        <div style="padding: 20px;margin-top: 40px;">
             <a href="javascript:app.logout();" class="weui-btn weui-btn_warn">退出登录</a>
         </div>
     </section>
diff --git a/platforms/android/app/src/main/java/com/bitpay/cordova/qrscanner/QRScanner.java b/platforms/android/app/src/main/java/com/bitpay/cordova/qrscanner/QRScanner.java
index f2e37d7..c5cfe08 100755
--- a/platforms/android/app/src/main/java/com/bitpay/cordova/qrscanner/QRScanner.java
+++ b/platforms/android/app/src/main/java/com/bitpay/cordova/qrscanner/QRScanner.java
@@ -9,12 +9,11 @@
 import android.net.Uri;
 
 import com.google.zxing.BarcodeFormat;
-import com.google.zxing.ResultPoint;
-import com.journeyapps.barcodescanner.BarcodeCallback;
-import com.journeyapps.barcodescanner.BarcodeResult;
 import com.journeyapps.barcodescanner.BarcodeView;
-import com.journeyapps.barcodescanner.DefaultDecoderFactory;
 import com.journeyapps.barcodescanner.camera.CameraSettings;
+import com.visionsmarts.VSBarcodeReader;
+import com.visionsmarts.pic2shop.view.ScannerLiveView;
+
 import org.apache.cordova.CallbackContext;
 import org.apache.cordova.CordovaPlugin;
 import org.apache.cordova.PluginResult;
@@ -35,8 +34,8 @@
 
 
 @SuppressWarnings("deprecation")
-public class QRScanner extends CordovaPlugin implements BarcodeCallback {
-
+public class QRScanner extends CordovaPlugin  {
+    private ScannerLiveView scannerLiveView;
     private CallbackContext callbackContext;
     private boolean cameraClosing;
     private static Boolean flashAvailable;
@@ -60,7 +59,49 @@
     private boolean oneTime = true;
     private boolean keepDenied = false;
     private boolean appPausedWithActivePreview = false;
-    
+    private ScannerLiveView.Listener listener = new ScannerLiveView.Listener() {
+        @Override
+        public void onCodeScanned(String str, String data) {
+            if (nextScanCallback == null) {
+                return;
+            }
+
+            if(data != null) {
+                scanning = false;
+                nextScanCallback.success(data);
+                nextScanCallback = null;
+            }
+            else {
+                scan(nextScanCallback);
+            }
+        }
+
+        @Override
+        public void onCameraIssue() {
+
+        }
+    };
+
+    public void onCodeScanned(String type, String data) {
+        //PluginResult result = new PluginResult(PluginResult.Status.OK, data);
+        //callbackContext.sendPluginResult(result);
+        if (this.nextScanCallback == null) {
+            return;
+        }
+
+        if(data != null) {
+            scanning = false;
+            this.nextScanCallback.success(data);
+            this.nextScanCallback = null;
+        }
+        else {
+            scan(this.nextScanCallback);
+        }
+    }
+    public void onCameraIssue() {
+
+    }
+
     static class QRScannerError {
         private static final int UNEXPECTED_ERROR = 0,
                 CAMERA_ACCESS_DENIED = 1,
@@ -293,6 +334,13 @@
                     else
                         lightOn = false;
                 }
+                if(scannerLiveView!=null){
+                    scannerLiveView.setTorch(toggleLight);
+                    if (toggleLight)
+                        lightOn = true;
+                    else
+                        lightOn = false;
+                }
                 getStatus(callbackContext);
             }
         });
@@ -451,25 +499,29 @@
             @Override
             public void run() {
                 // Create our Preview view and set it as the content of our activity.
-                mBarcodeView = new BarcodeView(cordova.getActivity());
+                //mBarcodeView = new BarcodeView(cordova.getActivity());
+                scannerLiveView = new ScannerLiveView(cordova.getActivity(),listener);
 
+                VSBarcodeReader.VSinit();
+                VSBarcodeReader.setBlurryAcceptanceThresholdWithAF(0.0d);
                 //Configure the decoder
                 ArrayList<BarcodeFormat> formatList = new ArrayList<BarcodeFormat>();
                 formatList.add(BarcodeFormat.QR_CODE);
-                mBarcodeView.setDecoderFactory(new DefaultDecoderFactory(formatList, null, null));
+                //mBarcodeView.setDecoderFactory(new DefaultDecoderFactory(formatList, null, null));
 
                 //Configure the camera (front/back)
                 CameraSettings settings = new CameraSettings();
                 settings.setRequestedCameraId(getCurrentCameraId());
-                mBarcodeView.setCameraSettings(settings);
+                //mBarcodeView.setCameraSettings(settings);
 
                 FrameLayout.LayoutParams cameraPreviewParams = new FrameLayout.LayoutParams(FrameLayout.LayoutParams.WRAP_CONTENT, FrameLayout.LayoutParams.WRAP_CONTENT);
-                ((ViewGroup) webView.getView().getParent()).addView(mBarcodeView, cameraPreviewParams);
-
+                //((ViewGroup) webView.getView().getParent()).addView(mBarcodeView, cameraPreviewParams);
+                ((ViewGroup) webView.getView().getParent()).addView(scannerLiveView, cameraPreviewParams);
                 cameraPreviewing = true;
                 webView.getView().bringToFront();
 
-                mBarcodeView.resume();
+                //mBarcodeView.resume();
+                //scannerLiveView.onResume();
             }
         });
         prepared = true;
@@ -479,7 +531,7 @@
 
     }
 
-    @Override
+    /*@Override
     public void barcodeResult(BarcodeResult barcodeResult) {
         if (this.nextScanCallback == null) {
             return;
@@ -497,7 +549,7 @@
 
     @Override
     public void possibleResultPoints(List<ResultPoint> list) {
-    }
+    }*/
 
     // ---- BEGIN EXTERNAL API ----
     private void prepare(final CallbackContext callbackContext) {
@@ -588,7 +640,7 @@
             }
             shouldScanAgain = false;
             this.nextScanCallback = callbackContext;
-            final BarcodeCallback b = this;
+            /*final BarcodeCallback b = this;
             this.cordova.getActivity().runOnUiThread(new Runnable() {
                 @Override
                 public void run() {
@@ -596,7 +648,11 @@
                         mBarcodeView.decodeSingle(b);
                     }
                 }
-            });
+            });*/
+
+            if(scannerLiveView!=null){
+                scannerLiveView.onResume();
+            }
         }
     }
 
@@ -620,6 +676,9 @@
             @Override
             public void run() {
                 webView.getView().setBackgroundColor(Color.argb(1, 0, 0, 0));
+                if(scannerLiveView!=null){
+                    scannerLiveView.startCamera();
+                }
                 showing = true;
                 getStatus(callbackContext);
             }
@@ -777,8 +836,10 @@
             this.cordova.getActivity().runOnUiThread(new Runnable() {
                 @Override
                 public void run() {
+                  if(mBarcodeView!=null) {
                     ((ViewGroup) mBarcodeView.getParent()).removeView(mBarcodeView);
                     cameraPreviewing = false;
+                  }
                 }
             });
         }
@@ -788,6 +849,9 @@
         }
         closeCamera();
         currentCameraId = 0;
+        if(scannerLiveView!=null){
+          scannerLiveView.onPause();
+        }
         getStatus(callbackContext);
     }
 }
diff --git a/platforms/android/app/src/main/java/com/supwisdom/dlapp/MainActivity.java b/platforms/android/app/src/main/java/com/dalicitycard/app/MainActivity.java
similarity index 97%
rename from platforms/android/app/src/main/java/com/supwisdom/dlapp/MainActivity.java
rename to platforms/android/app/src/main/java/com/dalicitycard/app/MainActivity.java
index c48c351..7b7fe6b 100644
--- a/platforms/android/app/src/main/java/com/supwisdom/dlapp/MainActivity.java
+++ b/platforms/android/app/src/main/java/com/dalicitycard/app/MainActivity.java
@@ -17,7 +17,7 @@
        under the License.
  */
 
-package com.supwisdom.dlapp;
+package com.dalicitycard.app;
 
 import android.os.Bundle;
 import org.apache.cordova.*;
diff --git a/platforms/android/app/src/main/java/com/visionsmarts/VSBarcodeReader.java b/platforms/android/app/src/main/java/com/visionsmarts/VSBarcodeReader.java
new file mode 100644
index 0000000..feb3b33
--- /dev/null
+++ b/platforms/android/app/src/main/java/com/visionsmarts/VSBarcodeReader.java
@@ -0,0 +1,90 @@
+package com.visionsmarts;
+
+public class VSBarcodeReader {
+    public static final int BARCODE_TYPE_CODABAR = 64;
+    public static final int BARCODE_TYPE_CODE128 = 32;
+    public static final int BARCODE_TYPE_CODE39 = 16;
+    public static final int BARCODE_TYPE_CODE93 = 128;
+    public static final int BARCODE_TYPE_EAN_13_UPC_A = 1;
+    public static final int BARCODE_TYPE_EAN_8 = 2;
+    public static final String BARCODE_TYPE_ID_CODABAR = "CODABAR";
+    public static final String BARCODE_TYPE_ID_CODE128 = "CODE128";
+    public static final String BARCODE_TYPE_ID_CODE39 = "CODE39";
+    public static final String BARCODE_TYPE_ID_CODE93 = "CODE93";
+    public static final String BARCODE_TYPE_ID_EAN_13_UPC_A = "EAN13";
+    public static final String BARCODE_TYPE_ID_EAN_8 = "EAN8";
+    public static final String BARCODE_TYPE_ID_ITF = "ITF";
+    public static final String BARCODE_TYPE_ID_STD2OF5 = "STD2OF5";
+    public static final String BARCODE_TYPE_ID_UPC_E = "UPCE";
+    public static final int BARCODE_TYPE_INVALID = -1;
+    public static final int BARCODE_TYPE_ITF = 8;
+    public static final String BARCODE_TYPE_NAME_CODABAR = "Codabar";
+    public static final String BARCODE_TYPE_NAME_CODE128 = "Code 128";
+    public static final String BARCODE_TYPE_NAME_CODE39 = "Code 39";
+    public static final String BARCODE_TYPE_NAME_CODE93 = "Code 93";
+    public static final String BARCODE_TYPE_NAME_EAN_13_UPC_A = "EAN-13/UPC-A";
+    public static final String BARCODE_TYPE_NAME_EAN_8 = "EAN-8";
+    public static final String BARCODE_TYPE_NAME_ITF = "ITF";
+    public static final String BARCODE_TYPE_NAME_STD2OF5 = "STD 2 of 5";
+    public static final String BARCODE_TYPE_NAME_UPC_E = "UPC-E";
+    public static final int BARCODE_TYPE_STD2OF5 = 256;
+    public static final int BARCODE_TYPE_UPC_E = 4;
+
+    public static class DecoderValues {
+        public int evaluationDays;
+        public int left;
+        public Point lineEnd;
+        public Point lineStart;
+        public int right;
+        public int type;
+
+        public DecoderValues() {
+            this.lineStart = new Point();
+            this.lineEnd = new Point();
+        }
+    }
+
+    public static class Point {
+        public int x;
+        public int y;
+    }
+
+    public static native int VSinit();
+
+    public static native String decodeNextImage(byte[] bArr, int i, int i2, DecoderValues decoderValues);
+
+    public static native String decodeNextImageOmnidirectional(byte[] bArr, int i, int i2, int i3, DecoderValues decoderValues);
+
+    public static native int reset();
+
+    public static native int setBlurryAcceptanceThresholdWithAF(double d);
+
+    static {
+        System.loadLibrary("VSBarcodeReader");
+    }
+
+    public static String format(String barcode, int type) {
+        Object[] objArr;
+        switch (type) {
+            case BARCODE_TYPE_EAN_13_UPC_A /*1*/:
+                if (barcode.substring(0, BARCODE_TYPE_EAN_13_UPC_A).equals("0")) {
+                    objArr = new Object[BARCODE_TYPE_UPC_E];
+                    objArr[0] = barcode.substring(BARCODE_TYPE_EAN_13_UPC_A, BARCODE_TYPE_EAN_8);
+                    objArr[BARCODE_TYPE_EAN_13_UPC_A] = barcode.substring(BARCODE_TYPE_EAN_8, 7);
+                    objArr[BARCODE_TYPE_EAN_8] = barcode.substring(7, 12);
+                    objArr[3] = barcode.substring(12, 13);
+                    return String.format("%s-%s-%s-%s", objArr);
+                }
+                return String.format("%s-%s-%s", new Object[]{barcode.substring(0, BARCODE_TYPE_EAN_13_UPC_A), barcode.substring(BARCODE_TYPE_EAN_13_UPC_A, 7), barcode.substring(7, 13)});
+            case BARCODE_TYPE_EAN_8 /*2*/:
+                objArr = new Object[BARCODE_TYPE_EAN_8];
+                objArr[0] = barcode.substring(0, BARCODE_TYPE_UPC_E);
+                objArr[BARCODE_TYPE_EAN_13_UPC_A] = barcode.substring(BARCODE_TYPE_UPC_E, BARCODE_TYPE_ITF);
+                return String.format("%s-%s", objArr);
+            case BARCODE_TYPE_UPC_E /*4*/:
+                return String.format("%s-%s-%s", new Object[]{barcode.substring(0, BARCODE_TYPE_EAN_13_UPC_A), barcode.substring(BARCODE_TYPE_EAN_13_UPC_A, 7), barcode.substring(7, BARCODE_TYPE_ITF)});
+            default:
+                return barcode;
+        }
+    }
+}
diff --git a/platforms/android/app/src/main/java/com/visionsmarts/VSReaderQR.java b/platforms/android/app/src/main/java/com/visionsmarts/VSReaderQR.java
new file mode 100644
index 0000000..12acf68
--- /dev/null
+++ b/platforms/android/app/src/main/java/com/visionsmarts/VSReaderQR.java
@@ -0,0 +1,190 @@
+package com.visionsmarts;
+
+import java.nio.ByteBuffer;
+import java.nio.charset.CharacterCodingException;
+import java.nio.charset.Charset;
+
+public class VSReaderQR {
+    public static final int MODE_ALPHANUMERIC = 2;
+    public static final int MODE_BYTE = 4;
+    public static final int MODE_KANJI = 8;
+    public static final int MODE_NUMERIC = 1;
+    public static final String QR_CODE_TYPE_ID = "QR";
+
+    public static class DecoderValues {
+        public Point corner1;
+        public Point corner2;
+        public Point corner3;
+        public Point corner4;
+        public int evaluationDays;
+        public int mode;
+
+        public DecoderValues() {
+            this.corner1 = new Point();
+            this.corner2 = new Point();
+            this.corner3 = new Point();
+            this.corner4 = new Point();
+        }
+    }
+
+    private static class ECIMarker {
+        public int eci;
+        public int position;
+
+        private ECIMarker() {
+        }
+    }
+
+    public static class Point {
+        public int x;
+        public int y;
+    }
+
+    public static native byte[] decodeImage(byte[] bArr, int i, int i2, DecoderValues decoderValues);
+
+    static {
+        System.loadLibrary("VSReaderQR");
+    }
+
+    public static String format(byte[] data, int mode) {
+        Charset charset = Charset.forName("UTF-8");
+        if ((mode & MODE_KANJI) == MODE_KANJI) {
+            charset = Charset.forName("Shift_JIS");
+        }
+        int position = 0;
+        if (data.length > 3 && data[0] == 93 && data[MODE_NUMERIC] == 81) {
+            if (data[MODE_ALPHANUMERIC] == 51 || data[MODE_ALPHANUMERIC] == 52) {
+                position = 0 + 3;
+            }
+            if ((data[MODE_ALPHANUMERIC] == 53 || data[MODE_ALPHANUMERIC] == 54) && data.length > 5) {
+                position += 5;
+            }
+        }
+        StringBuilder result = new StringBuilder(data.length);
+        do {
+            ECIMarker nextMarker = findFirstECIMarker(data, position);
+            String next = decodeData(ByteBuffer.wrap(data, position, Math.min(nextMarker.position, data.length) - position), charset);
+            if (next != null) {
+                result.append(next);
+            }
+            if (nextMarker.position != data.length) {
+                position = nextMarker.position + 7;
+                charset = getCharsetForECI(nextMarker.eci);
+                if (charset == null) {
+                    charset = getCharsetForECI(0);
+                }
+            }
+            if (nextMarker.position == data.length) {
+                break;
+            }
+        } while (position < data.length);
+        return result.toString();
+    }
+
+    private static ECIMarker findFirstECIMarker(byte[] data, int fromPosition) {
+        ECIMarker eciMarker = new ECIMarker();
+        eciMarker.position = data.length;
+        int position = fromPosition;
+        while (position < data.length - 6) {
+            if (data[position] == 92 && Character.isDigit(data[position + MODE_NUMERIC]) && Character.isDigit(data[position + MODE_ALPHANUMERIC]) && Character.isDigit(data[position + 3]) && Character.isDigit(data[position + MODE_BYTE]) && Character.isDigit(data[position + 5]) && Character.isDigit(data[position + 6])) {
+                eciMarker.position = position;
+                eciMarker.eci = ((((((data[position + MODE_NUMERIC] - 48) * 100000) + ((data[position + MODE_ALPHANUMERIC] - 48) * 10000)) + ((data[position + 3] - 48) * 1000)) + ((data[position + MODE_BYTE] - 48) * 100)) + ((data[position + 5] - 48) * 10)) + (data[position + 6] - 48);
+                break;
+            }
+            position += MODE_NUMERIC;
+        }
+        return eciMarker;
+    }
+
+    private static Charset getCharsetForECI(int eci) {
+        switch (eci) {
+
+            case MODE_NUMERIC /*1*/:
+                return Charset.forName("ISO-8859-1");
+            case MODE_ALPHANUMERIC /*2*/:
+                return Charset.forName("ISO-8859-1");
+            case MODE_BYTE /*4*/:
+                return Charset.forName("ISO-8859-2");
+            case 5:
+                return Charset.forName("ISO-8859-3");
+            case 6:
+                return Charset.forName("ISO-8859-4");
+            case 7:
+                return Charset.forName("ISO-8859-5");
+            case MODE_KANJI /*8*/:
+                return Charset.forName("ISO-8859-6");
+            case 9:
+                return Charset.forName("ISO-8859-7");
+            case 10:
+                return Charset.forName("ISO-8859-8");
+            case 11:
+                return Charset.forName("ISO-8859-9");
+            case 12:
+                return Charset.forName("ISO-8859-10");
+            case 13:
+                return Charset.forName("ISO-8859-11");
+            case 15:
+                return Charset.forName("ISO-8859-13");
+            case VSBarcodeReader.BARCODE_TYPE_CODE39 /*16*/:
+                return Charset.forName("ISO-8859-14");
+            case 17:
+                return Charset.forName("ISO-8859-15");
+            case 18:
+                return Charset.forName("ISO-8859-16");
+            case 20:
+                return Charset.forName("Shift_JIS");
+            case 21:
+                return Charset.forName("windows-1250");
+            case 22:
+                return Charset.forName("windows-1251");
+            case 23:
+                return Charset.forName("windows-1252");
+            case 24:
+                return Charset.forName("windows-1256");
+            case 25:
+                return Charset.forName("UTF-16BE");
+            case 26:
+                return Charset.forName("UTF-8");
+            case 27:
+                return Charset.forName("EUC-JP");
+            case 28:
+                return Charset.forName("Big5");
+            case 29:
+                return Charset.forName("x-EUC-CN");
+            case 30:
+                return Charset.forName("EUC-KR");
+            case 899:
+                return Charset.forName("UTF-8");
+            default:
+                return null;
+        }
+    }
+
+    public static String decodeData(ByteBuffer data, Charset charset) {
+        try {
+            return charset.newDecoder().decode(data).toString();
+        } catch (CharacterCodingException e) {
+            data.rewind();
+            try {
+                return Charset.forName("Shift_JIS").newDecoder().decode(data).toString();
+            } catch (CharacterCodingException e2) {
+                data.rewind();
+                try {
+                    return Charset.forName("UTF-8").newDecoder().decode(data).toString();
+                } catch (CharacterCodingException e3) {
+                    data.rewind();
+                    try {
+                        return Charset.forName("ISO-8859-1").newDecoder().decode(data).toString();
+                    } catch (CharacterCodingException e4) {
+                        data.rewind();
+                        try {
+                            return Charset.forName("US-ASCII").newDecoder().decode(data).toString();
+                        } catch (CharacterCodingException e5) {
+                            return null;
+                        }
+                    }
+                }
+            }
+        }
+    }
+}
diff --git a/platforms/android/app/src/main/java/com/visionsmarts/pic2shop/view/BarQrCodeUtil.java b/platforms/android/app/src/main/java/com/visionsmarts/pic2shop/view/BarQrCodeUtil.java
new file mode 100644
index 0000000..222d7e2
--- /dev/null
+++ b/platforms/android/app/src/main/java/com/visionsmarts/pic2shop/view/BarQrCodeUtil.java
@@ -0,0 +1,27 @@
+package com.visionsmarts.pic2shop.view;
+
+import com.visionsmarts.VSReaderQR;
+
+import java.nio.ByteBuffer;
+import java.nio.charset.Charset;
+
+public class BarQrCodeUtil {
+  public static String qrToString(byte[] qrData) {
+    ByteBuffer qrBuffer;
+    if (qrData[qrData.length - 1] == 0) {
+      qrBuffer = ByteBuffer.wrap(qrData, 0, qrData.length - 1);
+    } else {
+      qrBuffer = ByteBuffer.wrap(qrData);
+    }
+    return VSReaderQR.decodeData(qrBuffer, Charset.forName("UTF-8"));
+  }
+
+  public static final int DECODE = 100;
+  public static final int QUIT = 101;
+  public static final int NOTFOUND = 102;
+
+  public static final int BARCODE = 103;
+  public static final int QRCODE = 104;
+
+  public static final int AUTO_FOCUS = 105;
+}
diff --git a/platforms/android/app/src/main/java/com/visionsmarts/pic2shop/view/ScannerLiveView.java b/platforms/android/app/src/main/java/com/visionsmarts/pic2shop/view/ScannerLiveView.java
new file mode 100644
index 0000000..a45ba8b
--- /dev/null
+++ b/platforms/android/app/src/main/java/com/visionsmarts/pic2shop/view/ScannerLiveView.java
@@ -0,0 +1,784 @@
+package com.visionsmarts.pic2shop.view;
+
+import android.app.Activity;
+import android.content.Context;
+import android.graphics.ImageFormat;
+import android.graphics.Point;
+import android.hardware.Camera;
+import android.hardware.Camera.AutoFocusCallback;
+import android.hardware.Camera.Parameters;
+import android.hardware.Camera.PreviewCallback;
+import android.hardware.Camera.Size;
+import android.os.Handler;
+import android.os.Looper;
+import android.os.Message;
+import android.util.AttributeSet;
+import android.util.Log;
+import android.view.Display;
+import android.view.SurfaceHolder;
+import android.view.SurfaceHolder.Callback;
+import android.view.SurfaceView;
+import android.view.WindowManager;
+
+import com.google.zxing.client.android.camera.CameraConfigurationUtils;
+import com.visionsmarts.VSBarcodeReader;
+import com.visionsmarts.VSBarcodeReader.DecoderValues;
+import com.visionsmarts.VSReaderQR;
+
+import java.io.IOException;
+import java.util.regex.Pattern;
+
+public class ScannerLiveView extends SurfaceView implements Callback {
+    private Point screen;
+    private static final int BARCODE_TYPES_MASK = 7;
+    private static final Pattern COMMA_PATTERN;
+    private static final int DESIRED_ZOOM_X10 = 27;
+    private static final String TAG;
+    private AutoFocusCallback mAutoFocusCallback;
+    private volatile byte[] mCallbackBuffer;
+    private volatile Camera mCamera;
+    private DecodingThread mDecodingThread;
+    volatile boolean mFoundBarcodeOrQRCode;
+    volatile byte[] mFrameData;
+    volatile boolean mFrameDataIsAutoFocusInProgress;
+    volatile boolean mHasCameraAutoFocus;
+    volatile boolean mIsAutoFocusInProgress;
+    volatile boolean mIsPreviewStarted;
+    Listener mListener;
+    private PreviewCallback mPreviewCallback;
+    private int mPreviewFrameSize;
+    volatile Size mPreviewSize;
+    final ScannerHandler mScannerHandler;
+    private volatile int mCameraDisplayOrientation;
+
+    public interface Listener {
+        void onCodeScanned(String str, String str2);
+        void onCameraIssue();
+    }
+
+    /* renamed from: com.visionsmarts.pic2shop.view.ScannerLiveView.1 */
+    class ScanAutoFocusCallback implements AutoFocusCallback {
+        ScanAutoFocusCallback() {
+        }
+
+        public void onAutoFocus(boolean success, Camera camera) {
+            ScannerLiveView.this.mIsAutoFocusInProgress = false;
+        }
+    }
+
+    /* renamed from: com.visionsmarts.pic2shop.view.ScannerLiveView.2 */
+    class ScanPreviewCallback implements PreviewCallback {
+        ScanPreviewCallback() {
+        }
+
+        public synchronized void onPreviewFrame(byte[] frameData, Camera camera) {
+            if (!(!ScannerLiveView.this.mIsPreviewStarted || ScannerLiveView.this.mDecodingThread == null || ScannerLiveView.this.mFoundBarcodeOrQRCode)) {
+                boolean shouldSendDecodeRequest = ScannerLiveView.this.mFrameData == null;
+                ScannerLiveView.this.mFrameData = frameData;
+                ScannerLiveView.this.mFrameDataIsAutoFocusInProgress = ScannerLiveView.this.mIsAutoFocusInProgress;
+                if (shouldSendDecodeRequest) {
+                    ScannerLiveView.this.mDecodingThread.getHandler().obtainMessage(BarQrCodeUtil.DECODE).sendToTarget();
+                }
+            }
+        }
+    }
+
+    private class DecodingThread extends Thread {
+        DecoderValues mBarcodeDecoderValues;
+        private Handler mHandler;
+        private int mNumberConsecutiveFailedDecodingSinceFocusEnded;
+        private byte[] mPreviewLine;
+        VSReaderQR.DecoderValues mQRDecoderValues;
+
+        /* renamed from: com.visionsmarts.pic2shop.view.ScannerLiveView.DecodingThread.1 */
+        class DecodeMessageHandler extends Handler {
+            DecodeMessageHandler() {
+            }
+
+            public void handleMessage(Message message) {
+                switch (message.what) {
+                    case BarQrCodeUtil.DECODE:
+                        if (ScannerLiveView.this.mIsPreviewStarted && !ScannerLiveView.this.mFoundBarcodeOrQRCode) {
+                            DecodingThread.this.decode();
+                        }
+                        break;
+                    case BarQrCodeUtil.QUIT:
+                        Looper.myLooper().quit();
+                        break;
+                    default:
+                }
+            }
+        }
+
+        public DecodingThread() {
+            this.mNumberConsecutiveFailedDecodingSinceFocusEnded = 0;
+            this.mBarcodeDecoderValues = new DecoderValues();
+            this.mQRDecoderValues = new VSReaderQR.DecoderValues();
+            setPriority(10);
+            initialize();
+        }
+
+        synchronized Handler getHandler() {
+            if (this.mHandler == null) {
+                try {
+                    ScannerLiveView.this.mDecodingThread.wait(1000);
+                } catch (InterruptedException e) {
+                }
+            }
+            return this.mHandler;
+        }
+
+        public void initialize() {
+            if (ScannerLiveView.this.mPreviewSize != null && (this.mPreviewLine == null || this.mPreviewLine.length != ScannerLiveView.this.mPreviewSize.height)) {
+                this.mPreviewLine = new byte[ScannerLiveView.this.mPreviewSize.height];
+            }
+            this.mNumberConsecutiveFailedDecodingSinceFocusEnded = 0;
+            ScannerLiveView.this.mFoundBarcodeOrQRCode = false;
+            VSBarcodeReader.reset();
+        }
+
+        public void run() {
+            Looper.prepare();
+            synchronized (this) {
+                this.mHandler = new DecodeMessageHandler();
+                notify();
+            }
+            Looper.loop();
+        }
+
+        private void decode() {
+            byte[] previewLine = this.mPreviewLine;
+            int width = ScannerLiveView.this.mPreviewSize.width;
+            int height = ScannerLiveView.this.mPreviewSize.height;
+            synchronized (ScannerLiveView.this.mPreviewCallback) {
+                if (ScannerLiveView.this.mFrameData == null) {
+                    return;
+                }
+                byte[] frameData = ScannerLiveView.this.mFrameData;
+                boolean wasAutoFocusInProgress = ScannerLiveView.this.mFrameDataIsAutoFocusInProgress;
+                int offset  =  Math.round((float) (screen.y  / 2));
+                Log.e(TAG,"offset="+offset);
+                try {
+                    for (int i = previewLine.length - 1; i >= 0; i--) {
+                        previewLine[i] = frameData[offset];
+                        offset += width;
+                    }
+                } catch (ArrayIndexOutOfBoundsException e) {
+                }
+                if (ScannerLiveView.this.mFrameData != null) {
+                    String barcode = VSBarcodeReader.decodeNextImage(previewLine, ScannerLiveView.this.mHasCameraAutoFocus ? 1 : 0, ScannerLiveView.BARCODE_TYPES_MASK, this.mBarcodeDecoderValues);
+                    if (ScannerLiveView.this.mFrameData != null) {
+                        if (barcode.length() > 0) {
+                            ScannerLiveView.this.mFoundBarcodeOrQRCode = true;
+                            ScannerLiveView.this.mScannerHandler.obtainMessage(BarQrCodeUtil.BARCODE, barcode).sendToTarget();
+                        } else {
+                            try {
+                                byte[] qrData = VSReaderQR.decodeImage(frameData, width, height, this.mQRDecoderValues);
+                                if (qrData.length > 0) {
+                                    ScannerLiveView.this.mFoundBarcodeOrQRCode = true;
+                                    ScannerLiveView.this.mScannerHandler.obtainMessage(BarQrCodeUtil.QRCODE, qrData).sendToTarget();
+                                } else if (wasAutoFocusInProgress) {
+                                    this.mNumberConsecutiveFailedDecodingSinceFocusEnded = 0;
+                                } else {
+                                    this.mNumberConsecutiveFailedDecodingSinceFocusEnded++;
+                                    if (ScannerLiveView.this.mHasCameraAutoFocus && !ScannerLiveView.this.mIsAutoFocusInProgress && this.mNumberConsecutiveFailedDecodingSinceFocusEnded >= 4) {
+                                        ScannerLiveView.this.mScannerHandler.obtainMessage(BarQrCodeUtil.AUTO_FOCUS).sendToTarget();
+                                    }
+                                }
+                            }catch (Exception e){
+                                e.printStackTrace();
+                            }
+                        }
+                        synchronized (ScannerLiveView.this.mPreviewCallback) {
+                            ScannerLiveView.this.mFrameData = null;
+                            if (!(ScannerLiveView.this.mFoundBarcodeOrQRCode || ScannerLiveView.this.mCallbackBuffer == null)) {
+                                ScannerLiveView.this.mCamera.addCallbackBuffer(ScannerLiveView.this.mCallbackBuffer);
+                            }
+                        }
+                    }
+                }
+            }
+        }
+    }
+
+    private class ScannerHandler extends Handler {
+        private ScannerHandler() {
+        }
+
+        public void handleMessage(Message message) {
+            switch (message.what) {
+                case BarQrCodeUtil.AUTO_FOCUS:
+                    ScannerLiveView.this.requestAutoFocus();
+                    break;
+                case BarQrCodeUtil.BARCODE:
+                    if (ScannerLiveView.this.mIsPreviewStarted) {
+                        ScannerLiveView.this.stopCamera();
+                        ScannerLiveView.this.mListener.onCodeScanned("BAR", (String)message.obj);
+                    }
+                    break;
+                case BarQrCodeUtil.QRCODE:
+                    if (ScannerLiveView.this.mIsPreviewStarted) {
+                        ScannerLiveView.this.stopCamera();
+                        ScannerLiveView.this.mListener.onCodeScanned("QR", BarQrCodeUtil.qrToString((byte[])message.obj));
+                    }
+                    break;
+                default:
+            }
+        }
+    }
+
+    public ScannerLiveView(Context context,Listener mListener) {
+        super(context);
+        this.mPreviewFrameSize = 0;
+        this.mScannerHandler = new ScannerHandler();
+        this.mIsPreviewStarted = false;
+        this.mIsAutoFocusInProgress = false;
+        this.mFrameData = null;
+        this.mFrameDataIsAutoFocusInProgress = false;
+        this.mFoundBarcodeOrQRCode = false;
+        this.mListener = mListener;
+        initialize(context);
+    }
+
+    public ScannerLiveView(Context context, AttributeSet attrs) {
+        super(context, attrs);
+        this.mPreviewFrameSize = 0;
+        this.mScannerHandler = new ScannerHandler();
+        this.mIsPreviewStarted = false;
+        this.mIsAutoFocusInProgress = false;
+        this.mFrameData = null;
+        this.mFrameDataIsAutoFocusInProgress = false;
+        this.mFoundBarcodeOrQRCode = false;
+
+        initialize(context);
+    }
+
+    public ScannerLiveView(Context context, AttributeSet attrs, int defStyle) {
+        super(context, attrs, defStyle);
+        this.mPreviewFrameSize = 0;
+        this.mScannerHandler = new ScannerHandler();
+        this.mIsPreviewStarted = false;
+        this.mIsAutoFocusInProgress = false;
+        this.mFrameData = null;
+        this.mFrameDataIsAutoFocusInProgress = false;
+        this.mFoundBarcodeOrQRCode = false;
+        initialize(context);
+    }
+
+    private void initialize(Context context) {
+        //this.mListener = (Listener) context;
+        SurfaceHolder holder = getHolder();
+        holder.addCallback(this);
+        holder.setType(3);
+        holder.setKeepScreenOn(true);
+        this.mAutoFocusCallback = new ScanAutoFocusCallback();
+        this.mPreviewCallback = new ScanPreviewCallback();
+        Display display = ((WindowManager) context.getSystemService(Context.WINDOW_SERVICE)).getDefaultDisplay();
+        screen = new Point();
+        display.getSize(screen);
+    }
+
+
+    public void surfaceCreated(SurfaceHolder holder) {
+        if (holder == null) {
+            throw new IllegalStateException("No SurfaceHolder provided");
+        } else if (this.mCamera == null) {
+            try {
+                this.mCamera = null;
+                try {
+                    Camera.CameraInfo cameraInfo = new Camera.CameraInfo();
+                    int cameraCount = Camera.getNumberOfCameras();
+                    for (int camIdx = 0; camIdx < cameraCount; camIdx++) {
+                        Camera.getCameraInfo(camIdx, cameraInfo);
+                        if (cameraInfo.facing == 0) {
+                            this.mCamera = Camera.open(camIdx);
+                            //this.mCamera.setDisplayOrientation(90);
+                            setCameraDisplayOrientation(camIdx);
+                            break;
+                        }
+                    }
+                } catch (LinkageError e) {
+                }
+                if (this.mCamera == null) {
+                    try {
+                        this.mCamera = Camera.open(0);
+                        //this.mCamera.setDisplayOrientation(90);
+                        setCameraDisplayOrientation(0);
+                    } catch (LinkageError e2) {
+                    }
+                }
+                if (this.mCamera == null) {
+                    this.mCamera = Camera.open();
+                }
+                this.mCamera.setPreviewDisplay(holder);
+                this.mIsPreviewStarted = false;
+            } catch (IOException e3) {
+                this.mListener.onCameraIssue();
+            } catch (RuntimeException e4) {
+                this.mListener.onCameraIssue();
+            }
+        }
+    }
+
+    public void setCameraDisplayOrientation(int cameraId) {
+        Camera.CameraInfo info = new Camera.CameraInfo();
+        Camera.getCameraInfo(cameraId, info);
+        int degrees = 0;
+        switch (((Activity) getContext()).getWindowManager().getDefaultDisplay().getRotation()) {
+            case 0:
+                degrees = 0;
+                break;
+            case 1:
+                degrees = 90;
+                break;
+            case 2:
+                degrees = 180;
+                break;
+            case 3:
+                degrees = 270;
+                break;
+        }
+        if (info.facing == 1) {
+            this.mCameraDisplayOrientation = (info.orientation + degrees) % 360;
+            this.mCameraDisplayOrientation = (360 - this.mCameraDisplayOrientation) % 360;
+        } else {
+            this.mCameraDisplayOrientation = ((info.orientation - degrees) + 360) % 360;
+        }
+        this.mCamera.setDisplayOrientation(this.mCameraDisplayOrientation);
+    }
+
+    public void surfaceDestroyed(SurfaceHolder holder) {
+        if (this.mCamera != null) {
+            stopCamera();
+            this.mPreviewFrameSize = 0;
+        }
+    }
+
+    public void surfaceChanged(SurfaceHolder holder, int format, int width, int height) {
+        if (this.mCamera != null) {
+            stopCamera();
+            setCameraParameters(screen.y,screen.x);
+            if (isShown()) {
+                startCamera();
+            }
+        }
+    }
+
+    public void onPause() {
+        stopCamera();
+        if (this.mCamera != null) {
+            this.mCamera.release();
+            this.mCamera = null;
+        }
+        if(this.mDecodingThread!=null) {
+          Message.obtain(this.mDecodingThread.getHandler(), BarQrCodeUtil.QUIT).sendToTarget();
+          try {
+            this.mDecodingThread.join();
+          } catch (InterruptedException e) {
+          }
+        }
+        if(this.mScannerHandler!=null) {
+          this.mScannerHandler.removeMessages(BarQrCodeUtil.AUTO_FOCUS);
+          this.mScannerHandler.removeMessages(BarQrCodeUtil.BARCODE);
+          this.mScannerHandler.removeMessages(BarQrCodeUtil.QRCODE);
+        }
+        this.mDecodingThread = null;
+    }
+
+    public void setTorch(boolean on) {
+        if (this.mCamera != null) {
+            boolean isOn = isTorchOn();
+            if (on != isOn) {
+
+                Camera.Parameters parameters = this.mCamera.getParameters();
+                CameraConfigurationUtils.setTorch(parameters, on);
+                this.mCamera.setParameters(parameters);
+            }
+        }
+    }
+
+    public boolean isTorchOn() {
+        Camera.Parameters parameters = this.mCamera.getParameters();
+        if (parameters != null) {
+            String flashMode = parameters.getFlashMode();
+            return flashMode != null &&
+                (Camera.Parameters.FLASH_MODE_ON.equals(flashMode) ||
+                    Camera.Parameters.FLASH_MODE_TORCH.equals(flashMode));
+        } else {
+            return false;
+        }
+    }
+
+    public void onResume() {
+        /*this.mScannerOverlay = (ScannerOverlay) ((Activity) getContext()).findViewById(R.id.scanner_overlay);
+        this.mScannerOverlay.setBarcodeLocation(-1, -1);*/
+        this.mDecodingThread = new DecodingThread();
+        this.mDecodingThread.start();
+        startCamera();
+    }
+
+    public void startCamera() {
+        if (this.mCamera != null && !this.mIsPreviewStarted) {
+            this.mIsAutoFocusInProgress = false;
+            this.mFrameData = null;
+            if (this.mDecodingThread != null) {
+                this.mDecodingThread.initialize();
+            }
+            if (this.mPreviewFrameSize > 0) {
+                try {
+                    this.mCallbackBuffer = new byte[this.mPreviewFrameSize];
+                } catch (OutOfMemoryError e) {
+                    this.mCallbackBuffer = null;
+                }
+            }
+            if (this.mCallbackBuffer != null) {
+                this.mCamera.setPreviewCallbackWithBuffer(this.mPreviewCallback);
+                this.mCamera.addCallbackBuffer(this.mCallbackBuffer);
+            } else {
+                this.mCamera.setPreviewCallback(this.mPreviewCallback);
+            }
+            try {
+                this.mCamera.startPreview();
+                this.mIsPreviewStarted = true;
+                requestAutoFocus();
+            } catch (RuntimeException e2) {
+                this.mCamera.setPreviewCallback(null);
+                this.mCallbackBuffer = null;
+                this.mListener.onCameraIssue();
+            }
+        }
+    }
+
+    public void stopCamera() {
+        /*if (this.mCamera != null && this.mIsPreviewStarted) {
+            this.mCamera.setPreviewCallback(null);
+            this.mCamera.stopPreview();
+            this.mIsPreviewStarted = false;
+            if (this.mDecodingThread.getHandler() != null) {
+                this.mDecodingThread.getHandler().removeMessages(R.id.decode);
+            }
+            this.mScannerHandler.removeMessages(R.id.auto_focus);
+            this.mScannerHandler.removeMessages(R.id.msg_barcode_found);
+        }*/
+
+        if (this.mCamera != null && this.mIsPreviewStarted) {
+            synchronized (this.mPreviewCallback) {
+                this.mCamera.setPreviewCallback(null);
+                this.mCamera.stopPreview();
+                this.mIsPreviewStarted = false;
+                this.mCamera.cancelAutoFocus();
+                this.mFrameData = null;
+                this.mCallbackBuffer = null;
+            }
+            if (!(this.mDecodingThread == null || this.mDecodingThread.getHandler() == null)) {
+                this.mDecodingThread.getHandler().removeMessages(BarQrCodeUtil.DECODE);
+            }
+            this.mScannerHandler.removeMessages(BarQrCodeUtil.AUTO_FOCUS);
+            this.mScannerHandler.removeMessages(BarQrCodeUtil.BARCODE);
+            this.mScannerHandler.removeMessages(BarQrCodeUtil.QRCODE);
+        }
+
+    }
+
+    void requestAutoFocus() {
+        if (this.mCamera != null && this.mHasCameraAutoFocus && this.mIsPreviewStarted && !this.mIsAutoFocusInProgress) {
+            try {
+                this.mCamera.autoFocus(this.mAutoFocusCallback);
+                this.mIsAutoFocusInProgress = true;
+            } catch (RuntimeException e) {
+                Log.e(TAG, "Camera auto-focus failed: " + e.getLocalizedMessage());
+            }
+        }
+    }
+
+
+    private void setCameraParameters(int screenWidth, int screenHeight) {
+        Parameters parameters = this.mCamera.getParameters();
+        Log.e(TAG,"screenWidth="+screenWidth+",screenHeight="+screenHeight);
+        setPreviewSize(screenWidth, screenHeight, parameters);
+        setZoom(parameters);
+        String focusModeValues = parameters.get("focus-mode-values");
+        if (focusModeValues != null && focusModeValues.contains("macro")) {
+            parameters.set("focus-mode", "macro");
+            this.mHasCameraAutoFocus = true;
+        } else if (focusModeValues == null || !focusModeValues.contains("auto")) {
+            this.mHasCameraAutoFocus = false;
+        } else {
+            parameters.set("focus-mode", "auto");
+            this.mHasCameraAutoFocus = true;
+        }
+        try {
+            this.mCamera.setParameters(parameters);
+        } catch (RuntimeException e) {
+            this.mListener.onCameraIssue();
+        }
+        parameters = this.mCamera.getParameters();
+        this.mPreviewSize = parameters.getPreviewSize();
+        this.mPreviewFrameSize = ((this.mPreviewSize.width * this.mPreviewSize.height) * ImageFormat.getBitsPerPixel(parameters.getPreviewFormat())) / 8;
+    }
+
+    private void setPreviewSize(int screenWidth, int screenHeight, Parameters parameters) {
+        String previewSizeValuesString = parameters.get("preview-size-values");
+        if (previewSizeValuesString == null) {
+            previewSizeValuesString = parameters.get("preview-size-value");
+        }
+        Point bestPreviewSize = null;
+        if (previewSizeValuesString != null) {
+            bestPreviewSize = findBestPreviewSize(previewSizeValuesString, screenWidth, screenHeight);
+        }
+        if (bestPreviewSize != null) {
+            parameters.setPreviewSize(bestPreviewSize.x, bestPreviewSize.y);
+        } else {
+            parameters.setPreviewSize((screenWidth >> 4) << 4, (screenHeight >> 1) << 1);
+        }
+    }
+
+    private static Point findBestPreviewSize(CharSequence previewSizeValuesString, int screenWidth, int screenHeight) {
+        int bestPreviewWidth = 0;
+        int bestPreviewHeight = 0;
+        int minDifference = Integer.MAX_VALUE;
+        for (String previewSizeValueString : COMMA_PATTERN.split(previewSizeValuesString)) {
+            String previewSizeValueString2 = previewSizeValueString.trim();
+            int separatorPosition = previewSizeValueString2.indexOf(120);
+            if (separatorPosition >= 0) {
+                try {
+                    int previewSizeValueWidth = Integer.parseInt(previewSizeValueString2.substring(0, separatorPosition));
+                    int previewSizeValueHeight = Integer.parseInt(previewSizeValueString2.substring(separatorPosition + 1));
+                    int difference = Math.abs(previewSizeValueWidth - screenWidth) + Math.abs(previewSizeValueHeight - screenHeight);
+                    if (difference == 0) {
+                        bestPreviewWidth = previewSizeValueWidth;
+                        bestPreviewHeight = previewSizeValueHeight;
+                        break;
+                    } else if (difference < minDifference) {
+                        bestPreviewWidth = previewSizeValueWidth;
+                        bestPreviewHeight = previewSizeValueHeight;
+                        minDifference = difference;
+                    }
+                } catch (NumberFormatException e) {
+                }
+            }
+        }
+        if (bestPreviewWidth <= 0 || bestPreviewHeight <= 0) {
+            return null;
+        }
+        Log.e(TAG,"bestPreviewWidth="+bestPreviewWidth+",bestPreviewHeight="+bestPreviewHeight);
+        return new Point(bestPreviewWidth, bestPreviewHeight);
+    }
+
+    private void setZoom(Parameters parameters) {
+        String zoomSupportedString = parameters.get("zoom-supported");
+        if (zoomSupportedString == null || Boolean.parseBoolean(zoomSupportedString)) {
+            int maxZoomX10;
+            int desiredZoomX10 = DESIRED_ZOOM_X10;
+            String maxZoomString = parameters.get("max-zoom");
+            if (maxZoomString != null) {
+                try {
+                    maxZoomX10 = (int) (10.0d * Double.parseDouble(maxZoomString));
+                    if (DESIRED_ZOOM_X10 > maxZoomX10) {
+                        desiredZoomX10 = maxZoomX10;
+                    }
+                } catch (NumberFormatException e) {
+                }
+            }
+            String takingPictureZoomMaxString = parameters.get("taking-picture-zoom-max");
+            if (takingPictureZoomMaxString != null) {
+                try {
+                    maxZoomX10 = Integer.parseInt(takingPictureZoomMaxString);
+                    if (desiredZoomX10 > maxZoomX10) {
+                        desiredZoomX10 = maxZoomX10;
+                    }
+                } catch (NumberFormatException e2) {
+                }
+            }
+            String motZoomValuesString = parameters.get("mot-zoom-values");
+            if (motZoomValuesString != null) {
+                desiredZoomX10 = findBestMotZoomX10(motZoomValuesString, desiredZoomX10);
+            }
+            String motZoomStepString = parameters.get("mot-zoom-step");
+            if (motZoomStepString != null) {
+                try {
+                    int motZoomStepX10 = (int) (10.0d * Double.parseDouble(motZoomStepString.trim()));
+                    if (motZoomStepX10 > 1) {
+                        desiredZoomX10 -= desiredZoomX10 % motZoomStepX10;
+                    }
+                } catch (NumberFormatException e3) {
+                }
+            }
+            if (!(maxZoomString == null && motZoomValuesString == null)) {
+                parameters.set("zoom", String.valueOf(((double) desiredZoomX10) / 10.0d));
+            }
+            if (takingPictureZoomMaxString != null) {
+                parameters.set("taking-picture-zoom", desiredZoomX10);
+            }
+        }
+    }
+
+    private static int findBestMotZoomX10(CharSequence motZoomValuesString, int desiredZoomX10) {
+        int bestMotZoomX10 = 0;
+        String[] split = COMMA_PATTERN.split(motZoomValuesString);
+        int length = split.length;
+        int i = 0;
+        while (i < length) {
+            try {
+                int motZoomValueX10 = (int) (10.0d * Double.parseDouble(split[i].trim()));
+                if (Math.abs(desiredZoomX10 - motZoomValueX10) < Math.abs(desiredZoomX10 - bestMotZoomX10)) {
+                    bestMotZoomX10 = motZoomValueX10;
+                }
+                i++;
+            } catch (NumberFormatException e) {
+                return desiredZoomX10;
+            }
+        }
+        return bestMotZoomX10;
+    }
+    /*private void setCameraParameters(int screenWidth, int screenHeight) {
+        Parameters parameters = this.mCamera.getParameters();
+        setPreviewSize(screenWidth, screenHeight, parameters);
+        parameters.set("flash-mode", "off");
+        parameters.set("flash-value", 2);
+        setZoom(parameters);
+        int apiLevel = Integer.parseInt(VERSION.SDK);
+        if (apiLevel <= 3) {
+            this.mHasCameraAutoFocus = true;
+        } else if (apiLevel >= 5) {
+            String focusModeValues = parameters.get("focus-mode-values");
+            if (focusModeValues != null && focusModeValues.contains("macro")) {
+                parameters.set("focus-mode", "macro");
+                this.mHasCameraAutoFocus = true;
+            } else if (focusModeValues == null || !focusModeValues.contains("auto")) {
+                this.mHasCameraAutoFocus = false;
+            } else {
+                parameters.set("focus-mode", "auto");
+                this.mHasCameraAutoFocus = true;
+            }
+        } else {
+            String model = Build.MODEL.toLowerCase();
+            if (model.contains("devour") || model.contains("tattoo")) {
+                this.mHasCameraAutoFocus = false;
+            } else {
+                this.mHasCameraAutoFocus = true;
+            }
+        }
+        this.mCamera.setParameters(parameters);
+        this.mPreviewSize = parameters.getPreviewSize();
+    }
+
+    private void setPreviewSize(int screenWidth, int screenHeight, Parameters parameters) {
+        String previewSizeValuesString = parameters.get("preview-size-values");
+        if (previewSizeValuesString == null) {
+            previewSizeValuesString = parameters.get("preview-size-value");
+        }
+        Point bestPreviewSize = null;
+        if (previewSizeValuesString != null) {
+            bestPreviewSize = findBestPreviewSize(previewSizeValuesString, screenWidth, screenHeight);
+        }
+        if (bestPreviewSize != null) {
+            parameters.setPreviewSize(bestPreviewSize.x, bestPreviewSize.y);
+        } else {
+            parameters.setPreviewSize((screenWidth >> 3) << 3, (screenHeight >> 3) << 3);
+        }
+    }
+
+    private static Point findBestPreviewSize(CharSequence previewSizeValuesString, int screenWidth, int screenHeight) {
+        int bestPreviewWidth = 0;
+        int bestPreviewHeight = 0;
+        int minDifference = Integer.MAX_VALUE;
+        for (String previewSizeValueString : COMMA_PATTERN.split(previewSizeValuesString)) {
+            String previewSizeValueString2 = previewSizeValueString.trim();
+            int separatorPosition = previewSizeValueString2.indexOf(120);
+            if (separatorPosition >= 0) {
+                try {
+                    int previewSizeValueWidth = Integer.parseInt(previewSizeValueString2.substring(0, separatorPosition));
+                    int previewSizeValueHeight = Integer.parseInt(previewSizeValueString2.substring(separatorPosition + 1));
+                    int difference = Math.abs(previewSizeValueWidth - screenWidth) + Math.abs(previewSizeValueHeight - screenHeight);
+                    if (difference == 0) {
+                        bestPreviewWidth = previewSizeValueWidth;
+                        bestPreviewHeight = previewSizeValueHeight;
+                        break;
+                    } else if (difference < minDifference) {
+                        bestPreviewWidth = previewSizeValueWidth;
+                        bestPreviewHeight = previewSizeValueHeight;
+                        minDifference = difference;
+                    }
+                } catch (NumberFormatException e) {
+                }
+            }
+        }
+        if (bestPreviewWidth <= 0 || bestPreviewHeight <= 0) {
+            return null;
+        }
+        return new Point(bestPreviewWidth, bestPreviewHeight);
+    }
+
+    private void setZoom(Parameters parameters) {
+        String zoomSupportedString = parameters.get("zoom-supported");
+        if (zoomSupportedString == null || Boolean.parseBoolean(zoomSupportedString)) {
+            int maxZoomX10;
+            int desiredZoomX10 = DESIRED_ZOOM_X10;
+            String maxZoomString = parameters.get("max-zoom");
+            if (maxZoomString != null) {
+                try {
+                    maxZoomX10 = (int) (10.0d * Double.parseDouble(maxZoomString));
+                    if (DESIRED_ZOOM_X10 > maxZoomX10) {
+                        desiredZoomX10 = maxZoomX10;
+                    }
+                } catch (NumberFormatException e) {
+                }
+            }
+            String takingPictureZoomMaxString = parameters.get("taking-picture-zoom-max");
+            if (takingPictureZoomMaxString != null) {
+                try {
+                    maxZoomX10 = Integer.parseInt(takingPictureZoomMaxString);
+                    if (desiredZoomX10 > maxZoomX10) {
+                        desiredZoomX10 = maxZoomX10;
+                    }
+                } catch (NumberFormatException e2) {
+                }
+            }
+            String motZoomValuesString = parameters.get("mot-zoom-values");
+            if (motZoomValuesString != null) {
+                desiredZoomX10 = findBestMotZoomX10(motZoomValuesString, desiredZoomX10);
+            }
+            String motZoomStepString = parameters.get("mot-zoom-step");
+            if (motZoomStepString != null) {
+                try {
+                    int motZoomStepX10 = (int) (10.0d * Double.parseDouble(motZoomStepString.trim()));
+                    if (motZoomStepX10 > 1) {
+                        desiredZoomX10 -= desiredZoomX10 % motZoomStepX10;
+                    }
+                } catch (NumberFormatException e3) {
+                }
+            }
+            if (!(maxZoomString == null && motZoomValuesString == null)) {
+                parameters.set("zoom", String.valueOf(((double) desiredZoomX10) / 10.0d));
+            }
+            if (takingPictureZoomMaxString != null) {
+                parameters.set("taking-picture-zoom", desiredZoomX10);
+            }
+        }
+    }
+
+    private static int findBestMotZoomX10(CharSequence motZoomValuesString, int desiredZoomX10) {
+        int bestMotZoomX10 = 0;
+        String[] split = COMMA_PATTERN.split(motZoomValuesString);
+        int length = split.length;
+        int i = 0;
+        while (i < length) {
+            try {
+                int motZoomValueX10 = (int) (10.0d * Double.parseDouble(split[i].trim()));
+                if (Math.abs(desiredZoomX10 - motZoomValueX10) < Math.abs(desiredZoomX10 - bestMotZoomX10)) {
+                    bestMotZoomX10 = motZoomValueX10;
+                }
+                i++;
+            } catch (NumberFormatException e) {
+                return desiredZoomX10;
+            }
+        }
+        return bestMotZoomX10;
+    }*/
+
+    static {
+        TAG = ScannerLiveView.class.getSimpleName();
+        COMMA_PATTERN = Pattern.compile(",");
+    }
+}
diff --git a/platforms/android/app/src/main/java/com/visionsmarts/pic2shop/view/ScannerLiveViewLiner.java b/platforms/android/app/src/main/java/com/visionsmarts/pic2shop/view/ScannerLiveViewLiner.java
new file mode 100644
index 0000000..08a211c
--- /dev/null
+++ b/platforms/android/app/src/main/java/com/visionsmarts/pic2shop/view/ScannerLiveViewLiner.java
@@ -0,0 +1,601 @@
+package com.visionsmarts.pic2shop.view;
+
+import android.annotation.TargetApi;
+import android.app.Activity;
+import android.content.Context;
+import android.graphics.ImageFormat;
+import android.graphics.Point;
+import android.hardware.Camera;
+import android.hardware.Camera.AutoFocusCallback;
+import android.hardware.Camera.CameraInfo;
+import android.hardware.Camera.Parameters;
+import android.hardware.Camera.PreviewCallback;
+import android.hardware.Camera.Size;
+import android.os.Handler;
+import android.os.Looper;
+import android.os.Message;
+import android.util.AttributeSet;
+import android.util.Log;
+import android.view.SurfaceHolder;
+import android.view.SurfaceHolder.Callback;
+import android.view.SurfaceView;
+
+import com.visionsmarts.VSBarcodeReader;
+import com.visionsmarts.VSBarcodeReader.DecoderValues;
+import com.visionsmarts.VSReaderQR;
+
+import java.io.IOException;
+import java.util.regex.Pattern;
+
+public class ScannerLiveViewLiner extends SurfaceView implements Callback {
+    private static final int BARCODE_TYPES_MASK = 7;
+    private static final Pattern COMMA_PATTERN;
+    private static final int DESIRED_ZOOM_X10 = 27;
+    private static final String TAG;
+    private AutoFocusCallback mAutoFocusCallback;
+    private volatile byte[] mCallbackBuffer;
+    private volatile Camera mCamera;
+    private volatile int mCameraDisplayOrientation;
+    private DecodingThread mDecodingThread;
+    volatile boolean mFoundBarcodeOrQRCode;
+    volatile byte[] mFrameData;
+    volatile boolean mFrameDataIsAutoFocusInProgress;
+    volatile boolean mHasCameraAutoFocus;
+    volatile boolean mIsAutoFocusInProgress;
+    volatile boolean mIsPreviewStarted;
+    Listener mListener;
+    private PreviewCallback mPreviewCallback;
+    private int mPreviewFrameSize;
+    volatile Size mPreviewSize;
+    final ScannerHandler mScannerHandler;
+    ScannerOverlay mScannerOverlay;
+
+    /* renamed from: com.visionsmarts.pic2shop.view.ScannerLiveViewLiner.1 */
+    class C01731 implements AutoFocusCallback {
+        C01731() {
+        }
+
+        public void onAutoFocus(boolean success, Camera camera) {
+            ScannerLiveViewLiner.this.mIsAutoFocusInProgress = false;
+        }
+    }
+
+    /* renamed from: com.visionsmarts.pic2shop.view.ScannerLiveViewLiner.2 */
+    class C01742 implements PreviewCallback {
+        C01742() {
+        }
+
+        public synchronized void onPreviewFrame(byte[] frameData, Camera camera) {
+            if (!(!ScannerLiveViewLiner.this.mIsPreviewStarted || ScannerLiveViewLiner.this.mDecodingThread == null || ScannerLiveViewLiner.this.mFoundBarcodeOrQRCode)) {
+                boolean shouldSendDecodeRequest = ScannerLiveViewLiner.this.mFrameData == null;
+                ScannerLiveViewLiner.this.mFrameData = frameData;
+                ScannerLiveViewLiner.this.mFrameDataIsAutoFocusInProgress = ScannerLiveViewLiner.this.mIsAutoFocusInProgress;
+                if (shouldSendDecodeRequest) {
+                    ScannerLiveViewLiner.this.mDecodingThread.getHandler().obtainMessage(BarQrCodeUtil.DECODE).sendToTarget();
+                }
+            }
+        }
+    }
+
+    private class DecodingThread extends Thread {
+        DecoderValues mBarcodeDecoderValues;
+        private Handler mHandler;
+        private int mNumberConsecutiveFailedDecodingSinceFocusEnded;
+        private byte[] mPreviewLine;
+        VSReaderQR.DecoderValues mQRDecoderValues;
+
+        /* renamed from: com.visionsmarts.pic2shop.view.ScannerLiveViewLiner.DecodingThread.1 */
+        class C01751 extends Handler {
+            C01751() {
+            }
+
+            public void handleMessage(Message message) {
+                switch (message.what) {
+                    case BarQrCodeUtil.DECODE:
+                        if (ScannerLiveViewLiner.this.mIsPreviewStarted && !ScannerLiveViewLiner.this.mFoundBarcodeOrQRCode) {
+                            DecodingThread.this.decode();
+                        }
+                        break;
+                    case BarQrCodeUtil.QUIT:
+                        Looper.myLooper().quit();
+                        break;
+                    default:
+                }
+            }
+        }
+
+        public DecodingThread() {
+            this.mNumberConsecutiveFailedDecodingSinceFocusEnded = 0;
+            this.mBarcodeDecoderValues = new DecoderValues();
+            this.mQRDecoderValues = new VSReaderQR.DecoderValues();
+            setPriority(10);
+            initialize();
+        }
+
+        synchronized Handler getHandler() {
+            if (this.mHandler == null) {
+                try {
+                    ScannerLiveViewLiner.this.mDecodingThread.wait(1000);
+                } catch (InterruptedException e) {
+                }
+            }
+            return this.mHandler;
+        }
+
+        public void initialize() {
+            if (ScannerLiveViewLiner.this.mPreviewSize != null && (this.mPreviewLine == null || this.mPreviewLine.length != ScannerLiveViewLiner.this.mPreviewSize.height)) {
+                this.mPreviewLine = new byte[ScannerLiveViewLiner.this.mPreviewSize.height];
+            }
+            this.mNumberConsecutiveFailedDecodingSinceFocusEnded = 0;
+            ScannerLiveViewLiner.this.mFoundBarcodeOrQRCode = false;
+            VSBarcodeReader.reset();
+        }
+
+        public void run() {
+            Looper.prepare();
+            synchronized (this) {
+                this.mHandler = new C01751();
+                notify();
+            }
+            Looper.loop();
+        }
+
+        @TargetApi(8)
+        private void decode() {
+            byte[] previewLine = this.mPreviewLine;
+            int width = ScannerLiveViewLiner.this.mPreviewSize.width;
+            int height = ScannerLiveViewLiner.this.mPreviewSize.height;
+            synchronized (ScannerLiveViewLiner.this.mPreviewCallback) {
+                if (ScannerLiveViewLiner.this.mFrameData == null) {
+                    return;
+                }
+                byte[] frameData = ScannerLiveViewLiner.this.mFrameData;
+                boolean wasAutoFocusInProgress = ScannerLiveViewLiner.this.mFrameDataIsAutoFocusInProgress;
+                int offset = Math.round(ScannerLiveViewLiner.this.mScannerOverlay.getNormalizedLaserLinePosition() * ((float) width));
+                Log.e(TAG,"offset="+offset);
+                int i = previewLine.length - 1;
+                while (i >= 0) {
+                    try {
+                        previewLine[i] = frameData[offset];
+                        offset += width;
+                        i--;
+                    } catch (ArrayIndexOutOfBoundsException e) {
+                        throw new ArrayIndexOutOfBoundsException(e.getMessage() + "; width=" + width + "; height=" + height + "; previewLine.length=" + previewLine.length + "; initOffset=" + Math.round(ScannerLiveViewLiner.this.mScannerOverlay.getNormalizedLaserLinePosition() * ((float) width)));
+                    }
+                }
+                if (ScannerLiveViewLiner.this.mFrameData != null) {
+                    String barcode = VSBarcodeReader.decodeNextImage(previewLine, ScannerLiveViewLiner.this.mHasCameraAutoFocus ? 1 : 0, ScannerLiveViewLiner.BARCODE_TYPES_MASK, this.mBarcodeDecoderValues);
+                    if (ScannerLiveViewLiner.this.mFrameData != null) {
+                        if (this.mBarcodeDecoderValues.left >= 0) {
+                            int left = this.mBarcodeDecoderValues.left;
+                            int right = this.mBarcodeDecoderValues.right;
+                            float lineLength = (float) previewLine.length;
+                            if (ScannerLiveViewLiner.this.mCameraDisplayOrientation == 180) {
+                                ScannerLiveViewLiner.this.mScannerOverlay.setNormalizedBarcodeLocation(((float) (height - right)) / lineLength, ((float) (height - left)) / lineLength);
+                            } else {
+                                ScannerLiveViewLiner.this.mScannerOverlay.setNormalizedBarcodeLocation(((float) left) / lineLength, ((float) right) / lineLength);
+                            }
+                        } else {
+                            ScannerLiveViewLiner.this.mScannerOverlay.setNoBarcodeLocation();
+                        }
+                        if (barcode.length() > 0) {
+                            ScannerLiveViewLiner.this.mFoundBarcodeOrQRCode = true;
+                            ScannerLiveViewLiner.this.mScannerHandler.obtainMessage(BarQrCodeUtil.BARCODE, barcode).sendToTarget();
+                        } else {
+                            byte[] qrData = VSReaderQR.decodeImage(frameData, width, height, this.mQRDecoderValues);
+                            if (qrData.length > 0) {
+                                ScannerLiveViewLiner.this.mFoundBarcodeOrQRCode = true;
+                                ScannerLiveViewLiner.this.mScannerHandler.obtainMessage(BarQrCodeUtil.QRCODE, qrData).sendToTarget();
+                            } else if (wasAutoFocusInProgress) {
+                                this.mNumberConsecutiveFailedDecodingSinceFocusEnded = 0;
+                            } else {
+                                this.mNumberConsecutiveFailedDecodingSinceFocusEnded++;
+                                if (ScannerLiveViewLiner.this.mHasCameraAutoFocus && !ScannerLiveViewLiner.this.mIsAutoFocusInProgress && this.mNumberConsecutiveFailedDecodingSinceFocusEnded >= 4) {
+                                    ScannerLiveViewLiner.this.mScannerHandler.obtainMessage(BarQrCodeUtil.AUTO_FOCUS).sendToTarget();
+                                }
+                            }
+                        }
+                        synchronized (ScannerLiveViewLiner.this.mPreviewCallback) {
+                            ScannerLiveViewLiner.this.mFrameData = null;
+                            if (!(ScannerLiveViewLiner.this.mFoundBarcodeOrQRCode || ScannerLiveViewLiner.this.mCallbackBuffer == null)) {
+                                ScannerLiveViewLiner.this.mCamera.addCallbackBuffer(ScannerLiveViewLiner.this.mCallbackBuffer);
+                            }
+                        }
+                    }
+                }
+            }
+        }
+    }
+
+    public interface Listener {
+        void onCameraIssue();
+
+        void onCodeScanned(String str, String str2);
+    }
+
+    private class ScannerHandler extends Handler {
+        private ScannerHandler() {
+        }
+
+        public void handleMessage(Message message) {
+            switch (message.what) {
+                case BarQrCodeUtil.AUTO_FOCUS:
+                    ScannerLiveViewLiner.this.requestAutoFocus();
+                    break;
+                case BarQrCodeUtil.BARCODE:
+                    if (ScannerLiveViewLiner.this.mIsPreviewStarted) {
+                        ScannerLiveViewLiner.this.stopCamera();
+                        ScannerLiveViewLiner.this.mListener.onCodeScanned("BAR", (String)message.obj);
+                    }
+                    break;
+                case BarQrCodeUtil.QRCODE:
+                    if (ScannerLiveViewLiner.this.mIsPreviewStarted) {
+                        ScannerLiveViewLiner.this.stopCamera();
+                        ScannerLiveViewLiner.this.mListener.onCodeScanned("QR", BarQrCodeUtil.qrToString((byte[])message.obj));
+                    }
+                    break;
+                default:
+            }
+        }
+    }
+
+    public ScannerLiveViewLiner(Context context) {
+        super(context);
+        this.mPreviewFrameSize = 0;
+        this.mScannerHandler = new ScannerHandler();
+        this.mIsPreviewStarted = false;
+        this.mIsAutoFocusInProgress = false;
+        this.mFrameData = null;
+        this.mFrameDataIsAutoFocusInProgress = false;
+        this.mFoundBarcodeOrQRCode = false;
+        initialize(context);
+    }
+
+    public ScannerLiveViewLiner(Context context, AttributeSet attrs) {
+        super(context, attrs);
+        this.mPreviewFrameSize = 0;
+        this.mScannerHandler = new ScannerHandler();
+        this.mIsPreviewStarted = false;
+        this.mIsAutoFocusInProgress = false;
+        this.mFrameData = null;
+        this.mFrameDataIsAutoFocusInProgress = false;
+        this.mFoundBarcodeOrQRCode = false;
+        initialize(context);
+    }
+
+    public ScannerLiveViewLiner(Context context, AttributeSet attrs, int defStyle) {
+        super(context, attrs, defStyle);
+        this.mPreviewFrameSize = 0;
+        this.mScannerHandler = new ScannerHandler();
+        this.mIsPreviewStarted = false;
+        this.mIsAutoFocusInProgress = false;
+        this.mFrameData = null;
+        this.mFrameDataIsAutoFocusInProgress = false;
+        this.mFoundBarcodeOrQRCode = false;
+        initialize(context);
+    }
+
+    private void initialize(Context context) {
+        this.mListener = (Listener) context;
+        SurfaceHolder holder = getHolder();
+        holder.addCallback(this);
+        holder.setType(3);
+        holder.setKeepScreenOn(true);
+        this.mAutoFocusCallback = new C01731();
+        this.mPreviewCallback = new C01742();
+    }
+
+    @TargetApi(9)
+    public void surfaceCreated(SurfaceHolder holder) {
+        if (holder == null) {
+            throw new IllegalStateException("No SurfaceHolder provided");
+        } else if (this.mCamera == null) {
+            try {
+                this.mCamera = null;
+                try {
+                    CameraInfo cameraInfo = new CameraInfo();
+                    int cameraCount = Camera.getNumberOfCameras();
+                    for (int camIdx = 0; camIdx < cameraCount; camIdx++) {
+                        Camera.getCameraInfo(camIdx, cameraInfo);
+                        if (cameraInfo.facing == 0) {
+                            this.mCamera = Camera.open(camIdx);
+                            setCameraDisplayOrientation(camIdx);
+                            break;
+                        }
+                    }
+                } catch (LinkageError e) {
+                }
+                if (this.mCamera == null) {
+                    try {
+                        this.mCamera = Camera.open(0);
+                        setCameraDisplayOrientation(0);
+                    } catch (LinkageError e2) {
+                    }
+                }
+                if (this.mCamera == null) {
+                    this.mCamera = Camera.open();
+                }
+                this.mCamera.setPreviewDisplay(holder);
+                this.mIsPreviewStarted = false;
+            } catch (IOException e3) {
+                this.mListener.onCameraIssue();
+            } catch (RuntimeException e4) {
+                this.mListener.onCameraIssue();
+            }
+        }
+    }
+
+    public void surfaceDestroyed(SurfaceHolder holder) {
+        if (this.mCamera != null) {
+            stopCamera();
+            this.mPreviewFrameSize = 0;
+        }
+    }
+
+    public void surfaceChanged(SurfaceHolder holder, int format, int width, int height) {
+        if (this.mCamera != null) {
+            stopCamera();
+            setCameraParameters(width, height);
+            if (isShown()) {
+                startCamera();
+            }
+        }
+    }
+
+    public void onPause() {
+        stopCamera();
+        if (this.mCamera != null) {
+            this.mCamera.release();
+            this.mCamera = null;
+        }
+        Message.obtain(this.mDecodingThread.getHandler(), BarQrCodeUtil.QUIT).sendToTarget();
+        try {
+            this.mDecodingThread.join();
+        } catch (InterruptedException e) {
+        }
+        this.mScannerHandler.removeMessages(BarQrCodeUtil.AUTO_FOCUS);
+        this.mScannerHandler.removeMessages(BarQrCodeUtil.BARCODE);
+        this.mScannerHandler.removeMessages(BarQrCodeUtil.QRCODE);
+        this.mDecodingThread = null;
+    }
+
+    @TargetApi(8)
+    public void startCamera() {
+        if (this.mCamera != null && !this.mIsPreviewStarted) {
+            this.mIsAutoFocusInProgress = false;
+            this.mFrameData = null;
+            if (this.mDecodingThread != null) {
+                this.mDecodingThread.initialize();
+            }
+            if (this.mScannerOverlay != null) {
+                this.mScannerOverlay.setNoBarcodeLocation();
+            }
+            if (this.mPreviewFrameSize > 0) {
+                try {
+                    this.mCallbackBuffer = new byte[this.mPreviewFrameSize];
+                } catch (OutOfMemoryError e) {
+                    this.mCallbackBuffer = null;
+                }
+            }
+            if (this.mCallbackBuffer != null) {
+                this.mCamera.setPreviewCallbackWithBuffer(this.mPreviewCallback);
+                this.mCamera.addCallbackBuffer(this.mCallbackBuffer);
+            } else {
+                this.mCamera.setPreviewCallback(this.mPreviewCallback);
+            }
+            try {
+                this.mCamera.startPreview();
+                this.mIsPreviewStarted = true;
+                requestAutoFocus();
+            } catch (RuntimeException e2) {
+                this.mCamera.setPreviewCallback(null);
+                this.mCallbackBuffer = null;
+                this.mListener.onCameraIssue();
+            }
+        }
+    }
+
+    public void stopCamera() {
+        if (this.mCamera != null && this.mIsPreviewStarted) {
+            synchronized (this.mPreviewCallback) {
+                this.mCamera.setPreviewCallback(null);
+                this.mCamera.stopPreview();
+                this.mIsPreviewStarted = false;
+                this.mCamera.cancelAutoFocus();
+                this.mFrameData = null;
+                this.mCallbackBuffer = null;
+            }
+            if (!(this.mDecodingThread == null || this.mDecodingThread.getHandler() == null)) {
+                this.mDecodingThread.getHandler().removeMessages(BarQrCodeUtil.DECODE);
+            }
+            this.mScannerHandler.removeMessages(BarQrCodeUtil.AUTO_FOCUS);
+            this.mScannerHandler.removeMessages(BarQrCodeUtil.BARCODE);
+            this.mScannerHandler.removeMessages(BarQrCodeUtil.QRCODE);
+        }
+    }
+
+    void requestAutoFocus() {
+        if (this.mCamera != null && this.mHasCameraAutoFocus && this.mIsPreviewStarted && !this.mIsAutoFocusInProgress) {
+            try {
+                this.mCamera.autoFocus(this.mAutoFocusCallback);
+                this.mIsAutoFocusInProgress = true;
+            } catch (RuntimeException e) {
+                Log.e(TAG, "Camera auto-focus failed: " + e.getLocalizedMessage());
+            }
+        }
+    }
+
+    @TargetApi(9)
+    public void setCameraDisplayOrientation(int cameraId) {
+        CameraInfo info = new CameraInfo();
+        Camera.getCameraInfo(cameraId, info);
+        int degrees = 0;
+        switch (((Activity) getContext()).getWindowManager().getDefaultDisplay().getRotation()) {
+            case 0 /*0*/:
+                degrees = 0;
+                break;
+            case 1 /*1*/:
+                degrees = 90;
+                break;
+            case 2 /*2*/:
+                degrees = 180;
+                break;
+            case 3 /*3*/:
+                degrees = 270;
+                break;
+        }
+        if (info.facing == 1) {
+            this.mCameraDisplayOrientation = (info.orientation + degrees) % 360;
+            this.mCameraDisplayOrientation = (360 - this.mCameraDisplayOrientation) % 360;
+        } else {
+            this.mCameraDisplayOrientation = ((info.orientation - degrees) + 360) % 360;
+        }
+        this.mCamera.setDisplayOrientation(this.mCameraDisplayOrientation);
+    }
+
+    @TargetApi(8)
+    private void setCameraParameters(int screenWidth, int screenHeight) {
+        Log.e(TAG,"screenWidth="+screenWidth+",screenHeight="+screenHeight);
+        Parameters parameters = this.mCamera.getParameters();
+        setPreviewSize(screenWidth, screenHeight, parameters);
+        setZoom(parameters);
+        String focusModeValues = parameters.get("focus-mode-values");
+        if (focusModeValues != null && focusModeValues.contains("macro")) {
+            parameters.set("focus-mode", "macro");
+            this.mHasCameraAutoFocus = true;
+        } else if (focusModeValues == null || !focusModeValues.contains("auto")) {
+            this.mHasCameraAutoFocus = false;
+        } else {
+            parameters.set("focus-mode", "auto");
+            this.mHasCameraAutoFocus = true;
+        }
+        try {
+            this.mCamera.setParameters(parameters);
+        } catch (RuntimeException e) {
+            this.mListener.onCameraIssue();
+        }
+        parameters = this.mCamera.getParameters();
+        this.mPreviewSize = parameters.getPreviewSize();
+        this.mPreviewFrameSize = ((this.mPreviewSize.width * this.mPreviewSize.height) * ImageFormat.getBitsPerPixel(parameters.getPreviewFormat())) / 8;
+    }
+
+    private void setPreviewSize(int screenWidth, int screenHeight, Parameters parameters) {
+        String previewSizeValuesString = parameters.get("preview-size-values");
+        if (previewSizeValuesString == null) {
+            previewSizeValuesString = parameters.get("preview-size-value");
+        }
+        Point bestPreviewSize = null;
+        if (previewSizeValuesString != null) {
+            bestPreviewSize = findBestPreviewSize(previewSizeValuesString, screenWidth, screenHeight);
+        }
+        if (bestPreviewSize != null) {
+            parameters.setPreviewSize(bestPreviewSize.x, bestPreviewSize.y);
+        } else {
+            parameters.setPreviewSize((screenWidth >> 4) << 4, (screenHeight >> 1) << 1);
+        }
+    }
+
+    private static Point findBestPreviewSize(CharSequence previewSizeValuesString, int screenWidth, int screenHeight) {
+        int bestPreviewWidth = 0;
+        int bestPreviewHeight = 0;
+        int minDifference = Integer.MAX_VALUE;
+        for (String previewSizeValueString : COMMA_PATTERN.split(previewSizeValuesString)) {
+            String previewSizeValueString2 = previewSizeValueString.trim();
+            int separatorPosition = previewSizeValueString2.indexOf(120);
+            if (separatorPosition >= 0) {
+                try {
+                    int previewSizeValueWidth = Integer.parseInt(previewSizeValueString2.substring(0, separatorPosition));
+                    int previewSizeValueHeight = Integer.parseInt(previewSizeValueString2.substring(separatorPosition + 1));
+                    int difference = Math.abs(previewSizeValueWidth - screenWidth) + Math.abs(previewSizeValueHeight - screenHeight);
+                    if (difference == 0) {
+                        bestPreviewWidth = previewSizeValueWidth;
+                        bestPreviewHeight = previewSizeValueHeight;
+                        break;
+                    } else if (difference < minDifference) {
+                        bestPreviewWidth = previewSizeValueWidth;
+                        bestPreviewHeight = previewSizeValueHeight;
+                        minDifference = difference;
+                    }
+                } catch (NumberFormatException e) {
+                }
+            }
+        }
+        if (bestPreviewWidth <= 0 || bestPreviewHeight <= 0) {
+            return null;
+        }
+        Log.e(TAG,"bestPreviewWidth="+bestPreviewWidth+",bestPreviewHeight="+bestPreviewHeight);
+        return new Point(bestPreviewWidth, bestPreviewHeight);
+    }
+
+    private void setZoom(Parameters parameters) {
+        String zoomSupportedString = parameters.get("zoom-supported");
+        if (zoomSupportedString == null || Boolean.parseBoolean(zoomSupportedString)) {
+            int maxZoomX10;
+            int desiredZoomX10 = DESIRED_ZOOM_X10;
+            String maxZoomString = parameters.get("max-zoom");
+            if (maxZoomString != null) {
+                try {
+                    maxZoomX10 = (int) (10.0d * Double.parseDouble(maxZoomString));
+                    if (DESIRED_ZOOM_X10 > maxZoomX10) {
+                        desiredZoomX10 = maxZoomX10;
+                    }
+                } catch (NumberFormatException e) {
+                }
+            }
+            String takingPictureZoomMaxString = parameters.get("taking-picture-zoom-max");
+            if (takingPictureZoomMaxString != null) {
+                try {
+                    maxZoomX10 = Integer.parseInt(takingPictureZoomMaxString);
+                    if (desiredZoomX10 > maxZoomX10) {
+                        desiredZoomX10 = maxZoomX10;
+                    }
+                } catch (NumberFormatException e2) {
+                }
+            }
+            String motZoomValuesString = parameters.get("mot-zoom-values");
+            if (motZoomValuesString != null) {
+                desiredZoomX10 = findBestMotZoomX10(motZoomValuesString, desiredZoomX10);
+            }
+            String motZoomStepString = parameters.get("mot-zoom-step");
+            if (motZoomStepString != null) {
+                try {
+                    int motZoomStepX10 = (int) (10.0d * Double.parseDouble(motZoomStepString.trim()));
+                    if (motZoomStepX10 > 1) {
+                        desiredZoomX10 -= desiredZoomX10 % motZoomStepX10;
+                    }
+                } catch (NumberFormatException e3) {
+                }
+            }
+            if (!(maxZoomString == null && motZoomValuesString == null)) {
+                parameters.set("zoom", String.valueOf(((double) desiredZoomX10) / 10.0d));
+            }
+            if (takingPictureZoomMaxString != null) {
+                parameters.set("taking-picture-zoom", desiredZoomX10);
+            }
+        }
+    }
+
+    private static int findBestMotZoomX10(CharSequence motZoomValuesString, int desiredZoomX10) {
+        int bestMotZoomX10 = 0;
+        String[] split = COMMA_PATTERN.split(motZoomValuesString);
+        int length = split.length;
+        int i = 0;
+        while (i < length) {
+            try {
+                int motZoomValueX10 = (int) (10.0d * Double.parseDouble(split[i].trim()));
+                if (Math.abs(desiredZoomX10 - motZoomValueX10) < Math.abs(desiredZoomX10 - bestMotZoomX10)) {
+                    bestMotZoomX10 = motZoomValueX10;
+                }
+                i++;
+            } catch (NumberFormatException e) {
+                return desiredZoomX10;
+            }
+        }
+        return bestMotZoomX10;
+    }
+
+    static {
+        TAG = ScannerLiveViewLiner.class.getSimpleName();
+        COMMA_PATTERN = Pattern.compile(",");
+    }
+}
diff --git a/platforms/android/app/src/main/java/com/visionsmarts/pic2shop/view/ScannerOverlay.java b/platforms/android/app/src/main/java/com/visionsmarts/pic2shop/view/ScannerOverlay.java
new file mode 100644
index 0000000..696fe7d
--- /dev/null
+++ b/platforms/android/app/src/main/java/com/visionsmarts/pic2shop/view/ScannerOverlay.java
@@ -0,0 +1,124 @@
+package com.visionsmarts.pic2shop.view;
+
+import android.content.Context;
+import android.graphics.Canvas;
+import android.graphics.Color;
+import android.graphics.Paint;
+import android.graphics.Paint.Align;
+import android.graphics.Paint.Style;
+import android.graphics.Point;
+import android.graphics.Rect;
+import android.graphics.Typeface;
+import android.text.Layout.Alignment;
+import android.text.StaticLayout;
+import android.text.TextPaint;
+import android.util.AttributeSet;
+import android.view.Display;
+import android.view.View;
+import android.view.WindowManager;
+
+public class ScannerOverlay extends View {
+    private static final float LASER_LINE_WIDTH_160_DPI = 7.0f;
+    private static final float TEXT_FONT_SIZE = 20.0f;
+    private Paint mBarcodeLinePaint;
+    private Rect mBarcodeLineRect;
+    private Rect mCanvasClipRect;
+    private Paint mLaserLinePaint;
+    private int mLaserLinePosition;
+    private Rect mLaserLineRect;
+    private float mScreenDensity;
+    private Point mScreenResolution;
+    private Paint mTextBackgroundPaint;
+    private StaticLayout mTextLayout;
+
+    public ScannerOverlay(Context context) {
+        super(context);
+        this.mCanvasClipRect = new Rect();
+        this.mLaserLineRect = new Rect();
+        this.mBarcodeLineRect = new Rect(-1, -1, -1, -1);
+        initialize(context);
+    }
+
+    public ScannerOverlay(Context context, AttributeSet attrs) {
+        super(context, attrs);
+        this.mCanvasClipRect = new Rect();
+        this.mLaserLineRect = new Rect();
+        this.mBarcodeLineRect = new Rect(-1, -1, -1, -1);
+        initialize(context);
+    }
+
+    public ScannerOverlay(Context context, AttributeSet attrs, int defStyle) {
+        super(context, attrs, defStyle);
+        this.mCanvasClipRect = new Rect();
+        this.mLaserLineRect = new Rect();
+        this.mBarcodeLineRect = new Rect(-1, -1, -1, -1);
+        initialize(context);
+    }
+
+    private void initialize(Context context) {
+        this.mTextBackgroundPaint = new Paint();
+        this.mTextBackgroundPaint.setStyle(Style.FILL);
+        this.mTextBackgroundPaint.setColor(Color.GREEN);
+        this.mTextBackgroundPaint.setAlpha(204);
+        TextPaint textPaint = new TextPaint();
+        textPaint.setStyle(Style.FILL);
+        textPaint.setStrokeWidth(1.0f);
+        textPaint.setColor(-1);
+        textPaint.setAlpha(204);
+        textPaint.setAntiAlias(true);
+        textPaint.setTypeface(Typeface.DEFAULT_BOLD);
+        textPaint.setTextSize(TEXT_FONT_SIZE * context.getResources().getDisplayMetrics().scaledDensity);
+        textPaint.setTextAlign(Align.CENTER);
+        this.mTextLayout = new StaticLayout("将二维码/条形码放入框内, 即可自动扫描", textPaint, context.getResources().getDisplayMetrics().heightPixels, Alignment.ALIGN_NORMAL, 1.0f, 0.0f, true);
+        this.mLaserLinePaint = new Paint();
+        this.mLaserLinePaint.setStyle(Style.FILL);
+        this.mLaserLinePaint.setColor(-65536);
+        this.mLaserLinePaint.setAlpha(255);
+        this.mBarcodeLinePaint = new Paint();
+        this.mBarcodeLinePaint.setStyle(Style.FILL);
+        this.mBarcodeLinePaint.setColor(-16711936);
+        this.mBarcodeLinePaint.setAlpha(255);
+        Display display = ((WindowManager) context.getSystemService(Context.WINDOW_SERVICE)).getDefaultDisplay();
+        this.mScreenResolution = new Point(display.getWidth(), display.getHeight());
+        this.mScreenDensity = getContext().getResources().getDisplayMetrics().density;
+        this.mLaserLinePosition = Math.round((float) (this.mScreenResolution.x / 2));
+    }
+
+    protected void onDraw(Canvas canvas) {
+        float center = ((float) canvas.getHeight()) / 2.0f;
+        canvas.rotate(-90.0f, center, center);
+        if (canvas.getClipBounds(this.mCanvasClipRect)) {
+            if (this.mCanvasClipRect.height() == canvas.getWidth()) {
+                canvas.drawRect(0.0f, (float) (this.mCanvasClipRect.bottom - this.mTextLayout.getHeight()), (float) this.mCanvasClipRect.right, (float) this.mCanvasClipRect.bottom, this.mTextBackgroundPaint);
+                canvas.save();
+                canvas.translate(this.mCanvasClipRect.exactCenterX(), (float) (this.mCanvasClipRect.bottom - this.mTextLayout.getHeight()));
+                this.mTextLayout.draw(canvas);
+                canvas.restore();
+                int lineWidth = Math.round(LASER_LINE_WIDTH_160_DPI * this.mScreenDensity);
+                this.mLaserLineRect.set(this.mCanvasClipRect.width() / 8, this.mLaserLinePosition - (lineWidth / 2), (this.mCanvasClipRect.width() * 7) / 8, this.mLaserLinePosition + ((lineWidth - 1) / 2));
+                this.mBarcodeLineRect.top = this.mLaserLineRect.top;
+                this.mBarcodeLineRect.bottom = this.mLaserLineRect.bottom;
+            }
+            canvas.drawRect(this.mLaserLineRect, this.mLaserLinePaint);
+            if (this.mBarcodeLineRect.left >= 0 && this.mBarcodeLineRect.right >= 0) {
+                canvas.drawRect(this.mBarcodeLineRect, this.mBarcodeLinePaint);
+            }
+        }
+    }
+
+    public float getNormalizedLaserLinePosition() {
+        return ((float) this.mLaserLinePosition) / ((float) this.mScreenResolution.x);
+    }
+
+    public void setNormalizedBarcodeLocation(float left, float right) {
+        this.mBarcodeLineRect.left = Math.round(((float) this.mScreenResolution.y) * left);
+        this.mBarcodeLineRect.right = Math.round(((float) this.mScreenResolution.y) * right);
+        postInvalidate(this.mLaserLineRect.top, 0, this.mLaserLineRect.bottom, this.mScreenResolution.y - 1);
+    }
+
+    public void setNoBarcodeLocation() {
+        this.mBarcodeLineRect.left = -1;
+        this.mBarcodeLineRect.right = -1;
+        postInvalidate(this.mLaserLineRect.top, 0, this.mLaserLineRect.bottom, this.mScreenResolution.y - 1);
+    }
+}
diff --git a/platforms/android/app/src/main/java/uk/co/whiteoctober/cordova/AppVersion.java b/platforms/android/app/src/main/java/uk/co/whiteoctober/cordova/AppVersion.java
new file mode 100644
index 0000000..204ed7e
--- /dev/null
+++ b/platforms/android/app/src/main/java/uk/co/whiteoctober/cordova/AppVersion.java
@@ -0,0 +1,45 @@
+package uk.co.whiteoctober.cordova;
+
+import org.apache.cordova.CordovaPlugin;
+import org.apache.cordova.CallbackContext;
+import org.json.JSONArray;
+import org.json.JSONException;
+import org.json.JSONObject;
+
+import android.content.pm.ApplicationInfo;
+import android.content.pm.PackageManager.NameNotFoundException;
+import android.content.pm.PackageManager;
+
+public class AppVersion extends CordovaPlugin {
+  @Override
+  public boolean execute(String action, JSONArray args, CallbackContext callbackContext) throws JSONException {
+
+    try {
+      if (action.equals("getAppName")) {
+        PackageManager packageManager = this.cordova.getActivity().getPackageManager();
+        ApplicationInfo app = packageManager.getApplicationInfo(this.cordova.getActivity().getPackageName(), 0);
+        callbackContext.success((String)packageManager.getApplicationLabel(app));
+        return true;
+      }
+      if (action.equals("getPackageName")) {
+        callbackContext.success(this.cordova.getActivity().getPackageName());
+        return true;
+      }
+      if (action.equals("getVersionNumber")) {
+        PackageManager packageManager = this.cordova.getActivity().getPackageManager();
+        callbackContext.success(packageManager.getPackageInfo(this.cordova.getActivity().getPackageName(), 0).versionName);
+      return true;
+      }
+      if (action.equals("getVersionCode")) {
+        PackageManager packageManager = this.cordova.getActivity().getPackageManager();
+        callbackContext.success(packageManager.getPackageInfo(this.cordova.getActivity().getPackageName(), 0).versionCode);
+      return true;
+      }
+      return false;
+    } catch (NameNotFoundException e) {
+      callbackContext.success("N/A");
+      return true;
+    }
+  }
+
+}
diff --git a/platforms/android/app/src/main/jniLibs/armeabi/libVSBarcodeReader.so b/platforms/android/app/src/main/jniLibs/armeabi/libVSBarcodeReader.so
new file mode 100644
index 0000000..aa3d33b
--- /dev/null
+++ b/platforms/android/app/src/main/jniLibs/armeabi/libVSBarcodeReader.so
Binary files differ
diff --git a/platforms/android/app/src/main/jniLibs/armeabi/libVSReaderQR.so b/platforms/android/app/src/main/jniLibs/armeabi/libVSReaderQR.so
new file mode 100644
index 0000000..f6cd34d
--- /dev/null
+++ b/platforms/android/app/src/main/jniLibs/armeabi/libVSReaderQR.so
Binary files differ
diff --git a/platforms/android/app/src/main/res/drawable/back.png b/platforms/android/app/src/main/res/drawable/back.png
new file mode 100644
index 0000000..51bac9f
--- /dev/null
+++ b/platforms/android/app/src/main/res/drawable/back.png
Binary files differ
diff --git a/platforms/android/app/src/main/res/drawable/close.png b/platforms/android/app/src/main/res/drawable/close.png
new file mode 100644
index 0000000..3fb7db5
--- /dev/null
+++ b/platforms/android/app/src/main/res/drawable/close.png
Binary files differ
diff --git a/platforms/android/app/src/main/res/xml/config.xml b/platforms/android/app/src/main/res/xml/config.xml
index a0b93ed..cda74bc 100644
--- a/platforms/android/app/src/main/res/xml/config.xml
+++ b/platforms/android/app/src/main/res/xml/config.xml
@@ -1,5 +1,5 @@
 <?xml version='1.0' encoding='utf-8'?>
-<widget id="com.supwisdom.dlapp" version="1.0.0" xmlns="http://www.w3.org/ns/widgets" xmlns:cdv="http://cordova.apache.org/ns/1.0">
+<widget id="com.dalicitycard.app" version="1.0.4" xmlns="http://www.w3.org/ns/widgets" xmlns:cdv="http://cordova.apache.org/ns/1.0">
     <feature name="Fingerprint">
         <param name="android-package" value="de.niklasmerz.cordova.fingerprint.Fingerprint" />
     </feature>
@@ -37,6 +37,9 @@
     <feature name="JPushPlugin">
         <param name="android-package" value="cn.jiguang.cordova.push.JPushPlugin" />
     </feature>
+    <feature name="AppVersion">
+        <param name="android-package" value="uk.co.whiteoctober.cordova.AppVersion" />
+    </feature>
     <name short="大理市民卡">dlapp</name>
     <description>
         A sample Apache Cordova application that responds to the deviceready event.
@@ -59,6 +62,9 @@
     <edit-config file="*-Info.plist" mode="merge" target="NSCameraUsageDescription">
         <string>APP需要使用您的相机权限,没有该权限将无法完成扫一扫功能</string>
     </edit-config>
+    <edit-config file="*-Info.plist" mode="merge" target="NSPhotoLibraryUsageDescription">
+        <string>APP需要使用您的相册权限,没有该权限将无法完成扫一扫功能</string>
+    </edit-config>
     <allow-intent href="market:*" />
     <preference name="loglevel" value="DEBUG" />
     <preference name="AutoHideSplashScreen" value="true" />
@@ -70,4 +76,5 @@
     <preference name="DisallowOverscroll" value="true" />
     <preference name="UIWebViewBounce" value="false" />
     <preference name="BackupWebStorage" value="local" />
+    <preference name="CordovaWebViewEngine" value="CDVWKWebViewEngine" />
 </widget>
diff --git a/platforms/android/cordova-plugin-qrscanner/dlapp-qrscanner.gradle b/platforms/android/cordova-plugin-qrscanner/dlapp-qrscanner.gradle
index df682e7..6188e34 100644
--- a/platforms/android/cordova-plugin-qrscanner/dlapp-qrscanner.gradle
+++ b/platforms/android/cordova-plugin-qrscanner/dlapp-qrscanner.gradle
@@ -3,8 +3,8 @@
 }
 
 dependencies {
-    compile 'com.journeyapps:zxing-android-embedded:3.3.0'
-    compile 'com.android.support:appcompat-v7:23.1.0'
+    implementation 'com.journeyapps:zxing-android-embedded:3.3.0'
+    implementation 'com.android.support:appcompat-v7:23.1.0'
 }
 
 android {
diff --git a/platforms/android/platform_www/cordova_plugins.js b/platforms/android/platform_www/cordova_plugins.js
index 595ecb1..ee6832d 100644
--- a/platforms/android/platform_www/cordova_plugins.js
+++ b/platforms/android/platform_www/cordova_plugins.js
@@ -327,6 +327,14 @@
       "clobbers": [
         "JPush"
       ]
+    },
+    {
+      "id": "cordova-plugin-app-version.AppVersionPlugin",
+      "file": "plugins/cordova-plugin-app-version/www/AppVersionPlugin.js",
+      "pluginId": "cordova-plugin-app-version",
+      "clobbers": [
+        "cordova.getAppVersion"
+      ]
     }
   ];
   module.exports.metadata = {
@@ -344,6 +352,8 @@
     "cordova-plugin-device": "2.0.2",
     "cordova-plugin-themeablebrowser": "0.2.17",
     "cordova-plugin-jcore": "1.3.0",
-    "jpush-phonegap-plugin": "3.7.2"
+    "jpush-phonegap-plugin": "3.7.2",
+    "cordova-plugin-app-version": "0.1.9",
+    "cordova-plugin-wkwebview-engine": "1.2.1"
   };
 });
\ No newline at end of file
diff --git a/platforms/android/platform_www/plugins/cordova-plugin-app-version/www/AppVersionPlugin.js b/platforms/android/platform_www/plugins/cordova-plugin-app-version/www/AppVersionPlugin.js
new file mode 100644
index 0000000..430f50d
--- /dev/null
+++ b/platforms/android/platform_www/plugins/cordova-plugin-app-version/www/AppVersionPlugin.js
@@ -0,0 +1,68 @@
+cordova.define("cordova-plugin-app-version.AppVersionPlugin", function(require, exports, module) {
+/*jslint indent: 2 */
+/*global window, jQuery, angular, cordova */
+"use strict";
+
+// Returns a jQuery or AngularJS deferred object, or pass a success and fail callbacks if you don't want to use jQuery or AngularJS
+var getPromisedCordovaExec = function (command, success, fail) {
+  var toReturn, deferred, injector, $q;
+  if (success === undefined) {
+    if (window.jQuery) {
+      deferred = jQuery.Deferred();
+      success = deferred.resolve;
+      fail = deferred.reject;
+      toReturn = deferred;
+    } else if (window.angular) {
+      injector = angular.injector(["ng"]);
+      $q = injector.get("$q");
+      deferred = $q.defer();
+      success = deferred.resolve;
+      fail = deferred.reject;
+      toReturn = deferred.promise;
+    } else if (window.when && window.when.promise) {
+      deferred = when.defer();
+      success = deferred.resolve;
+      fail = deferred.reject;
+      toReturn = deferred.promise;
+    } else if (window.Promise) {
+      toReturn = new Promise(function(c, e) {
+        success = c;
+        fail = e;
+      });
+    } else if (window.WinJS && window.WinJS.Promise) {
+      toReturn = new WinJS.Promise(function(c, e) {
+        success = c;
+        fail = e;
+      });
+    } else {
+      return console.error('AppVersion either needs a success callback, or jQuery/AngularJS/Promise/WinJS.Promise defined for using promises');
+    }
+  }
+  // 5th param is NOT optional. must be at least empty array
+  cordova.exec(success, fail, "AppVersion", command, []);
+  return toReturn;
+};
+
+var getAppVersion = function (success, fail) {
+  return getPromisedCordovaExec('getVersionNumber', success, fail);
+};
+
+getAppVersion.getAppName = function (success, fail) {
+  return getPromisedCordovaExec('getAppName', success, fail);
+};
+
+getAppVersion.getPackageName = function (success, fail) {
+  return getPromisedCordovaExec('getPackageName', success, fail);
+};
+
+getAppVersion.getVersionNumber = function (success, fail) {
+  return getPromisedCordovaExec('getVersionNumber', success, fail);
+};
+
+getAppVersion.getVersionCode = function (success, fail) {
+  return getPromisedCordovaExec('getVersionCode', success, fail);
+};
+
+module.exports = getAppVersion;
+
+});
diff --git a/platforms/browser/browser.json b/platforms/browser/browser.json
index 9416cfc..13a6fc8 100644
--- a/platforms/browser/browser.json
+++ b/platforms/browser/browser.json
@@ -36,6 +36,14 @@
               "mode": "merge",
               "id": "config.xml"
             }
+          ],
+          "NSPhotoLibraryUsageDescription": [
+            {
+              "xml": "<string>APP需要使用您的相册权限,没有该权限将无法完成扫一扫功能</string>",
+              "count": 1,
+              "mode": "merge",
+              "id": "config.xml"
+            }
           ]
         }
       }
@@ -85,9 +93,15 @@
       "PACKAGE_NAME": "com.supwisdom.dlapp"
     },
     "jpush-phonegap-plugin": {
-      "APP_KEY": "your_jpush_appkey",
+      "APP_KEY": "bd22b85f247a6e2ca307d3c5",
       "CHANNEL": "developer-default",
       "PACKAGE_NAME": "com.supwisdom.dlapp"
+    },
+    "cordova-plugin-app-version": {
+      "PACKAGE_NAME": "com.supwisdom.dlapp"
+    },
+    "cordova-plugin-wkwebview-engine": {
+      "PACKAGE_NAME": "com.supwisdom.dlapp"
     }
   },
   "dependent_plugins": {},
@@ -445,6 +459,14 @@
       "clobbers": [
         "JPush"
       ]
+    },
+    {
+      "file": "plugins/cordova-plugin-app-version/www/AppVersionPlugin.js",
+      "id": "cordova-plugin-app-version.AppVersionPlugin",
+      "pluginId": "cordova-plugin-app-version",
+      "clobbers": [
+        "cordova.getAppVersion"
+      ]
     }
   ],
   "plugin_metadata": {
@@ -462,6 +484,8 @@
     "cordova-plugin-device": "2.0.2",
     "cordova-plugin-themeablebrowser": "0.2.17",
     "cordova-plugin-jcore": "1.3.0",
-    "jpush-phonegap-plugin": "3.7.2"
+    "jpush-phonegap-plugin": "3.7.2",
+    "cordova-plugin-app-version": "0.1.9",
+    "cordova-plugin-wkwebview-engine": "1.2.1"
   }
 }
diff --git a/platforms/browser/config.xml b/platforms/browser/config.xml
index 11d63b1..b0a0bfa 100644
--- a/platforms/browser/config.xml
+++ b/platforms/browser/config.xml
@@ -1,5 +1,5 @@
 <?xml version='1.0' encoding='utf-8'?>
-<widget id="com.supwisdom.dlapp" version="1.0.0" xmlns="http://www.w3.org/ns/widgets" xmlns:cdv="http://cordova.apache.org/ns/1.0">
+<widget id="com.dalicitycard.app" version="1.0.3" xmlns="http://www.w3.org/ns/widgets" xmlns:cdv="http://cordova.apache.org/ns/1.0">
     <name short="大理市民卡">dlapp</name>
     <description>
         A sample Apache Cordova application that responds to the deviceready event.
@@ -22,6 +22,9 @@
     <edit-config file="*-Info.plist" mode="merge" target="NSCameraUsageDescription">
         <string>APP需要使用您的相机权限,没有该权限将无法完成扫一扫功能</string>
     </edit-config>
+    <edit-config file="*-Info.plist" mode="merge" target="NSPhotoLibraryUsageDescription">
+        <string>APP需要使用您的相册权限,没有该权限将无法完成扫一扫功能</string>
+    </edit-config>
     <preference name="AutoHideSplashScreen" value="true" />
     <preference name="SplashScreenDelay" value="0" />
     <preference name="SplashShowOnlyFirstTime" value="true" />
diff --git a/platforms/browser/platform_www/cordova_plugins.js b/platforms/browser/platform_www/cordova_plugins.js
index 30be43a..3f30e69 100644
--- a/platforms/browser/platform_www/cordova_plugins.js
+++ b/platforms/browser/platform_www/cordova_plugins.js
@@ -353,6 +353,14 @@
         "clobbers": [
             "JPush"
         ]
+    },
+    {
+        "file": "plugins/cordova-plugin-app-version/www/AppVersionPlugin.js",
+        "id": "cordova-plugin-app-version.AppVersionPlugin",
+        "pluginId": "cordova-plugin-app-version",
+        "clobbers": [
+            "cordova.getAppVersion"
+        ]
     }
 ];
 module.exports.metadata = 
@@ -372,7 +380,9 @@
     "cordova-plugin-device": "2.0.2",
     "cordova-plugin-themeablebrowser": "0.2.17",
     "cordova-plugin-jcore": "1.3.0",
-    "jpush-phonegap-plugin": "3.7.2"
+    "jpush-phonegap-plugin": "3.7.2",
+    "cordova-plugin-app-version": "0.1.9",
+    "cordova-plugin-wkwebview-engine": "1.2.1"
 }
 // BOTTOM OF METADATA
 });
\ No newline at end of file
diff --git a/platforms/browser/platform_www/plugins/cordova-plugin-app-version/www/AppVersionPlugin.js b/platforms/browser/platform_www/plugins/cordova-plugin-app-version/www/AppVersionPlugin.js
new file mode 100644
index 0000000..c62fc27
--- /dev/null
+++ b/platforms/browser/platform_www/plugins/cordova-plugin-app-version/www/AppVersionPlugin.js
@@ -0,0 +1,67 @@
+cordova.define("cordova-plugin-app-version.AppVersionPlugin", function(require, exports, module) { /*jslint indent: 2 */
+/*global window, jQuery, angular, cordova */
+"use strict";
+
+// Returns a jQuery or AngularJS deferred object, or pass a success and fail callbacks if you don't want to use jQuery or AngularJS
+var getPromisedCordovaExec = function (command, success, fail) {
+  var toReturn, deferred, injector, $q;
+  if (success === undefined) {
+    if (window.jQuery) {
+      deferred = jQuery.Deferred();
+      success = deferred.resolve;
+      fail = deferred.reject;
+      toReturn = deferred;
+    } else if (window.angular) {
+      injector = angular.injector(["ng"]);
+      $q = injector.get("$q");
+      deferred = $q.defer();
+      success = deferred.resolve;
+      fail = deferred.reject;
+      toReturn = deferred.promise;
+    } else if (window.when && window.when.promise) {
+      deferred = when.defer();
+      success = deferred.resolve;
+      fail = deferred.reject;
+      toReturn = deferred.promise;
+    } else if (window.Promise) {
+      toReturn = new Promise(function(c, e) {
+        success = c;
+        fail = e;
+      });
+    } else if (window.WinJS && window.WinJS.Promise) {
+      toReturn = new WinJS.Promise(function(c, e) {
+        success = c;
+        fail = e;
+      });
+    } else {
+      return console.error('AppVersion either needs a success callback, or jQuery/AngularJS/Promise/WinJS.Promise defined for using promises');
+    }
+  }
+  // 5th param is NOT optional. must be at least empty array
+  cordova.exec(success, fail, "AppVersion", command, []);
+  return toReturn;
+};
+
+var getAppVersion = function (success, fail) {
+  return getPromisedCordovaExec('getVersionNumber', success, fail);
+};
+
+getAppVersion.getAppName = function (success, fail) {
+  return getPromisedCordovaExec('getAppName', success, fail);
+};
+
+getAppVersion.getPackageName = function (success, fail) {
+  return getPromisedCordovaExec('getPackageName', success, fail);
+};
+
+getAppVersion.getVersionNumber = function (success, fail) {
+  return getPromisedCordovaExec('getVersionNumber', success, fail);
+};
+
+getAppVersion.getVersionCode = function (success, fail) {
+  return getPromisedCordovaExec('getVersionCode', success, fail);
+};
+
+module.exports = getAppVersion;
+
+});
diff --git a/platforms/ios/dlapp.xcarchive/Info.plist b/platforms/ios/dlapp.xcarchive/Info.plist
index cb9e5c4..f54150d 100644
--- a/platforms/ios/dlapp.xcarchive/Info.plist
+++ b/platforms/ios/dlapp.xcarchive/Info.plist
@@ -7,20 +7,20 @@
 		<key>ApplicationPath</key>
 		<string>Applications/dlapp.app</string>
 		<key>CFBundleIdentifier</key>
-		<string>com.supwisdom.dlapp</string>
+		<string>com.dalicitycard.app</string>
 		<key>CFBundleShortVersionString</key>
-		<string>1.0.0</string>
+		<string>1.0.4</string>
 		<key>CFBundleVersion</key>
-		<string>1.0.0</string>
+		<string>1.0.4</string>
 		<key>SigningIdentity</key>
-		<string>iPhone Developer: wang sheng (5Z23CVC58F)</string>
+		<string>iPhone Developer: chuan xu (8FWH8QKULT)</string>
 		<key>Team</key>
-		<string>74UNETA6B2</string>
+		<string>58ZC23SH57</string>
 	</dict>
 	<key>ArchiveVersion</key>
 	<integer>2</integer>
 	<key>CreationDate</key>
-	<date>2019-07-12T05:53:30Z</date>
+	<date>2019-09-25T06:49:04Z</date>
 	<key>Name</key>
 	<string>dlapp</string>
 	<key>SchemeName</key>
diff --git a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon20x20@2x.png b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon20x20@2x.png
index 89f0031..b6d39e0 100644
--- a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon20x20@2x.png
+++ b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon20x20@2x.png
Binary files differ
diff --git a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon20x20@2x~ipad.png b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon20x20@2x~ipad.png
index 89f0031..b6d39e0 100644
--- a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon20x20@2x~ipad.png
+++ b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon20x20@2x~ipad.png
Binary files differ
diff --git a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon20x20@3x.png b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon20x20@3x.png
index b4f7708..6c57027 100644
--- a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon20x20@3x.png
+++ b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon20x20@3x.png
Binary files differ
diff --git a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon20x20~ipad.png b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon20x20~ipad.png
index 97fe2a7..cf8d677 100644
--- a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon20x20~ipad.png
+++ b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon20x20~ipad.png
Binary files differ
diff --git a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon29x29.png b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon29x29.png
index 26b9f7d..0300838 100644
--- a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon29x29.png
+++ b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon29x29.png
Binary files differ
diff --git a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon29x29@2x.png b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon29x29@2x.png
index 695a56a..f0b5e77 100644
--- a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon29x29@2x.png
+++ b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon29x29@2x.png
Binary files differ
diff --git a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon29x29@2x~ipad.png b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon29x29@2x~ipad.png
index 695a56a..f0b5e77 100644
--- a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon29x29@2x~ipad.png
+++ b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon29x29@2x~ipad.png
Binary files differ
diff --git a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon29x29@3x.png b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon29x29@3x.png
index 6856c41..4b12f07 100644
--- a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon29x29@3x.png
+++ b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon29x29@3x.png
Binary files differ
diff --git a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon29x29~ipad.png b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon29x29~ipad.png
index 26b9f7d..0300838 100644
--- a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon29x29~ipad.png
+++ b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon29x29~ipad.png
Binary files differ
diff --git a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon40x40@2x.png b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon40x40@2x.png
index 5616521..0eed434 100644
--- a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon40x40@2x.png
+++ b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon40x40@2x.png
Binary files differ
diff --git a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon40x40@2x~ipad.png b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon40x40@2x~ipad.png
index 5616521..0eed434 100644
--- a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon40x40@2x~ipad.png
+++ b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon40x40@2x~ipad.png
Binary files differ
diff --git a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon40x40@3x.png b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon40x40@3x.png
index d8be90e..d7269ae 100644
--- a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon40x40@3x.png
+++ b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon40x40@3x.png
Binary files differ
diff --git a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon40x40~ipad.png b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon40x40~ipad.png
index 89f0031..b6d39e0 100644
--- a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon40x40~ipad.png
+++ b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon40x40~ipad.png
Binary files differ
diff --git a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon50x50@2x~ipad.png b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon50x50@2x~ipad.png
deleted file mode 100644
index 3c6aab8..0000000
--- a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon50x50@2x~ipad.png
+++ /dev/null
Binary files differ
diff --git a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon50x50~ipad.png b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon50x50~ipad.png
deleted file mode 100644
index fd39d52..0000000
--- a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon50x50~ipad.png
+++ /dev/null
Binary files differ
diff --git a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon57x57.png b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon57x57.png
deleted file mode 100644
index aac8369..0000000
--- a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon57x57.png
+++ /dev/null
Binary files differ
diff --git a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon57x57@2x.png b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon57x57@2x.png
deleted file mode 100644
index 122e1e5..0000000
--- a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon57x57@2x.png
+++ /dev/null
Binary files differ
diff --git a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon60x60@2x.png b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon60x60@2x.png
index d8be90e..d7269ae 100644
--- a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon60x60@2x.png
+++ b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon60x60@2x.png
Binary files differ
diff --git a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon60x60@3x.png b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon60x60@3x.png
index 5442493..23fc9e6 100644
--- a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon60x60@3x.png
+++ b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon60x60@3x.png
Binary files differ
diff --git a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon72x72@2x~ipad.png b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon72x72@2x~ipad.png
deleted file mode 100644
index 4c9c847..0000000
--- a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon72x72@2x~ipad.png
+++ /dev/null
Binary files differ
diff --git a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon72x72~ipad.png b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon72x72~ipad.png
deleted file mode 100644
index 7b71834..0000000
--- a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon72x72~ipad.png
+++ /dev/null
Binary files differ
diff --git a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon76x76@2x~ipad.png b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon76x76@2x~ipad.png
index 11b7fce..95c031b 100644
--- a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon76x76@2x~ipad.png
+++ b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon76x76@2x~ipad.png
Binary files differ
diff --git a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon76x76~ipad.png b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon76x76~ipad.png
index fa527b6..c9fb74c 100644
--- a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon76x76~ipad.png
+++ b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon76x76~ipad.png
Binary files differ
diff --git a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon83.5x83.5@2x~ipad.png b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon83.5x83.5@2x~ipad.png
index 6ece2a1..c9e7e72 100644
--- a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon83.5x83.5@2x~ipad.png
+++ b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/AppIcon83.5x83.5@2x~ipad.png
Binary files differ
diff --git a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/Assets.car b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/Assets.car
index 223d896..694b01d 100644
--- a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/Assets.car
+++ b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/Assets.car
Binary files differ
diff --git a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/Frameworks/libswiftAVFoundation.dylib b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/Frameworks/libswiftAVFoundation.dylib
index bb010a6..24c2de2 100755
--- a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/Frameworks/libswiftAVFoundation.dylib
+++ b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/Frameworks/libswiftAVFoundation.dylib
Binary files differ
diff --git a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/Frameworks/libswiftCore.dylib b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/Frameworks/libswiftCore.dylib
index 11a6c1b..e2b92ee 100755
--- a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/Frameworks/libswiftCore.dylib
+++ b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/Frameworks/libswiftCore.dylib
Binary files differ
diff --git a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/Frameworks/libswiftCoreAudio.dylib b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/Frameworks/libswiftCoreAudio.dylib
index fdbd59d..4a8696c 100755
--- a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/Frameworks/libswiftCoreAudio.dylib
+++ b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/Frameworks/libswiftCoreAudio.dylib
Binary files differ
diff --git a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/Frameworks/libswiftCoreFoundation.dylib b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/Frameworks/libswiftCoreFoundation.dylib
index 6dde0a6..6c6db60 100755
--- a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/Frameworks/libswiftCoreFoundation.dylib
+++ b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/Frameworks/libswiftCoreFoundation.dylib
Binary files differ
diff --git a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/Frameworks/libswiftCoreGraphics.dylib b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/Frameworks/libswiftCoreGraphics.dylib
index e852e20..dbdda11 100755
--- a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/Frameworks/libswiftCoreGraphics.dylib
+++ b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/Frameworks/libswiftCoreGraphics.dylib
Binary files differ
diff --git a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/Frameworks/libswiftCoreImage.dylib b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/Frameworks/libswiftCoreImage.dylib
index 9a5d5a1..a270cb7 100755
--- a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/Frameworks/libswiftCoreImage.dylib
+++ b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/Frameworks/libswiftCoreImage.dylib
Binary files differ
diff --git a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/Frameworks/libswiftCoreMedia.dylib b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/Frameworks/libswiftCoreMedia.dylib
index 58fdcb0..d69a005 100755
--- a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/Frameworks/libswiftCoreMedia.dylib
+++ b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/Frameworks/libswiftCoreMedia.dylib
Binary files differ
diff --git a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/Frameworks/libswiftDarwin.dylib b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/Frameworks/libswiftDarwin.dylib
index 16bfa7a..6757d90 100755
--- a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/Frameworks/libswiftDarwin.dylib
+++ b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/Frameworks/libswiftDarwin.dylib
Binary files differ
diff --git a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/Frameworks/libswiftDispatch.dylib b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/Frameworks/libswiftDispatch.dylib
index 56c2c05..589e184 100755
--- a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/Frameworks/libswiftDispatch.dylib
+++ b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/Frameworks/libswiftDispatch.dylib
Binary files differ
diff --git a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/Frameworks/libswiftFoundation.dylib b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/Frameworks/libswiftFoundation.dylib
index 20ac92a..637c518 100755
--- a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/Frameworks/libswiftFoundation.dylib
+++ b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/Frameworks/libswiftFoundation.dylib
Binary files differ
diff --git a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/Frameworks/libswiftMetal.dylib b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/Frameworks/libswiftMetal.dylib
index 2fafbb3..b563931 100755
--- a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/Frameworks/libswiftMetal.dylib
+++ b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/Frameworks/libswiftMetal.dylib
Binary files differ
diff --git a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/Frameworks/libswiftObjectiveC.dylib b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/Frameworks/libswiftObjectiveC.dylib
index 34de80c..c260f2c 100755
--- a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/Frameworks/libswiftObjectiveC.dylib
+++ b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/Frameworks/libswiftObjectiveC.dylib
Binary files differ
diff --git a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/Frameworks/libswiftQuartzCore.dylib b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/Frameworks/libswiftQuartzCore.dylib
index 4b37bfa..ca49fd4 100755
--- a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/Frameworks/libswiftQuartzCore.dylib
+++ b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/Frameworks/libswiftQuartzCore.dylib
Binary files differ
diff --git a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/Frameworks/libswiftSwiftOnoneSupport.dylib b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/Frameworks/libswiftSwiftOnoneSupport.dylib
index a1aa841..4ca3c94 100755
--- a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/Frameworks/libswiftSwiftOnoneSupport.dylib
+++ b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/Frameworks/libswiftSwiftOnoneSupport.dylib
Binary files differ
diff --git a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/Frameworks/libswiftUIKit.dylib b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/Frameworks/libswiftUIKit.dylib
index 7b1df0a..44d9a82 100755
--- a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/Frameworks/libswiftUIKit.dylib
+++ b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/Frameworks/libswiftUIKit.dylib
Binary files differ
diff --git a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/Frameworks/libswiftos.dylib b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/Frameworks/libswiftos.dylib
index c9713b5..7cb498f 100755
--- a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/Frameworks/libswiftos.dylib
+++ b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/Frameworks/libswiftos.dylib
Binary files differ
diff --git a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/Frameworks/libswiftsimd.dylib b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/Frameworks/libswiftsimd.dylib
index 0abe019..4763208 100755
--- a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/Frameworks/libswiftsimd.dylib
+++ b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/Frameworks/libswiftsimd.dylib
Binary files differ
diff --git a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/Info.plist b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/Info.plist
index ecc0335..08ebb57 100644
--- a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/Info.plist
+++ b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/Info.plist
Binary files differ
diff --git a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/JPushConfig.plist b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/JPushConfig.plist
new file mode 100644
index 0000000..96bc470
--- /dev/null
+++ b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/JPushConfig.plist
Binary files differ
diff --git a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/MainViewController.nib b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/MainViewController.nib
index 953b2d2..47321ea 100644
--- a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/MainViewController.nib
+++ b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/MainViewController.nib
Binary files differ
diff --git a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/_CodeSignature/CodeResources b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/_CodeSignature/CodeResources
index 47cd0b7..8083a0e 100644
--- a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/_CodeSignature/CodeResources
+++ b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/_CodeSignature/CodeResources
@@ -6,175 +6,155 @@
 	<dict>
 		<key>AppIcon20x20@2x.png</key>
 		<data>
-		DjEAtviupMghxdL+fkyb3vVUBOI=
+		4s3iHwVtc4D5rEDx0dsVP3Ccp+M=
 		</data>
 		<key>AppIcon20x20@2x~ipad.png</key>
 		<data>
-		DjEAtviupMghxdL+fkyb3vVUBOI=
+		4s3iHwVtc4D5rEDx0dsVP3Ccp+M=
 		</data>
 		<key>AppIcon20x20@3x.png</key>
 		<data>
-		BfVRyLrHGHJm+0WuwuOPqz2aCas=
+		inNMZ0LYnXYtiXOTodGWImyL6MU=
 		</data>
 		<key>AppIcon20x20~ipad.png</key>
 		<data>
-		H6rZilBJB9YKOyY97leKlTxy6XM=
+		QgEmJmozGUfF6Gxc90W4zVT/ZEk=
 		</data>
 		<key>AppIcon29x29.png</key>
 		<data>
-		otncBRMMKVzMW+iwsSzrGJYek6w=
+		HHDfUCqu1hpJ1qn2R16w+JzH8/k=
 		</data>
 		<key>AppIcon29x29@2x.png</key>
 		<data>
-		Ro2/nf0nqrSy4vCWu94qHBsgntU=
+		dpGzXh2r7rpz2qmVWfS/drJRxFk=
 		</data>
 		<key>AppIcon29x29@2x~ipad.png</key>
 		<data>
-		Ro2/nf0nqrSy4vCWu94qHBsgntU=
+		dpGzXh2r7rpz2qmVWfS/drJRxFk=
 		</data>
 		<key>AppIcon29x29@3x.png</key>
 		<data>
-		QDnu1K3zTpRFbUpH1pc06nQXP/4=
+		gcxHkRSzkCsIG42uKL9uYXOrdJE=
 		</data>
 		<key>AppIcon29x29~ipad.png</key>
 		<data>
-		otncBRMMKVzMW+iwsSzrGJYek6w=
+		HHDfUCqu1hpJ1qn2R16w+JzH8/k=
 		</data>
 		<key>AppIcon40x40@2x.png</key>
 		<data>
-		bqhTfe/UUsLmwqwKtmYfpBNyHHE=
+		BcBek5g6jsOqa0ibWCnC1JTgL+c=
 		</data>
 		<key>AppIcon40x40@2x~ipad.png</key>
 		<data>
-		bqhTfe/UUsLmwqwKtmYfpBNyHHE=
+		BcBek5g6jsOqa0ibWCnC1JTgL+c=
 		</data>
 		<key>AppIcon40x40@3x.png</key>
 		<data>
-		7bf8dqKMlGV9BeNvI9Z4FC+62EU=
+		+0oGxBUPkB+c6Z7XyUmtZpCo2lU=
 		</data>
 		<key>AppIcon40x40~ipad.png</key>
 		<data>
-		DjEAtviupMghxdL+fkyb3vVUBOI=
-		</data>
-		<key>AppIcon50x50@2x~ipad.png</key>
-		<data>
-		04wFY+JbiDwIxpPmec88nEldiCY=
-		</data>
-		<key>AppIcon50x50~ipad.png</key>
-		<data>
-		+ULYPtkyH7TWwGxGEFNW6M8jLYE=
-		</data>
-		<key>AppIcon57x57.png</key>
-		<data>
-		PbF/1dvCpOLYNWV+g1MRQWl4WnE=
-		</data>
-		<key>AppIcon57x57@2x.png</key>
-		<data>
-		V0sslzjLj1HAL3zLlk8dvEctXT0=
+		4s3iHwVtc4D5rEDx0dsVP3Ccp+M=
 		</data>
 		<key>AppIcon60x60@2x.png</key>
 		<data>
-		7bf8dqKMlGV9BeNvI9Z4FC+62EU=
+		+0oGxBUPkB+c6Z7XyUmtZpCo2lU=
 		</data>
 		<key>AppIcon60x60@3x.png</key>
 		<data>
-		u4hDZJNq/M9gB/k7ZWPGCQh1dlY=
-		</data>
-		<key>AppIcon72x72@2x~ipad.png</key>
-		<data>
-		6XXlAQJ+2YZtK4XZVDeAXCGQAjs=
-		</data>
-		<key>AppIcon72x72~ipad.png</key>
-		<data>
-		qt7V3ayH99MYvDNK/r88oIVhpxI=
+		2N92m9WnIZ8k7WASphMkppCl7HA=
 		</data>
 		<key>AppIcon76x76@2x~ipad.png</key>
 		<data>
-		dPM76DtwjHUolue6BdDUn6RQXnQ=
+		iMfY34hWth/mR2xKqlWonHWYrDQ=
 		</data>
 		<key>AppIcon76x76~ipad.png</key>
 		<data>
-		mVA2cm+ufolVC0dfMnpXBt7NFYw=
+		z6rQV98PVDRhQUXa/DwAbinm0SA=
 		</data>
 		<key>AppIcon83.5x83.5@2x~ipad.png</key>
 		<data>
-		F3/BziTbXcn/vpTHvub/+Txde8U=
+		oJtSiDfNgPpCB0QhhFClnkrbXcQ=
 		</data>
 		<key>Assets.car</key>
 		<data>
-		r9rUGcVj88K1Zc51XtyyT15hnfk=
+		KKAirXh8K/ModwnSXLShV5/etr0=
 		</data>
 		<key>Frameworks/libswiftAVFoundation.dylib</key>
 		<data>
-		ukqktZJa/8A+eCPL/P22HQgAC1k=
+		uDfYCHXGi4LJJ7PehI1sKbZqVf4=
 		</data>
 		<key>Frameworks/libswiftCore.dylib</key>
 		<data>
-		GREBcl8kDXtAsOe5ywfZW3xto9k=
+		hnZxV4PUHdqbt8IOBCPhBpfSwUE=
 		</data>
 		<key>Frameworks/libswiftCoreAudio.dylib</key>
 		<data>
-		hT5I0SMVXfebWk6J/t2JG8P9cLw=
+		/mmLx8jrVORtoTACElCyWqzqYfA=
 		</data>
 		<key>Frameworks/libswiftCoreFoundation.dylib</key>
 		<data>
-		LDYTh6fyuPjxuyAKIBufA7E4nDw=
+		v7BE4evcLJt3iFrwd9m33m5rFI8=
 		</data>
 		<key>Frameworks/libswiftCoreGraphics.dylib</key>
 		<data>
-		ZD7SY7zfzZOkv/ex3o4soLRgyKU=
+		qxYPH4/wxggOGD73Xj6EkCR0xkY=
 		</data>
 		<key>Frameworks/libswiftCoreImage.dylib</key>
 		<data>
-		pDi7kJiFWg8POUcZ02wMhGdzpEU=
+		vlRBCfDqtrrwzkBLtGs2HbO4YbI=
 		</data>
 		<key>Frameworks/libswiftCoreMedia.dylib</key>
 		<data>
-		rs4o8hPdZsIaykGs8h6jw9/bEac=
+		CyOREkCX0hnTg5JHbY6kdrfAERI=
 		</data>
 		<key>Frameworks/libswiftDarwin.dylib</key>
 		<data>
-		nqFz221Io6AgWQK2mjBZH53FOBQ=
+		nd3vDcLn6YQQrhlqobWhMV/sLAE=
 		</data>
 		<key>Frameworks/libswiftDispatch.dylib</key>
 		<data>
-		5SUy+afr0k0FIaWpa01vu9OoYsk=
+		Xlup3R5V6sXScSmXMkAysKJWVXk=
 		</data>
 		<key>Frameworks/libswiftFoundation.dylib</key>
 		<data>
-		4KLJXVVgDMFE0WIsT9hLmcA7DNo=
+		6FQCjaFEt9vOMPGkD3Bi4b9USw0=
 		</data>
 		<key>Frameworks/libswiftMetal.dylib</key>
 		<data>
-		sLaCL5cSVZgN2tzYV0APfk1uaRM=
+		JJGt6xWjffN+5mM0q0dDOmJ8dDE=
 		</data>
 		<key>Frameworks/libswiftObjectiveC.dylib</key>
 		<data>
-		aKLtw+VhPxXGVOKvhsUQPeGTNW0=
+		OIdIVW04vwXmE+cHkwyzMTkbvnU=
 		</data>
 		<key>Frameworks/libswiftQuartzCore.dylib</key>
 		<data>
-		DAih33A0MVtJw87+AJ1vZeye528=
+		cshqKXNDw3S4IFGWYenc+0CqhCk=
 		</data>
 		<key>Frameworks/libswiftSwiftOnoneSupport.dylib</key>
 		<data>
-		yXFysLEA844zanH61b0YqEDGMks=
+		T9TevUnkeG5ZEUxj0Pdl4fF0vUE=
 		</data>
 		<key>Frameworks/libswiftUIKit.dylib</key>
 		<data>
-		0IIDJ+kZElM4TpEU9I1GwOCQUvQ=
+		TrQW8qKOdy8IEbHkKhWe3R+o2ZM=
 		</data>
 		<key>Frameworks/libswiftos.dylib</key>
 		<data>
-		v5ybt8/g6uVCJbKKlrL6rvz9cMM=
+		TQ11eqpSTjqthNmaPsfIeasSdUk=
 		</data>
 		<key>Frameworks/libswiftsimd.dylib</key>
 		<data>
-		A8vh5DhJOdsNjcnMpf8HZmtFLt0=
+		3yFMAEujHZwmMLxWNEPsqtRI7l8=
 		</data>
 		<key>Info.plist</key>
 		<data>
-		xCcMK6i5qsOv40GndCWSWjMi70w=
+		ptakydEySnuUqGLwmDSThlf9kP8=
+		</data>
+		<key>JPushConfig.plist</key>
+		<data>
+		qV/PQh+d737riAnpOVOo2BJPYKw=
 		</data>
 		<key>LaunchImage-1100-Landscape-2436h@3x.png</key>
 		<data>
@@ -218,7 +198,7 @@
 		</data>
 		<key>MainViewController.nib</key>
 		<data>
-		c8qwsmtNPeDXR5piUQXUJZV4NkU=
+		Hbj+jg8kHggfQilLv2funLLiKdE=
 		</data>
 		<key>PkgInfo</key>
 		<data>
@@ -226,11 +206,11 @@
 		</data>
 		<key>config.xml</key>
 		<data>
-		O33IIDUH183cwlV6v9zaOFqmJ1o=
+		IgESgLidVuYaBKc1zJzsW9K32uo=
 		</data>
 		<key>embedded.mobileprovision</key>
 		<data>
-		WNm5zuPz65rrY9t5qIL1iJgFcQ8=
+		OuWZMIad+tog0ZMleeOfjgsQuoo=
 		</data>
 		<key>www/bill.html</key>
 		<data>
@@ -238,7 +218,7 @@
 		</data>
 		<key>www/billdetail.html</key>
 		<data>
-		cqHtFm0XLXtu3pFFlRV0wqo3bLo=
+		x+c/i1RxokvMGRSy2owEyEKzgmg=
 		</data>
 		<key>www/bindcard.html</key>
 		<data>
@@ -278,7 +258,7 @@
 		</data>
 		<key>www/cordova_plugins.js</key>
 		<data>
-		5yQtgIC/T2E5OFopQG2kN+WdYrI=
+		mjZMhcaV9rGT+gEJycqyUiJiwp8=
 		</data>
 		<key>www/css/aui-iconfont.ttf</key>
 		<data>
@@ -398,7 +378,7 @@
 		</data>
 		<key>www/js/billdetail.js</key>
 		<data>
-		ICgW8NAQBBEJmmNYuELt2HMjRtk=
+		sxiH889o1dm1Uaqbq7ReLFK47h0=
 		</data>
 		<key>www/js/bindcard.js</key>
 		<data>
@@ -438,7 +418,7 @@
 		</data>
 		<key>www/js/index.js</key>
 		<data>
-		asyakUNRxlJpE4P7WMiyTJTY97Y=
+		B5X6EPmPRDoyX3Z9Eq1q8rmGSGQ=
 		</data>
 		<key>www/js/lib/aui-actionsheet.js</key>
 		<data>
@@ -542,11 +522,11 @@
 		</data>
 		<key>www/js/login.js</key>
 		<data>
-		GnaACCIZ8j2xg8PJGAWxS4CymgM=
+		ldWa4XoqiR3SZsamE16ZBUrQDT4=
 		</data>
 		<key>www/js/main.js</key>
 		<data>
-		I2Jj7RTovo4kH11m8CRuakKi3nk=
+		QSdOeA6BefLzgiGbSEou4rGjHqo=
 		</data>
 		<key>www/js/mobile.js</key>
 		<data>
@@ -566,23 +546,23 @@
 		</data>
 		<key>www/js/qrcode.js</key>
 		<data>
-		nUamfLQSBc/NAzOMJP5WwXnZGxI=
+		Cx6iRRJAH08QlPBBT//jwM7LZP4=
 		</data>
 		<key>www/js/register.js</key>
 		<data>
-		aPLw5ln4ElwhbTzbdXZpyILJBiY=
+		kEIN8Lt6KbeSEYmiYk47uhchWg8=
 		</data>
 		<key>www/js/scan.js</key>
 		<data>
-		xRDtmYCYmFtZu+H1/SjTBlennsM=
+		Cea6nn8OF3hogSuEpiL+IkVdO0I=
 		</data>
 		<key>www/js/security.js</key>
 		<data>
-		s52wwGEv5fJuX8ngkR5GGqdAXMg=
+		B2Cv1FDNaUjne/EkpPvlr5Cve88=
 		</data>
 		<key>www/js/server.js</key>
 		<data>
-		6JlWzinRBn6MsREucfIEiCvn5oA=
+		jp9NlgHW1O72GXbxGb4cmcCVw+w=
 		</data>
 		<key>www/js/signxy.js</key>
 		<data>
@@ -908,6 +888,10 @@
 		<data>
 		09a/If3TGPR46gxmzbSwdbcSvBc=
 		</data>
+		<key>www/plugins/cordova-plugin-app-version/www/AppVersionPlugin.js</key>
+		<data>
+		V7Ywjbu2Kj4wesp8mWW2lF5aDpE=
+		</data>
 		<key>www/plugins/cordova-plugin-camera/www/Camera.js</key>
 		<data>
 		/Tl12sGFo/UZbPqnupaaV0Hg0vU=
@@ -1040,17 +1024,29 @@
 		<data>
 		oGafU2UdHnS6q3vnNz3WB2an0TY=
 		</data>
+		<key>www/plugins/cordova-plugin-wkwebview-engine/src/www/ios/ios-wkwebview-exec.js</key>
+		<data>
+		Jf+80xptQsEGhUiGLgqUT/RQinI=
+		</data>
+		<key>www/plugins/cordova-plugin-wkwebview-engine/src/www/ios/ios-wkwebview.js</key>
+		<data>
+		uSpOoBJtw3huMClDN2UUZQOjz/Y=
+		</data>
+		<key>www/plugins/jpush-phonegap-plugin/www/JPushPlugin.js</key>
+		<data>
+		WbD83XEtIdDDWazehjb7DykZYCE=
+		</data>
 		<key>www/pwdset.html</key>
 		<data>
 		V3rync0T0/WyYm1RxOmrQ0VHwls=
 		</data>
 		<key>www/qrcode.html</key>
 		<data>
-		/T8vAhNAeCOJv1Hw6L4detL0zZE=
+		FK8oc1oB59vB31qmvZp+SzcB9/U=
 		</data>
 		<key>www/register.html</key>
 		<data>
-		q/NP40bBQOZfbeq+nId2UNahWqk=
+		j0E17LezraXxL2i9s0tnnWrl9vw=
 		</data>
 		<key>www/scan.html</key>
 		<data>
@@ -1058,7 +1054,7 @@
 		</data>
 		<key>www/security.html</key>
 		<data>
-		LQqkVW0wcKOsVTN4GeoIHaLFmHA=
+		3isNUT+DEogiz2Le39n8VyG+mRQ=
 		</data>
 		<key>www/signxy.html</key>
 		<data>
@@ -1079,462 +1075,407 @@
 		<dict>
 			<key>hash</key>
 			<data>
-			DjEAtviupMghxdL+fkyb3vVUBOI=
+			4s3iHwVtc4D5rEDx0dsVP3Ccp+M=
 			</data>
 			<key>hash2</key>
 			<data>
-			8gs3eoIb4H9cpuPaDkErBai6L4FZOZfyttI/pYM3Hw4=
+			/jx2HIiBG+oNpd+0usVeIZxAvkA27ZpiSAex3riWFHQ=
 			</data>
 		</dict>
 		<key>AppIcon20x20@2x~ipad.png</key>
 		<dict>
 			<key>hash</key>
 			<data>
-			DjEAtviupMghxdL+fkyb3vVUBOI=
+			4s3iHwVtc4D5rEDx0dsVP3Ccp+M=
 			</data>
 			<key>hash2</key>
 			<data>
-			8gs3eoIb4H9cpuPaDkErBai6L4FZOZfyttI/pYM3Hw4=
+			/jx2HIiBG+oNpd+0usVeIZxAvkA27ZpiSAex3riWFHQ=
 			</data>
 		</dict>
 		<key>AppIcon20x20@3x.png</key>
 		<dict>
 			<key>hash</key>
 			<data>
-			BfVRyLrHGHJm+0WuwuOPqz2aCas=
+			inNMZ0LYnXYtiXOTodGWImyL6MU=
 			</data>
 			<key>hash2</key>
 			<data>
-			wB8DRUnh3AMIUfOsoN2UakYsGsGtVsCMKPqymkIfzys=
+			BR1eZknKOY1H7MAyXZld2yKSOCayLZBdlj5QRFNTSws=
 			</data>
 		</dict>
 		<key>AppIcon20x20~ipad.png</key>
 		<dict>
 			<key>hash</key>
 			<data>
-			H6rZilBJB9YKOyY97leKlTxy6XM=
+			QgEmJmozGUfF6Gxc90W4zVT/ZEk=
 			</data>
 			<key>hash2</key>
 			<data>
-			sDvITbxB8+WSbGLw2hi9wNucw935HeGWu6F47RDuyDo=
+			Ck2d8ewvZ1cjSx6Vo6hRiwiKcwV7Khb61Rslp5EBorE=
 			</data>
 		</dict>
 		<key>AppIcon29x29.png</key>
 		<dict>
 			<key>hash</key>
 			<data>
-			otncBRMMKVzMW+iwsSzrGJYek6w=
+			HHDfUCqu1hpJ1qn2R16w+JzH8/k=
 			</data>
 			<key>hash2</key>
 			<data>
-			j3+Oyaoj9BUqxemeJFSZ5I6ZMXcDWGER+zX0zKI5qXk=
+			lFwBNCRgbv9HY1G5bOKNhPiyURhYafyWeI84Xcl8ljg=
 			</data>
 		</dict>
 		<key>AppIcon29x29@2x.png</key>
 		<dict>
 			<key>hash</key>
 			<data>
-			Ro2/nf0nqrSy4vCWu94qHBsgntU=
+			dpGzXh2r7rpz2qmVWfS/drJRxFk=
 			</data>
 			<key>hash2</key>
 			<data>
-			bGGPXkSeFsyh7eAmq5YgeHYkFDjIsqsr4Yt3dpj09N0=
+			nqN/EqFaooiXfy5K9WhOXvone1cRRvxgsXw4DnLmVlA=
 			</data>
 		</dict>
 		<key>AppIcon29x29@2x~ipad.png</key>
 		<dict>
 			<key>hash</key>
 			<data>
-			Ro2/nf0nqrSy4vCWu94qHBsgntU=
+			dpGzXh2r7rpz2qmVWfS/drJRxFk=
 			</data>
 			<key>hash2</key>
 			<data>
-			bGGPXkSeFsyh7eAmq5YgeHYkFDjIsqsr4Yt3dpj09N0=
+			nqN/EqFaooiXfy5K9WhOXvone1cRRvxgsXw4DnLmVlA=
 			</data>
 		</dict>
 		<key>AppIcon29x29@3x.png</key>
 		<dict>
 			<key>hash</key>
 			<data>
-			QDnu1K3zTpRFbUpH1pc06nQXP/4=
+			gcxHkRSzkCsIG42uKL9uYXOrdJE=
 			</data>
 			<key>hash2</key>
 			<data>
-			2TxWQw5j1QBbjE38vdn2xOMy4knvqkZ/nNLUWNt0sCI=
+			4VwirX+1pgq35pmm0UyXcG2+NXkxl6DvDAFQ9dvqiLs=
 			</data>
 		</dict>
 		<key>AppIcon29x29~ipad.png</key>
 		<dict>
 			<key>hash</key>
 			<data>
-			otncBRMMKVzMW+iwsSzrGJYek6w=
+			HHDfUCqu1hpJ1qn2R16w+JzH8/k=
 			</data>
 			<key>hash2</key>
 			<data>
-			j3+Oyaoj9BUqxemeJFSZ5I6ZMXcDWGER+zX0zKI5qXk=
+			lFwBNCRgbv9HY1G5bOKNhPiyURhYafyWeI84Xcl8ljg=
 			</data>
 		</dict>
 		<key>AppIcon40x40@2x.png</key>
 		<dict>
 			<key>hash</key>
 			<data>
-			bqhTfe/UUsLmwqwKtmYfpBNyHHE=
+			BcBek5g6jsOqa0ibWCnC1JTgL+c=
 			</data>
 			<key>hash2</key>
 			<data>
-			tFvg6swsA5hwLRDfRCDi7CMI0P+ViFf6IgRScxSlb/0=
+			9WHfcGm0K8HueWfC1UjexYAfaBhvFKeDZfsEyFCEtx4=
 			</data>
 		</dict>
 		<key>AppIcon40x40@2x~ipad.png</key>
 		<dict>
 			<key>hash</key>
 			<data>
-			bqhTfe/UUsLmwqwKtmYfpBNyHHE=
+			BcBek5g6jsOqa0ibWCnC1JTgL+c=
 			</data>
 			<key>hash2</key>
 			<data>
-			tFvg6swsA5hwLRDfRCDi7CMI0P+ViFf6IgRScxSlb/0=
+			9WHfcGm0K8HueWfC1UjexYAfaBhvFKeDZfsEyFCEtx4=
 			</data>
 		</dict>
 		<key>AppIcon40x40@3x.png</key>
 		<dict>
 			<key>hash</key>
 			<data>
-			7bf8dqKMlGV9BeNvI9Z4FC+62EU=
+			+0oGxBUPkB+c6Z7XyUmtZpCo2lU=
 			</data>
 			<key>hash2</key>
 			<data>
-			5V8UjSCgkmKRVOYu+FRB0+yhTL1NtlVCTmBhpUNWgC0=
+			F6dGIPQp/X9Huj5SI1FnfRlgqZsfJ8plPgS5DLXmyHc=
 			</data>
 		</dict>
 		<key>AppIcon40x40~ipad.png</key>
 		<dict>
 			<key>hash</key>
 			<data>
-			DjEAtviupMghxdL+fkyb3vVUBOI=
+			4s3iHwVtc4D5rEDx0dsVP3Ccp+M=
 			</data>
 			<key>hash2</key>
 			<data>
-			8gs3eoIb4H9cpuPaDkErBai6L4FZOZfyttI/pYM3Hw4=
-			</data>
-		</dict>
-		<key>AppIcon50x50@2x~ipad.png</key>
-		<dict>
-			<key>hash</key>
-			<data>
-			04wFY+JbiDwIxpPmec88nEldiCY=
-			</data>
-			<key>hash2</key>
-			<data>
-			Fgd22lgmtvaG3tzLwnbu57xZPQfGb7kA8fw+v4xYq7M=
-			</data>
-		</dict>
-		<key>AppIcon50x50~ipad.png</key>
-		<dict>
-			<key>hash</key>
-			<data>
-			+ULYPtkyH7TWwGxGEFNW6M8jLYE=
-			</data>
-			<key>hash2</key>
-			<data>
-			EZireyXQZ2BAg+xIagkCS36vnwTAT9Gj4klrLYnBaK0=
-			</data>
-		</dict>
-		<key>AppIcon57x57.png</key>
-		<dict>
-			<key>hash</key>
-			<data>
-			PbF/1dvCpOLYNWV+g1MRQWl4WnE=
-			</data>
-			<key>hash2</key>
-			<data>
-			iSorb6M7XrIIMpCBr6awOme1bCqhFhETsVuGfC9jVjo=
-			</data>
-		</dict>
-		<key>AppIcon57x57@2x.png</key>
-		<dict>
-			<key>hash</key>
-			<data>
-			V0sslzjLj1HAL3zLlk8dvEctXT0=
-			</data>
-			<key>hash2</key>
-			<data>
-			3GoBd/2HILd1AINYIZ2VN5SyJll0gGaeOlrrU1Ca78A=
+			/jx2HIiBG+oNpd+0usVeIZxAvkA27ZpiSAex3riWFHQ=
 			</data>
 		</dict>
 		<key>AppIcon60x60@2x.png</key>
 		<dict>
 			<key>hash</key>
 			<data>
-			7bf8dqKMlGV9BeNvI9Z4FC+62EU=
+			+0oGxBUPkB+c6Z7XyUmtZpCo2lU=
 			</data>
 			<key>hash2</key>
 			<data>
-			5V8UjSCgkmKRVOYu+FRB0+yhTL1NtlVCTmBhpUNWgC0=
+			F6dGIPQp/X9Huj5SI1FnfRlgqZsfJ8plPgS5DLXmyHc=
 			</data>
 		</dict>
 		<key>AppIcon60x60@3x.png</key>
 		<dict>
 			<key>hash</key>
 			<data>
-			u4hDZJNq/M9gB/k7ZWPGCQh1dlY=
+			2N92m9WnIZ8k7WASphMkppCl7HA=
 			</data>
 			<key>hash2</key>
 			<data>
-			r8K3AZPdn6icGj4YUVtCtXHNle4pibhlywI7n8aG/Io=
-			</data>
-		</dict>
-		<key>AppIcon72x72@2x~ipad.png</key>
-		<dict>
-			<key>hash</key>
-			<data>
-			6XXlAQJ+2YZtK4XZVDeAXCGQAjs=
-			</data>
-			<key>hash2</key>
-			<data>
-			5WyvqaFUnD6nIdPHQmezpma8HivvHieK/L954As389E=
-			</data>
-		</dict>
-		<key>AppIcon72x72~ipad.png</key>
-		<dict>
-			<key>hash</key>
-			<data>
-			qt7V3ayH99MYvDNK/r88oIVhpxI=
-			</data>
-			<key>hash2</key>
-			<data>
-			/1yzmm2Ovvhnj5fOlzXwken4Gpd7Uskb1KN4X1Eh5wI=
+			dQmhVBOE7LllJ1jQuS6MlUwqAY9rw3N83U9OpTvQmUI=
 			</data>
 		</dict>
 		<key>AppIcon76x76@2x~ipad.png</key>
 		<dict>
 			<key>hash</key>
 			<data>
-			dPM76DtwjHUolue6BdDUn6RQXnQ=
+			iMfY34hWth/mR2xKqlWonHWYrDQ=
 			</data>
 			<key>hash2</key>
 			<data>
-			J9GAry/RDwypFKcWaJ/7THn0XDTXf1vkmuaPFHrNAuQ=
+			zDK30NWfjipDfaQp5rJ1roBf5sk1HCHP1AHfE8Koa3c=
 			</data>
 		</dict>
 		<key>AppIcon76x76~ipad.png</key>
 		<dict>
 			<key>hash</key>
 			<data>
-			mVA2cm+ufolVC0dfMnpXBt7NFYw=
+			z6rQV98PVDRhQUXa/DwAbinm0SA=
 			</data>
 			<key>hash2</key>
 			<data>
-			nE7QwQcdQpQt4n1d27B67A4367MV7J8kEhrSETTNr3g=
+			SEIGmphMB4mPWfJUCc/8/OEHXuPaOTnpwx7fqG/I01U=
 			</data>
 		</dict>
 		<key>AppIcon83.5x83.5@2x~ipad.png</key>
 		<dict>
 			<key>hash</key>
 			<data>
-			F3/BziTbXcn/vpTHvub/+Txde8U=
+			oJtSiDfNgPpCB0QhhFClnkrbXcQ=
 			</data>
 			<key>hash2</key>
 			<data>
-			+mzLV5S6RSIPr6LMndIfUYIEt1cTLOqITJ2VIkQ6SdM=
+			p9CZ5DH6P6Cwm2CIRfkZRVd5VcVYXRhHPP0Zdeujh7o=
 			</data>
 		</dict>
 		<key>Assets.car</key>
 		<dict>
 			<key>hash</key>
 			<data>
-			r9rUGcVj88K1Zc51XtyyT15hnfk=
+			KKAirXh8K/ModwnSXLShV5/etr0=
 			</data>
 			<key>hash2</key>
 			<data>
-			ZgQ1nWHWv23ukJB2SDcb1etq4KuOI3kJmGMZHGsiVvw=
+			nReIXWpgV9Kb7kvFFviDa0ldEsVlJYZnX3sW+zEIOoE=
 			</data>
 		</dict>
 		<key>Frameworks/libswiftAVFoundation.dylib</key>
 		<dict>
 			<key>hash</key>
 			<data>
-			ukqktZJa/8A+eCPL/P22HQgAC1k=
+			uDfYCHXGi4LJJ7PehI1sKbZqVf4=
 			</data>
 			<key>hash2</key>
 			<data>
-			M4OlrFfFLzLudxsH7utEaY6yys55xfptVE8j4xlWL+M=
+			uBXupAH/nHa8Xn0vQL18OKMoz5nwtyOQyRrDYywnT2Y=
 			</data>
 		</dict>
 		<key>Frameworks/libswiftCore.dylib</key>
 		<dict>
 			<key>hash</key>
 			<data>
-			GREBcl8kDXtAsOe5ywfZW3xto9k=
+			hnZxV4PUHdqbt8IOBCPhBpfSwUE=
 			</data>
 			<key>hash2</key>
 			<data>
-			NmIKl3IuKEnfk6TQDfg/hxldLif8PPCSgyk/b7+XSI4=
+			p6+Hu5nJHIAgwObOZvX2YVFv9uZmIAdxaXpuKk99HsQ=
 			</data>
 		</dict>
 		<key>Frameworks/libswiftCoreAudio.dylib</key>
 		<dict>
 			<key>hash</key>
 			<data>
-			hT5I0SMVXfebWk6J/t2JG8P9cLw=
+			/mmLx8jrVORtoTACElCyWqzqYfA=
 			</data>
 			<key>hash2</key>
 			<data>
-			7GhBnOiJ5bhxhV91S0ekBpUrvRIZ0L5ApDWhlnDQ8uI=
+			p9sdnJpMpkRQ+jg6wuB9bs/n5/l0uNQQlya0Vspe5Y4=
 			</data>
 		</dict>
 		<key>Frameworks/libswiftCoreFoundation.dylib</key>
 		<dict>
 			<key>hash</key>
 			<data>
-			LDYTh6fyuPjxuyAKIBufA7E4nDw=
+			v7BE4evcLJt3iFrwd9m33m5rFI8=
 			</data>
 			<key>hash2</key>
 			<data>
-			uovqNi2JxzxSDIoNaNMtcS7y/IyXBqf6098wTkXhsb0=
+			A8VfO5EJH/1XaYYpedcjFu0C8tPp6sULSQkH6c9Snk8=
 			</data>
 		</dict>
 		<key>Frameworks/libswiftCoreGraphics.dylib</key>
 		<dict>
 			<key>hash</key>
 			<data>
-			ZD7SY7zfzZOkv/ex3o4soLRgyKU=
+			qxYPH4/wxggOGD73Xj6EkCR0xkY=
 			</data>
 			<key>hash2</key>
 			<data>
-			tcHnlq2aVlHKRNtP9ohq6XGGo25HoGgsJPHifGTZ1Ac=
+			MATi1ECxIR33VrEed+K9v0VXz+qfWvzXZoZhaCeiA8c=
 			</data>
 		</dict>
 		<key>Frameworks/libswiftCoreImage.dylib</key>
 		<dict>
 			<key>hash</key>
 			<data>
-			pDi7kJiFWg8POUcZ02wMhGdzpEU=
+			vlRBCfDqtrrwzkBLtGs2HbO4YbI=
 			</data>
 			<key>hash2</key>
 			<data>
-			WDLdEDB3zi2tGexRfz08LjEVT3j8og+6wyTPQHTQHT8=
+			K47oJc8r9dJYRsWzi+BIhDtLTFCZihsGFBh+/mHQuVk=
 			</data>
 		</dict>
 		<key>Frameworks/libswiftCoreMedia.dylib</key>
 		<dict>
 			<key>hash</key>
 			<data>
-			rs4o8hPdZsIaykGs8h6jw9/bEac=
+			CyOREkCX0hnTg5JHbY6kdrfAERI=
 			</data>
 			<key>hash2</key>
 			<data>
-			AEdy6S/GUVhBVUHOrRHE5g3OrW4pUnI0thDZOQOZxZQ=
+			/fidqVROE0ZTPK+z2Ivl0fr9LvkZtMM+k/HfToN/S1A=
 			</data>
 		</dict>
 		<key>Frameworks/libswiftDarwin.dylib</key>
 		<dict>
 			<key>hash</key>
 			<data>
-			nqFz221Io6AgWQK2mjBZH53FOBQ=
+			nd3vDcLn6YQQrhlqobWhMV/sLAE=
 			</data>
 			<key>hash2</key>
 			<data>
-			BUgrEq27PObBjaOoTj+G+u+hFuEq7M3vlkY/s8O5a7o=
+			+jx6Y88pLiTayhNHrKV+cvGDubsban8mTTSKAFyxXtc=
 			</data>
 		</dict>
 		<key>Frameworks/libswiftDispatch.dylib</key>
 		<dict>
 			<key>hash</key>
 			<data>
-			5SUy+afr0k0FIaWpa01vu9OoYsk=
+			Xlup3R5V6sXScSmXMkAysKJWVXk=
 			</data>
 			<key>hash2</key>
 			<data>
-			wHUgmYozNY3bfu4CpL6djba9He3bckof8G1ofo8nMic=
+			kf3F5hCOQjxwhh0bnjLpfQ0at4IYiQXRnFA0GHgdKTM=
 			</data>
 		</dict>
 		<key>Frameworks/libswiftFoundation.dylib</key>
 		<dict>
 			<key>hash</key>
 			<data>
-			4KLJXVVgDMFE0WIsT9hLmcA7DNo=
+			6FQCjaFEt9vOMPGkD3Bi4b9USw0=
 			</data>
 			<key>hash2</key>
 			<data>
-			f6J5y+1XugEsZTcUTZq8FYg9jrT7NEWnFgapee7nFb4=
+			buTkqHRqLULyfmgfMfODWvRvz4dt1Cg/1Hrv5ndbJjk=
 			</data>
 		</dict>
 		<key>Frameworks/libswiftMetal.dylib</key>
 		<dict>
 			<key>hash</key>
 			<data>
-			sLaCL5cSVZgN2tzYV0APfk1uaRM=
+			JJGt6xWjffN+5mM0q0dDOmJ8dDE=
 			</data>
 			<key>hash2</key>
 			<data>
-			p14LLUwjoLf9mz5K4GdxzVpoa8o+wZhnbmxF5t5KJv8=
+			Q/eqOi5Bts/4DzykQhKDZEEmvs0P0XeelFxTIwKhuRY=
 			</data>
 		</dict>
 		<key>Frameworks/libswiftObjectiveC.dylib</key>
 		<dict>
 			<key>hash</key>
 			<data>
-			aKLtw+VhPxXGVOKvhsUQPeGTNW0=
+			OIdIVW04vwXmE+cHkwyzMTkbvnU=
 			</data>
 			<key>hash2</key>
 			<data>
-			nxEgKw/jGB/7OCCJAne8SPV33Gps2WecjqmARUKTxvE=
+			09Rh2HZy1FxjpKjOdWogDCPxC77vqjKOmnxFWTYTTbg=
 			</data>
 		</dict>
 		<key>Frameworks/libswiftQuartzCore.dylib</key>
 		<dict>
 			<key>hash</key>
 			<data>
-			DAih33A0MVtJw87+AJ1vZeye528=
+			cshqKXNDw3S4IFGWYenc+0CqhCk=
 			</data>
 			<key>hash2</key>
 			<data>
-			yPy4rgLRB2rXdHq4yEvupkl8k+pqFtHmGvfKRoNRP/8=
+			d6iUBJvHmPEduWaf3mresVZuJx5f0uDmj/Q6yKRf9xE=
 			</data>
 		</dict>
 		<key>Frameworks/libswiftSwiftOnoneSupport.dylib</key>
 		<dict>
 			<key>hash</key>
 			<data>
-			yXFysLEA844zanH61b0YqEDGMks=
+			T9TevUnkeG5ZEUxj0Pdl4fF0vUE=
 			</data>
 			<key>hash2</key>
 			<data>
-			Jn3taRNXsbgzubW9PHTU2xXZEq91hp8c72H3vME9OwA=
+			ZGaqmTrf9sdGpU6nQ3WEQmC/NopTbMZ9hbX1MW6WXXY=
 			</data>
 		</dict>
 		<key>Frameworks/libswiftUIKit.dylib</key>
 		<dict>
 			<key>hash</key>
 			<data>
-			0IIDJ+kZElM4TpEU9I1GwOCQUvQ=
+			TrQW8qKOdy8IEbHkKhWe3R+o2ZM=
 			</data>
 			<key>hash2</key>
 			<data>
-			KywBZaL/xBgq9w4HH7GynFaqSaYzCjIu9ct2h9atUEw=
+			f5qWx1UwiW+tVgxmWY2uRxr0eTEkWMqis3s5hJnUAIM=
 			</data>
 		</dict>
 		<key>Frameworks/libswiftos.dylib</key>
 		<dict>
 			<key>hash</key>
 			<data>
-			v5ybt8/g6uVCJbKKlrL6rvz9cMM=
+			TQ11eqpSTjqthNmaPsfIeasSdUk=
 			</data>
 			<key>hash2</key>
 			<data>
-			YAzhxDFbrJV7k5BjI+ZmIH1y0PzRtAoD2+/FzBkZU6o=
+			Ql7Bw3we9SVQ5fEOtjrVgHsY5hhGuGNKvi3jPv8/ZLI=
 			</data>
 		</dict>
 		<key>Frameworks/libswiftsimd.dylib</key>
 		<dict>
 			<key>hash</key>
 			<data>
-			A8vh5DhJOdsNjcnMpf8HZmtFLt0=
+			3yFMAEujHZwmMLxWNEPsqtRI7l8=
 			</data>
 			<key>hash2</key>
 			<data>
-			f+qELgXajnOIxDkqFZypP1/0Ei8s3RRcdrhbCdli9QU=
+			QBy+8Rh3zSljUjUo1mnDhNzyp0XPtzHOidN4SwhRDkI=
+			</data>
+		</dict>
+		<key>JPushConfig.plist</key>
+		<dict>
+			<key>hash</key>
+			<data>
+			qV/PQh+d737riAnpOVOo2BJPYKw=
+			</data>
+			<key>hash2</key>
+			<data>
+			EZrU0KO5QFZ5fTHAAt0PId1Li/EE+hZexiOezt6CDmw=
 			</data>
 		</dict>
 		<key>LaunchImage-1100-Landscape-2436h@3x.png</key>
@@ -1651,33 +1592,33 @@
 		<dict>
 			<key>hash</key>
 			<data>
-			c8qwsmtNPeDXR5piUQXUJZV4NkU=
+			Hbj+jg8kHggfQilLv2funLLiKdE=
 			</data>
 			<key>hash2</key>
 			<data>
-			sbviKnlZlk3hGOQDhZ1GgEWVTsKa9Ga1SqqNRShbVGw=
+			AQvB0y4SawJMCUT1q06CQjD/NgLijaua3CvtGzExEUo=
 			</data>
 		</dict>
 		<key>config.xml</key>
 		<dict>
 			<key>hash</key>
 			<data>
-			O33IIDUH183cwlV6v9zaOFqmJ1o=
+			IgESgLidVuYaBKc1zJzsW9K32uo=
 			</data>
 			<key>hash2</key>
 			<data>
-			ExbxvWR+hO0yJrjtxpQRzs4QKpPR2lD4ssUd6lHa2DU=
+			SbLdTrUoZlolkwamhFCqAvtbQUU/oaBoDoDAZGW4rCI=
 			</data>
 		</dict>
 		<key>embedded.mobileprovision</key>
 		<dict>
 			<key>hash</key>
 			<data>
-			WNm5zuPz65rrY9t5qIL1iJgFcQ8=
+			OuWZMIad+tog0ZMleeOfjgsQuoo=
 			</data>
 			<key>hash2</key>
 			<data>
-			8dIWw9eXozB2DtbVPRHN3hu7yhjI74L3184XxOY586k=
+			I2c1ltNORy7u1b/+E+Kpg2ZJa3OfvEte5B1AHhc7eTo=
 			</data>
 		</dict>
 		<key>www/bill.html</key>
@@ -1695,11 +1636,11 @@
 		<dict>
 			<key>hash</key>
 			<data>
-			cqHtFm0XLXtu3pFFlRV0wqo3bLo=
+			x+c/i1RxokvMGRSy2owEyEKzgmg=
 			</data>
 			<key>hash2</key>
 			<data>
-			eBgSw3AJ1XGN6ICOgI4lpS0w5l9Rt4WghqVHpJoWORY=
+			TN8DM8733V4VhlGaP+O7pprJgjL3F67OTMwD7xV84KI=
 			</data>
 		</dict>
 		<key>www/bindcard.html</key>
@@ -1805,11 +1746,11 @@
 		<dict>
 			<key>hash</key>
 			<data>
-			5yQtgIC/T2E5OFopQG2kN+WdYrI=
+			mjZMhcaV9rGT+gEJycqyUiJiwp8=
 			</data>
 			<key>hash2</key>
 			<data>
-			x1upHfUuBcJ6Tke/ngdf2mnxo6x26sRTpS6VlyHRa0U=
+			NAGln7mA1gWlhX8EULmd8KjWEz3VwOZVBK1TutRZiQ4=
 			</data>
 		</dict>
 		<key>www/css/aui-iconfont.ttf</key>
@@ -2135,11 +2076,11 @@
 		<dict>
 			<key>hash</key>
 			<data>
-			ICgW8NAQBBEJmmNYuELt2HMjRtk=
+			sxiH889o1dm1Uaqbq7ReLFK47h0=
 			</data>
 			<key>hash2</key>
 			<data>
-			PNjIMH7Xh1rt0BEaJDkghE6nzhKQ1LeXA9vvohMWl0E=
+			paloTqVUqu4fEFrGgM/JR2+QJ1THc8JIxLDdeboE8d4=
 			</data>
 		</dict>
 		<key>www/js/bindcard.js</key>
@@ -2245,11 +2186,11 @@
 		<dict>
 			<key>hash</key>
 			<data>
-			asyakUNRxlJpE4P7WMiyTJTY97Y=
+			B5X6EPmPRDoyX3Z9Eq1q8rmGSGQ=
 			</data>
 			<key>hash2</key>
 			<data>
-			/E23wKzs+L6w6sRklGOiQqSAtMN20zBHMCvJDzaTtA4=
+			VmLo1aaDK/43gHQNmMq4GPwLubbtbB/4RSLKpMauduU=
 			</data>
 		</dict>
 		<key>www/js/lib/aui-actionsheet.js</key>
@@ -2531,22 +2472,22 @@
 		<dict>
 			<key>hash</key>
 			<data>
-			GnaACCIZ8j2xg8PJGAWxS4CymgM=
+			ldWa4XoqiR3SZsamE16ZBUrQDT4=
 			</data>
 			<key>hash2</key>
 			<data>
-			w2bwoTKwQ/CsM9LtLjMEPahT2ZOL7o02CiG2oiurI/Q=
+			cvJ4ODIeH3tt0OLA57ehOIuVVGcGPrkXTit5x33MLsE=
 			</data>
 		</dict>
 		<key>www/js/main.js</key>
 		<dict>
 			<key>hash</key>
 			<data>
-			I2Jj7RTovo4kH11m8CRuakKi3nk=
+			QSdOeA6BefLzgiGbSEou4rGjHqo=
 			</data>
 			<key>hash2</key>
 			<data>
-			+3DiCEwGQX3VJAAfi0B9bkRsfSwDHXtcmO6S/jaoZFs=
+			1nAaMqlGuQgqChazP2EJpnb7aP34936TRvAuddhZZFw=
 			</data>
 		</dict>
 		<key>www/js/mobile.js</key>
@@ -2597,55 +2538,55 @@
 		<dict>
 			<key>hash</key>
 			<data>
-			nUamfLQSBc/NAzOMJP5WwXnZGxI=
+			Cx6iRRJAH08QlPBBT//jwM7LZP4=
 			</data>
 			<key>hash2</key>
 			<data>
-			bonfkrWCjMv5LWiAp1sfmRvU0wFfN0bYRwBLbFijF/k=
+			y5y66ieXeEONknB6UKddmxUSVsTEKM0JD/kEZBuBQ+I=
 			</data>
 		</dict>
 		<key>www/js/register.js</key>
 		<dict>
 			<key>hash</key>
 			<data>
-			aPLw5ln4ElwhbTzbdXZpyILJBiY=
+			kEIN8Lt6KbeSEYmiYk47uhchWg8=
 			</data>
 			<key>hash2</key>
 			<data>
-			iyaJXQRZwYysUd//j42epM6Y+Bqkm8S+ZOuGUwhfFn8=
+			SWhxKePIt9pzPkMUPoRj0WTaXD4Z7GYBGqdsoqvRyuo=
 			</data>
 		</dict>
 		<key>www/js/scan.js</key>
 		<dict>
 			<key>hash</key>
 			<data>
-			xRDtmYCYmFtZu+H1/SjTBlennsM=
+			Cea6nn8OF3hogSuEpiL+IkVdO0I=
 			</data>
 			<key>hash2</key>
 			<data>
-			s2KUAXjrg/ljg8IoSBtI3V2xcRU57DBSC4OGz/NYnBg=
+			boEwP89p0NKOJH9RNkGe9B9GsagQ2Ug8esVLc2s5oP8=
 			</data>
 		</dict>
 		<key>www/js/security.js</key>
 		<dict>
 			<key>hash</key>
 			<data>
-			s52wwGEv5fJuX8ngkR5GGqdAXMg=
+			B2Cv1FDNaUjne/EkpPvlr5Cve88=
 			</data>
 			<key>hash2</key>
 			<data>
-			sasPlhOHyLhEjRoUQpmieOq/IW8v9yLbzXcckfySGjg=
+			OGZtj/+XWJJTY2txmB7Gvzwn4YOehMFaeYM7ju+IPwI=
 			</data>
 		</dict>
 		<key>www/js/server.js</key>
 		<dict>
 			<key>hash</key>
 			<data>
-			6JlWzinRBn6MsREucfIEiCvn5oA=
+			jp9NlgHW1O72GXbxGb4cmcCVw+w=
 			</data>
 			<key>hash2</key>
 			<data>
-			9BIwn+Du4nx0VxOUv39nWFXNeN9k5+QoZyWWWetbBIA=
+			xkxp3hfX0I2FABTvDz6d8u4ZnwK6XUy2IrW6YX4VK14=
 			</data>
 		</dict>
 		<key>www/js/signxy.js</key>
@@ -3539,6 +3480,17 @@
 			PwOMlqlVzVgIZXZ1SbMCjBbNhPUtIEmbS1IuHC4X+FE=
 			</data>
 		</dict>
+		<key>www/plugins/cordova-plugin-app-version/www/AppVersionPlugin.js</key>
+		<dict>
+			<key>hash</key>
+			<data>
+			V7Ywjbu2Kj4wesp8mWW2lF5aDpE=
+			</data>
+			<key>hash2</key>
+			<data>
+			hULEK/sXXYA5Q+DEGduyGZlT2gUtMhRcybSoo9TWM+0=
+			</data>
+		</dict>
 		<key>www/plugins/cordova-plugin-camera/www/Camera.js</key>
 		<dict>
 			<key>hash</key>
@@ -3902,6 +3854,39 @@
 			pw9ge6okwHZeP0dHYYlBTFuDJUkZQDPAKRM006KG8ek=
 			</data>
 		</dict>
+		<key>www/plugins/cordova-plugin-wkwebview-engine/src/www/ios/ios-wkwebview-exec.js</key>
+		<dict>
+			<key>hash</key>
+			<data>
+			Jf+80xptQsEGhUiGLgqUT/RQinI=
+			</data>
+			<key>hash2</key>
+			<data>
+			30rJ9tZXBbfE/VcYCAuJHI8E7YpVPHFcxXVT9nbhkUo=
+			</data>
+		</dict>
+		<key>www/plugins/cordova-plugin-wkwebview-engine/src/www/ios/ios-wkwebview.js</key>
+		<dict>
+			<key>hash</key>
+			<data>
+			uSpOoBJtw3huMClDN2UUZQOjz/Y=
+			</data>
+			<key>hash2</key>
+			<data>
+			snCU5zVffeqnWk/2NWikUz5/ywm8VWiiKUujPDpj0Yw=
+			</data>
+		</dict>
+		<key>www/plugins/jpush-phonegap-plugin/www/JPushPlugin.js</key>
+		<dict>
+			<key>hash</key>
+			<data>
+			WbD83XEtIdDDWazehjb7DykZYCE=
+			</data>
+			<key>hash2</key>
+			<data>
+			8tb7CZsUzCwsaMSrBEosFu+/pgVWFbZptbW/ilTlAPs=
+			</data>
+		</dict>
 		<key>www/pwdset.html</key>
 		<dict>
 			<key>hash</key>
@@ -3917,22 +3902,22 @@
 		<dict>
 			<key>hash</key>
 			<data>
-			/T8vAhNAeCOJv1Hw6L4detL0zZE=
+			FK8oc1oB59vB31qmvZp+SzcB9/U=
 			</data>
 			<key>hash2</key>
 			<data>
-			owfyBn4pS5DnYeA3edJ/WmjW1ANLhwT8SdO2fRM3yqQ=
+			hKaZe4Brj53BLM4b10F58QehbRHB4aCSmOpVeXW/8sM=
 			</data>
 		</dict>
 		<key>www/register.html</key>
 		<dict>
 			<key>hash</key>
 			<data>
-			q/NP40bBQOZfbeq+nId2UNahWqk=
+			j0E17LezraXxL2i9s0tnnWrl9vw=
 			</data>
 			<key>hash2</key>
 			<data>
-			WsYPx/6kDCp5gr/e4lMTJvGzW/VDXMwvnHlWa3MjS5w=
+			Iu5z6Xp9qSJxhhkhGheMQI9Ns2tMH0hhOpULa3eMjek=
 			</data>
 		</dict>
 		<key>www/scan.html</key>
@@ -3950,11 +3935,11 @@
 		<dict>
 			<key>hash</key>
 			<data>
-			LQqkVW0wcKOsVTN4GeoIHaLFmHA=
+			3isNUT+DEogiz2Le39n8VyG+mRQ=
 			</data>
 			<key>hash2</key>
 			<data>
-			xzEaRg38D+hgjxJoKsj3oFwfrqsYIm4s4H7MDEAsXNY=
+			S9+OZm7tir1iQxoRsBfSKv1+p+2avVkKfHLJtDZJZAs=
 			</data>
 		</dict>
 		<key>www/signxy.html</key>
diff --git a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/config.xml b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/config.xml
index ed6c95a..89c5991 100755
--- a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/config.xml
+++ b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/config.xml
@@ -1,5 +1,5 @@
 <?xml version='1.0' encoding='utf-8'?>
-<widget id="com.supwisdom.dlapp" version="1.0.0" xmlns="http://www.w3.org/ns/widgets" xmlns:cdv="http://cordova.apache.org/ns/1.0">
+<widget id="com.dalicitycard.app" version="1.0.4" xmlns="http://www.w3.org/ns/widgets" xmlns:cdv="http://cordova.apache.org/ns/1.0">
     <feature name="LocalStorage">
         <param name="ios-package" value="CDVLocalStorage" />
     </feature>
@@ -55,6 +55,15 @@
     <feature name="ThemeableBrowser">
         <param name="ios-package" value="CDVThemeableBrowser" />
     </feature>
+    <feature name="JPushPlugin">
+        <param name="ios-package" value="JPushPlugin" />
+    </feature>
+    <feature name="AppVersion">
+        <param name="ios-package" value="AppVersion" />
+    </feature>
+    <feature name="CDVWKWebViewEngine">
+        <param name="ios-package" value="CDVWKWebViewEngine" />
+    </feature>
     <name short="大理市民卡">dlapp</name>
     <description>
         A sample Apache Cordova application that responds to the deviceready event.
@@ -77,6 +86,9 @@
     <edit-config file="*-Info.plist" mode="merge" target="NSCameraUsageDescription">
         <string>APP需要使用您的相机权限,没有该权限将无法完成扫一扫功能</string>
     </edit-config>
+    <edit-config file="*-Info.plist" mode="merge" target="NSPhotoLibraryUsageDescription">
+        <string>APP需要使用您的相册权限,没有该权限将无法完成扫一扫功能</string>
+    </edit-config>
     <allow-intent href="itms:*" />
     <allow-intent href="itms-apps:*" />
     <preference name="AllowInlineMediaPlayback" value="false" />
@@ -102,4 +114,5 @@
     <preference name="Orientation" value="portrait" />
     <preference name="UseSwiftLanguageVersion" value="4.0" />
     <preference name="UIWebViewBounce" value="false" />
+    <preference name="CordovaWebViewEngine" value="CDVWKWebViewEngine" />
 </widget>
diff --git a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/dlapp b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/dlapp
index 388e661..e2e075e 100755
--- a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/dlapp
+++ b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/dlapp
Binary files differ
diff --git a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/embedded.mobileprovision b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/embedded.mobileprovision
index abda867..1b86fa4 100644
--- a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/embedded.mobileprovision
+++ b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/embedded.mobileprovision
Binary files differ
diff --git a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/www/billdetail.html b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/www/billdetail.html
index e419a98..8289dbf 100644
--- a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/www/billdetail.html
+++ b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/www/billdetail.html
@@ -16,7 +16,7 @@
 
 <body>
     <header class="aui-bar aui-bar-nav" style="padding-top:25px;">
-        <a class="aui-pull-left" href="javascript:window.history.go(-1)">
+        <a class="aui-pull-left" href="javascript:app.toBack();">
             <span class="aui-iconfont aui-icon-left"></span>
         </a>
         <div class="aui-title">账单详情</div>
diff --git a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/www/cordova_plugins.js b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/www/cordova_plugins.js
index 79df2d5..99f7689 100644
--- a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/www/cordova_plugins.js
+++ b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/www/cordova_plugins.js
@@ -319,6 +319,38 @@
       "clobbers": [
         "cordova.ThemeableBrowser"
       ]
+    },
+    {
+      "id": "jpush-phonegap-plugin.JPushPlugin",
+      "file": "plugins/jpush-phonegap-plugin/www/JPushPlugin.js",
+      "pluginId": "jpush-phonegap-plugin",
+      "clobbers": [
+        "JPush"
+      ]
+    },
+    {
+      "id": "cordova-plugin-app-version.AppVersionPlugin",
+      "file": "plugins/cordova-plugin-app-version/www/AppVersionPlugin.js",
+      "pluginId": "cordova-plugin-app-version",
+      "clobbers": [
+        "cordova.getAppVersion"
+      ]
+    },
+    {
+      "id": "cordova-plugin-wkwebview-engine.ios-wkwebview-exec",
+      "file": "plugins/cordova-plugin-wkwebview-engine/src/www/ios/ios-wkwebview-exec.js",
+      "pluginId": "cordova-plugin-wkwebview-engine",
+      "clobbers": [
+        "cordova.exec"
+      ]
+    },
+    {
+      "id": "cordova-plugin-wkwebview-engine.ios-wkwebview",
+      "file": "plugins/cordova-plugin-wkwebview-engine/src/www/ios/ios-wkwebview.js",
+      "pluginId": "cordova-plugin-wkwebview-engine",
+      "clobbers": [
+        "window.WkWebView"
+      ]
     }
   ];
   module.exports.metadata = {
@@ -334,6 +366,10 @@
     "cordova-plugin-camera": "4.0.3",
     "cordova-plugin-inappbrowser": "3.0.0",
     "cordova-plugin-device": "2.0.2",
-    "cordova-plugin-themeablebrowser": "0.2.17"
+    "cordova-plugin-themeablebrowser": "0.2.17",
+    "cordova-plugin-jcore": "1.3.0",
+    "jpush-phonegap-plugin": "3.7.2",
+    "cordova-plugin-app-version": "0.1.9",
+    "cordova-plugin-wkwebview-engine": "1.2.1"
   };
 });
\ No newline at end of file
diff --git a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/www/js/billdetail.js b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/www/js/billdetail.js
index 3615234..51579aa 100644
--- a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/www/js/billdetail.js
+++ b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/www/js/billdetail.js
@@ -9,7 +9,8 @@
         this.loadBill()
     },
     toBack: function (){
-        window.history.back();
+        //window.history.back();
+        window.history.go(-1)
     },
     loadBill: function() {
         var refno = window.localStorage.getItem("currentrefno");
diff --git a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/www/js/index.js b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/www/js/index.js
index 112a927..db3d7ce 100644
--- a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/www/js/index.js
+++ b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/www/js/index.js
@@ -34,15 +34,10 @@
                 console.log(ret)
                 if (ok) {
                     if(ret.code==200){
-                        var exp =  window.localStorage.getItem("tokenexpire");
-                        var t = parseInt(exp);
-                        //token 小于10分钟了,需要刷新
-                        console.log((ret.now-t))
-                        if(ret.now-t>1000*60*10){
-                             window.location = "login.html";
-                        }else{
-                             window.location = "main.html";
+                        if(!isEmpty(ret.token)){
+                             window.localStorage.setItem("token",ret.token); 
                         }
+                        window.location = "main.html";
                     }else{
                         window.location = "login.html";
                     }
diff --git a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/www/js/login.js b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/www/js/login.js
index 77b8b2a..7931a48 100644
--- a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/www/js/login.js
+++ b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/www/js/login.js
@@ -33,7 +33,8 @@
         $.showLoading("登录中");
         var param={
             "username":phone,
-            "password":pwd
+            "password":pwd,
+            "platform":device.platform
         }
         Login(param,function(ok,ret){
             console.log(ret)
@@ -47,6 +48,7 @@
                  window.localStorage.setItem("phone",phone); 
                  window.localStorage.setItem("phoneX",ret.phone);
                  window.localStorage.setItem("token",ret.token); 
+                 window.localStorage.setItem("uid",ret.uid); 
                  window.localStorage.setItem("tenantid",ret.tenantid); 
                  window.localStorage.setItem("tokenexpire",ret.expire); 
                  window.localStorage.setItem("tokentime",ret.now); 
diff --git a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/www/js/main.js b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/www/js/main.js
index 3b01a2a..90977da 100644
--- a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/www/js/main.js
+++ b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/www/js/main.js
@@ -4,11 +4,61 @@
     initialize: function() {
         this.initTab();
         document.addEventListener('deviceready', this.onDeviceReady.bind(this), false);
+        document.addEventListener('jpush.receiveRegistrationId', function(event) {
+             console.log(event.registrationId)
+        }, false)
+        document.addEventListener("jpush.openNotification", function (event) {
+          var refno
+          console.log("openNotify:"+event);
+          if(device.platform == "Android") {
+            refno = event.extras.refno
+          } else {
+            refno = event.refno
+            window.JPush.setApplicationIconBadgeNumber(0);
+          }
+          app.openBill(refno);
+          console.log("openNotify:"+refno);
+        }, false)
+    },
+    openBill:function(billno){
+        window.localStorage.setItem("currentrefno",billno);
+        window.location='billdetail.html';
+    },
+    initJpush: function() {
+        if(device.platform == "Android") {
+        } else {
+         window.JPush.setApplicationIconBadgeNumber(0);
+        }
+        window.JPush.init();
+        window.JPush.setDebugMode(true);
+        window.JPush.isPushStopped(function(result) {
+            if (result == 0) {
+                //window.JPush.resumePush();
+            } else {
+                window.JPush.resumePush();
+            }
+        });
+        window.JPush.getUserNotificationSettings(function(result) {
+          if(result == 0) {
+          } else if(result > 0) {
+          }
+         });
+        var uid = window.localStorage.getItem("uid");
+        window.JPush.setAlias({ sequence: 1, alias: uid },
+          (result) => {
+            var sequence = result.sequence
+            var alias = result.alias
+            //alert(JSON.stringify(result))
+          }, (error) => {
+            var sequence = error.sequence
+            var errorCode = error.code
+            //alert(JSON.stringify(error))
+          })
     },
 
     onDeviceReady: function() {
         var uid = window.localStorage.getItem("token");
-        console.log(CURRENT_INDEX);
+        this.initJpush();
         $('#scanBtn').click(function() {
             //window.location = "scan.html";
             app.checkBefore(function() {
@@ -42,11 +92,12 @@
             })
         });
         $('#secBtn').click(function() {
-            app.checkBefore(function() {
+            window.location = "security.html";
+            /*app.checkBefore(function() {
                 app.checkOther(function() {
                     window.location = "security.html";
                 })
-            })
+            })*/
         });
         $('#usersec').click(function() {
             app.checkBefore(function() {
@@ -57,22 +108,23 @@
         });
         this.initData();
     },
-    initTab:function(){
+    initTab: function() {
         $("#maincontent").css("top", $("#maintop").height())
         var tab = new auiTab({
             element: document.getElementById("footer"),
         }, function(ret) {
-            window.localStorage.setItem("tabindex",ret.index); 
-            
+            window.localStorage.setItem("tabindex", ret.index);
+
             changeTab(ret.index);
         });
-        var tabindex =  window.localStorage.getItem("tabindex"); 
-        if(!tabindex||tabindex==0){
+        var tabindex = window.localStorage.getItem("tabindex");
+        if (!tabindex || tabindex == 0) {
             tabindex = 1
         }
         changeTab(tabindex);
         tab.setActive(tabindex)
-        function changeTab(index){
+
+        function changeTab(index) {
             if (index == 1) {
                 $("#main1").show();
                 $("#main2").hide();
@@ -93,8 +145,9 @@
         }
         V1Bills(param, function(ok, ret) {
             if (ok) {
-                console.log(ret)
+                //console.log(ret)
                 if (ret.code == 200) {
+                    app.checkVersion(ret.version,ret.minversion,ret.versionmsg);
                     $("#maingt").text(ret.t + "!")
                     $("#user-amount").text(ret.amount)
                     $("#user-point").text(ret.point)
@@ -131,7 +184,17 @@
             }
         })
     },
-
+    checkVersion:function(ver,minver,msg){
+        cordova.getAppVersion.getVersionNumber(function (version) {
+            //alert(version);
+            if(version<minver){
+                //TODO 强制升级
+                alert("当前版本过低,为了不影响您的使用,请先升级");
+            }else if(ver>version){
+                alert("有新的版本");    
+            }
+        });
+    },
     initBillView: function(page) {
         var html = '';
         for (var i = 0; i < page.data.length; i++) {
@@ -255,4 +318,4 @@
         }
     }
 };
-app.initialize();
\ No newline at end of file
+app.initialize();
diff --git a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/www/js/qrcode.js b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/www/js/qrcode.js
index 35fe7a3..4664a9b 100644
--- a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/www/js/qrcode.js
+++ b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/www/js/qrcode.js
@@ -7,17 +7,58 @@
 
     onDeviceReady: function() {
         var uid = window.localStorage.getItem("token");
-        var qrcode = new QRCode(document.getElementById("qrcode"), {
-          text: uid,
-          width: 150,
-          height: 150,
-          colorDark : "#000000",
-          colorLight : "#ffffff",
-          correctLevel : QRCode.CorrectLevel.L
-      });
+        this.loadQrcode();
+        setInterval(function () {
+            window.location.reload();
+        },100000);
     },
-    toBillDetail :function(refno){
-        
+    loadQrcode: function() {
+        $.showLoading("加载中");
+        V1Qrcode(function(ok, ret) {
+            if (ok) {
+              console.log(ret)
+                if (ret.code == 200) {
+                    $.hideLoading();
+                    var qrcode = new QRCode(document.getElementById("qrcode"), {
+                      text: ret.qrcode,
+                      width: 150,
+                      height: 150,
+                      colorDark: "#000000",
+                      colorLight: "#ffffff",
+                      correctLevel: QRCode.CorrectLevel.L
+                    });
+                } else {
+                    $.hideLoading();
+                    $.alert("请求失败,请稍后再试", "错误");
+                }
+            } else {
+                $.hideLoading();
+                $.alert("请求失败了:" + ret.status + "请稍后再试", "错误");
+            }
+        })
+    },
+    refresh:function(){
+      V1Qrcode(function(ok, ret) {
+            if (ok) {
+                if (ret.code == 200) {
+                    $.hideLoading();
+                    var qrcode = new QRCode(document.getElementById("qrcode"), {
+                      text: ret.qrcode,
+                      width: 150,
+                      height: 150,
+                      colorDark: "#000000",
+                      colorLight: "#ffffff",
+                      correctLevel: QRCode.CorrectLevel.L
+                    });
+                } else {
+                    $.hideLoading();
+                    $.alert("请求失败,请稍后再试", "错误");
+                }
+            } else {
+                $.hideLoading();
+                $.alert("请求失败了:" + ret.status + "请稍后再试", "错误");
+            }
+        })
     }
 };
 app.initialize();
\ No newline at end of file
diff --git a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/www/js/register.js b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/www/js/register.js
index e0214ab..d10558e 100644
--- a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/www/js/register.js
+++ b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/www/js/register.js
@@ -33,7 +33,6 @@
                 $.hideLoading();
                 console.log(ret)
                 if(ret.code==200){
-                     
                      window.localStorage.setItem("phone",phone); 
                      window.localStorage.setItem("uid",ret.uid); 
                      window.localStorage.setItem("code",ret.randcode); 
diff --git a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/www/js/scan.js b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/www/js/scan.js
index e75eba8..0bde5cd 100644
--- a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/www/js/scan.js
+++ b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/www/js/scan.js
@@ -78,9 +78,9 @@
     }
     var userid = window.localStorage.getItem("userid"); 
     if(url.indexOf("?")>0){
-        url=url+'&uid='+userid;
+        url=url+'&userid='+userid;
     }else{
-        url=url+'?uid='+userid;
+        url=url+'?userid='+userid;
     }
     inAppBrowserRef = cordova.ThemeableBrowser.open(url, '_blank', {
         statusbar: {
diff --git a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/www/js/security.js b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/www/js/security.js
index 3586930..f12a1cc 100644
--- a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/www/js/security.js
+++ b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/www/js/security.js
@@ -4,11 +4,7 @@
     initialize: function() {
         document.addEventListener('deviceready', this.onDeviceReady.bind(this), false);
     },
-  
     onDeviceReady: function() {
-        var uid = window.localStorage.getItem("uid");
-        var phone =  window.localStorage.getItem("phoneX");
-        
     },
     editPwd: function() {
        window.location = "editpwd.html";
@@ -19,6 +15,13 @@
     logout:function(){
         window.localStorage.removeItem("token");
         window.location = "login.html";
+    },
+    loginByTouchId: function() {
+       Fingerprint.isAvailable(function(result){
+            alert("Fingerprint available");
+       }, function(message){
+            alert(message);
+       });
     }
 };
 app.initialize();
diff --git a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/www/js/server.js b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/www/js/server.js
index 94f7c65..c8eb688 100644
--- a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/www/js/server.js
+++ b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/www/js/server.js
@@ -1,10 +1,14 @@
-var dev = true;
-var SERVER = "";
+var dev = false;
+var SERVER = "https://yy.dlsmk.cn/payapi/mobileapi";
 var GLOBAL_TODAY="";
 var GLOBAL_YESTERDAY="";
 var CURRENT_INDEX=1;
 if (dev) {
-    SERVER = "http://172.28.43.3:8099/payapi/mobileapi";
+    SERVER = "http://172.28.201.70:10010/payapi/mobileapi";
+}
+
+function V1Qrcode(callback) {
+    ajaxPost("/v1/qrcode", {}, callback)
 }
 function V1Idtypes(callback) {
     ajaxPost("/v1/idtypes", {}, callback)
diff --git a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/www/plugins/cordova-plugin-app-version/www/AppVersionPlugin.js b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/www/plugins/cordova-plugin-app-version/www/AppVersionPlugin.js
new file mode 100644
index 0000000..430f50d
--- /dev/null
+++ b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/www/plugins/cordova-plugin-app-version/www/AppVersionPlugin.js
@@ -0,0 +1,68 @@
+cordova.define("cordova-plugin-app-version.AppVersionPlugin", function(require, exports, module) {
+/*jslint indent: 2 */
+/*global window, jQuery, angular, cordova */
+"use strict";
+
+// Returns a jQuery or AngularJS deferred object, or pass a success and fail callbacks if you don't want to use jQuery or AngularJS
+var getPromisedCordovaExec = function (command, success, fail) {
+  var toReturn, deferred, injector, $q;
+  if (success === undefined) {
+    if (window.jQuery) {
+      deferred = jQuery.Deferred();
+      success = deferred.resolve;
+      fail = deferred.reject;
+      toReturn = deferred;
+    } else if (window.angular) {
+      injector = angular.injector(["ng"]);
+      $q = injector.get("$q");
+      deferred = $q.defer();
+      success = deferred.resolve;
+      fail = deferred.reject;
+      toReturn = deferred.promise;
+    } else if (window.when && window.when.promise) {
+      deferred = when.defer();
+      success = deferred.resolve;
+      fail = deferred.reject;
+      toReturn = deferred.promise;
+    } else if (window.Promise) {
+      toReturn = new Promise(function(c, e) {
+        success = c;
+        fail = e;
+      });
+    } else if (window.WinJS && window.WinJS.Promise) {
+      toReturn = new WinJS.Promise(function(c, e) {
+        success = c;
+        fail = e;
+      });
+    } else {
+      return console.error('AppVersion either needs a success callback, or jQuery/AngularJS/Promise/WinJS.Promise defined for using promises');
+    }
+  }
+  // 5th param is NOT optional. must be at least empty array
+  cordova.exec(success, fail, "AppVersion", command, []);
+  return toReturn;
+};
+
+var getAppVersion = function (success, fail) {
+  return getPromisedCordovaExec('getVersionNumber', success, fail);
+};
+
+getAppVersion.getAppName = function (success, fail) {
+  return getPromisedCordovaExec('getAppName', success, fail);
+};
+
+getAppVersion.getPackageName = function (success, fail) {
+  return getPromisedCordovaExec('getPackageName', success, fail);
+};
+
+getAppVersion.getVersionNumber = function (success, fail) {
+  return getPromisedCordovaExec('getVersionNumber', success, fail);
+};
+
+getAppVersion.getVersionCode = function (success, fail) {
+  return getPromisedCordovaExec('getVersionCode', success, fail);
+};
+
+module.exports = getAppVersion;
+
+});
diff --git a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/www/plugins/cordova-plugin-wkwebview-engine/src/www/ios/ios-wkwebview-exec.js b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/www/plugins/cordova-plugin-wkwebview-engine/src/www/ios/ios-wkwebview-exec.js
new file mode 100644
index 0000000..dc7595d
--- /dev/null
+++ b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/www/plugins/cordova-plugin-wkwebview-engine/src/www/ios/ios-wkwebview-exec.js
@@ -0,0 +1,177 @@
+cordova.define("cordova-plugin-wkwebview-engine.ios-wkwebview-exec", function(require, exports, module) {
+/*
+ *
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ *
+ *   http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing,
+ * software distributed under the License is distributed on an
+ * "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+ * KIND, either express or implied.  See the License for the
+ * specific language governing permissions and limitations
+ * under the License.
+ *
+*/
+
+/**
+ * Creates the exec bridge used to notify the native code of
+ * commands.
+ */
+var cordova = require('cordova');
+var utils = require('cordova/utils');
+var base64 = require('cordova/base64');
+
+function massageArgsJsToNative (args) {
+    if (!args || utils.typeName(args) !== 'Array') {
+        return args;
+    }
+    var ret = [];
+    args.forEach(function (arg, i) {
+        if (utils.typeName(arg) === 'ArrayBuffer') {
+            ret.push({
+                'CDVType': 'ArrayBuffer',
+                'data': base64.fromArrayBuffer(arg)
+            });
+        } else {
+            ret.push(arg);
+        }
+    });
+    return ret;
+}
+
+function massageMessageNativeToJs (message) {
+    if (message.CDVType === 'ArrayBuffer') {
+        var stringToArrayBuffer = function (str) {
+            var ret = new Uint8Array(str.length);
+            for (var i = 0; i < str.length; i++) {
+                ret[i] = str.charCodeAt(i);
+            }
+            return ret.buffer;
+        };
+        var base64ToArrayBuffer = function (b64) {
+            return stringToArrayBuffer(atob(b64)); // eslint-disable-line no-undef
+        };
+        message = base64ToArrayBuffer(message.data);
+    }
+    return message;
+}
+
+function convertMessageToArgsNativeToJs (message) {
+    var args = [];
+    if (!message || !message.hasOwnProperty('CDVType')) {
+        args.push(message);
+    } else if (message.CDVType === 'MultiPart') {
+        message.messages.forEach(function (e) {
+            args.push(massageMessageNativeToJs(e));
+        });
+    } else {
+        args.push(massageMessageNativeToJs(message));
+    }
+    return args;
+}
+
+var iOSExec = function () {
+    // detect change in bridge, if there is a change, we forward to new bridge
+
+    // if (window.webkit && window.webkit.messageHandlers && window.webkit.messageHandlers.cordova && window.webkit.messageHandlers.cordova.postMessage) {
+    //     bridgeMode = jsToNativeModes.WK_WEBVIEW_BINDING;
+    // }
+
+    var successCallback, failCallback, service, action, actionArgs;
+    var callbackId = null;
+    if (typeof arguments[0] !== 'string') {
+        // FORMAT ONE
+        successCallback = arguments[0];
+        failCallback = arguments[1];
+        service = arguments[2];
+        action = arguments[3];
+        actionArgs = arguments[4];
+
+        // Since we need to maintain backwards compatibility, we have to pass
+        // an invalid callbackId even if no callback was provided since plugins
+        // will be expecting it. The Cordova.exec() implementation allocates
+        // an invalid callbackId and passes it even if no callbacks were given.
+        callbackId = 'INVALID';
+    } else {
+   	    throw new Error('The old format of this exec call has been removed (deprecated since 2.1). Change to: ' + // eslint-disable-line
+            'cordova.exec(null, null, \'Service\', \'action\', [ arg1, arg2 ]);');
+    }
+
+    // If actionArgs is not provided, default to an empty array
+    actionArgs = actionArgs || [];
+
+    // Register the callbacks and add the callbackId to the positional
+    // arguments if given.
+    if (successCallback || failCallback) {
+        callbackId = service + cordova.callbackId++;
+        cordova.callbacks[callbackId] =
+            {success: successCallback, fail: failCallback};
+    }
+
+    actionArgs = massageArgsJsToNative(actionArgs);
+
+    // CB-10133 DataClone DOM Exception 25 guard (fast function remover)
+    var command = [callbackId, service, action, JSON.parse(JSON.stringify(actionArgs))];
+    window.webkit.messageHandlers.cordova.postMessage(command);
+};
+
+iOSExec.nativeCallback = function (callbackId, status, message, keepCallback, debug) {
+    var success = status === 0 || status === 1;
+    var args = convertMessageToArgsNativeToJs(message);
+    Promise.resolve().then(function () {
+        cordova.callbackFromNative(callbackId, success, status, args, keepCallback); // eslint-disable-line
+    });
+};
+
+// for backwards compatibility
+iOSExec.nativeEvalAndFetch = function (func) {
+    try {
+        func();
+    } catch (e) {
+        console.log(e);
+    }
+};
+
+// Proxy the exec for bridge changes. See CB-10106
+
+function cordovaExec () {
+    var cexec = require('cordova/exec');
+    var cexec_valid = (typeof cexec.nativeFetchMessages === 'function') && (typeof cexec.nativeEvalAndFetch === 'function') && (typeof cexec.nativeCallback === 'function');
+    return (cexec_valid && execProxy !== cexec) ? cexec : iOSExec;
+}
+
+function execProxy () {
+    cordovaExec().apply(null, arguments);
+}
+
+execProxy.nativeFetchMessages = function () {
+    return cordovaExec().nativeFetchMessages.apply(null, arguments);
+};
+
+execProxy.nativeEvalAndFetch = function () {
+    return cordovaExec().nativeEvalAndFetch.apply(null, arguments);
+};
+
+execProxy.nativeCallback = function () {
+    return cordovaExec().nativeCallback.apply(null, arguments);
+};
+
+module.exports = execProxy;
+
+if (window.webkit && window.webkit.messageHandlers && window.webkit.messageHandlers.cordova && window.webkit.messageHandlers.cordova.postMessage) {
+    // unregister the old bridge
+    cordova.define.remove('cordova/exec');
+    // redefine bridge to our new bridge
+    cordova.define('cordova/exec', function (require, exports, module) {
+        module.exports = execProxy;
+    });
+}
+
+});
diff --git a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/www/plugins/cordova-plugin-wkwebview-engine/src/www/ios/ios-wkwebview.js b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/www/plugins/cordova-plugin-wkwebview-engine/src/www/ios/ios-wkwebview.js
new file mode 100644
index 0000000..0dac749
--- /dev/null
+++ b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/www/plugins/cordova-plugin-wkwebview-engine/src/www/ios/ios-wkwebview.js
@@ -0,0 +1,33 @@
+cordova.define("cordova-plugin-wkwebview-engine.ios-wkwebview", function(require, exports, module) {
+/*
+ *
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ *
+ *   http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing,
+ * software distributed under the License is distributed on an
+ * "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+ * KIND, either express or implied.  See the License for the
+ * specific language governing permissions and limitations
+ * under the License.
+ *
+*/
+
+var exec = require('cordova/exec');
+
+var WkWebKit = {
+    allowsBackForwardNavigationGestures: function (allow) {
+        exec(null, null, 'CDVWKWebViewEngine', 'allowsBackForwardNavigationGestures', [allow]);
+    }
+};
+
+module.exports = WkWebKit;
+
+});
diff --git a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/www/plugins/jpush-phonegap-plugin/www/JPushPlugin.js b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/www/plugins/jpush-phonegap-plugin/www/JPushPlugin.js
new file mode 100644
index 0000000..773b885
--- /dev/null
+++ b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/www/plugins/jpush-phonegap-plugin/www/JPushPlugin.js
@@ -0,0 +1,489 @@
+cordova.define("jpush-phonegap-plugin.JPushPlugin", function(require, exports, module) {
+var JPushPlugin = function() {};
+
+// private plugin function
+
+JPushPlugin.prototype.receiveMessage = {};
+JPushPlugin.prototype.openNotification = {};
+JPushPlugin.prototype.receiveNotification = {};
+
+JPushPlugin.prototype.isPlatformIOS = function() {
+  return (
+    device.platform === "iPhone" ||
+    device.platform === "iPad" ||
+    device.platform === "iPod touch" ||
+    device.platform === "iOS"
+  );
+};
+
+JPushPlugin.prototype.errorCallback = function(msg) {
+  console.log("JPush Callback Error: " + msg);
+};
+
+JPushPlugin.prototype.callNative = function(
+  name,
+  args,
+  successCallback,
+  errorCallback
+) {
+  if (errorCallback) {
+    cordova.exec(successCallback, errorCallback, "JPushPlugin", name, args);
+  } else {
+    cordova.exec(
+      successCallback,
+      this.errorCallback,
+      "JPushPlugin",
+      name,
+      args
+    );
+  }
+};
+
+// Common methods
+JPushPlugin.prototype.init = function() {
+  if (this.isPlatformIOS()) {
+    this.callNative("initial", [], null);
+  } else {
+    this.callNative("init", [], null);
+  }
+};
+
+JPushPlugin.prototype.setDebugMode = function(mode) {
+  if (device.platform === "Android") {
+    this.callNative("setDebugMode", [mode], null);
+  } else {
+    if (mode === true) {
+      this.setDebugModeFromIos();
+    } else {
+      this.setLogOFF();
+    }
+  }
+};
+
+JPushPlugin.prototype.getRegistrationID = function(successCallback) {
+  this.callNative("getRegistrationID", [], successCallback);
+};
+
+JPushPlugin.prototype.stopPush = function() {
+  this.callNative("stopPush", [], null);
+};
+
+JPushPlugin.prototype.resumePush = function() {
+  this.callNative("resumePush", [], null);
+};
+
+JPushPlugin.prototype.isPushStopped = function(successCallback) {
+  this.callNative("isPushStopped", [], successCallback);
+};
+
+JPushPlugin.prototype.clearLocalNotifications = function() {
+  if (device.platform === "Android") {
+    this.callNative("clearLocalNotifications", [], null);
+  } else {
+    this.clearAllLocalNotifications();
+  }
+};
+
+/**
+ * 设置标签。
+ * 注意:该接口是覆盖逻辑,而不是增量逻辑。即新的调用会覆盖之前的设置。
+ *
+ * @param params = { 'sequence': number, 'tags': ['tag1', 'tag2'] }
+ */
+JPushPlugin.prototype.setTags = function(
+  params,
+  successCallback,
+  errorCallback
+) {
+  this.callNative("setTags", [params], successCallback, errorCallback);
+};
+
+/**
+ * 新增标签。
+ *
+ * @param params = { 'sequence': number, 'tags': ['tag1', 'tag2'] }
+ */
+JPushPlugin.prototype.addTags = function(
+  params,
+  successCallback,
+  errorCallback
+) {
+  this.callNative("addTags", [params], successCallback, errorCallback);
+};
+
+/**
+ * 删除指定标签。
+ *
+ * @param params = { 'sequence': number, 'tags': ['tag1', 'tag2'] }
+ */
+JPushPlugin.prototype.deleteTags = function(
+  params,
+  successCallback,
+  errorCallback
+) {
+  this.callNative("deleteTags", [params], successCallback, errorCallback);
+};
+
+/**
+ * 清除所有标签。
+ *
+ * @param params = { 'sequence': number }
+ */
+JPushPlugin.prototype.cleanTags = function(
+  params,
+  successCallback,
+  errorCallback
+) {
+  this.callNative("cleanTags", [params], successCallback, errorCallback);
+};
+
+/**
+ * 查询所有标签。
+ *
+ * @param params = { 'sequence': number }
+ */
+JPushPlugin.prototype.getAllTags = function(
+  params,
+  successCallback,
+  errorCallback
+) {
+  this.callNative("getAllTags", [params], successCallback, errorCallback);
+};
+
+/**
+ * 查询指定标签与当前用户的绑定状态。
+ *
+ * @param params = { 'sequence': number, 'tag': string }
+ */
+JPushPlugin.prototype.checkTagBindState = function(
+  params,
+  successCallback,
+  errorCallback
+) {
+  this.callNative(
+    "checkTagBindState",
+    [params],
+    successCallback,
+    errorCallback
+  );
+};
+
+/**
+ * 设置别名。
+ * 注意:该接口是覆盖逻辑,而不是增量逻辑。即新的调用会覆盖之前的设置。
+ *
+ * @param params = { 'sequence': number, 'alias': string }
+ */
+JPushPlugin.prototype.setAlias = function(
+  params,
+  successCallback,
+  errorCallback
+) {
+  this.callNative("setAlias", [params], successCallback, errorCallback);
+};
+
+/**
+ * 删除别名。
+ *
+ * @param params = { 'sequence': number }
+ */
+JPushPlugin.prototype.deleteAlias = function(
+  params,
+  successCallback,
+  errorCallback
+) {
+  this.callNative("deleteAlias", [params], successCallback, errorCallback);
+};
+
+/**
+ * 查询当前绑定的别名。
+ *
+ * @param params = { 'sequence': number }
+ */
+JPushPlugin.prototype.getAlias = function(
+  params,
+  successCallback,
+  errorCallback
+) {
+  this.callNative("getAlias", [params], successCallback, errorCallback);
+};
+
+// 判断系统设置中是否对本应用启用通知。
+// iOS: 返回值如果大于 0,代表通知开启;0: 通知关闭。
+// UIRemoteNotificationTypeNone = 0,
+// UIRemoteNotificationTypeBadge = 1 << 0,
+// UIRemoteNotificationTypeSound = 1 << 1,
+// UIRemoteNotificationTypeAlert = 1 << 2,
+// UIRemoteNotificationTypeNewsstandContentAvailability = 1 << 3,
+// Android: 返回值 1 代表通知启用;0: 通知关闭。
+JPushPlugin.prototype.getUserNotificationSettings = function(successCallback) {
+  if (this.isPlatformIOS()) {
+    this.callNative("getUserNotificationSettings", [], successCallback);
+  } else if (device.platform === "Android") {
+    this.callNative("areNotificationEnabled", [], successCallback);
+  }
+};
+
+// iOS methods
+
+JPushPlugin.prototype.startJPushSDK = function() {
+  this.callNative("startJPushSDK", [], null);
+};
+
+JPushPlugin.prototype.setBadge = function(value) {
+  if (this.isPlatformIOS()) {
+    this.callNative("setBadge", [value], null);
+  }
+};
+
+JPushPlugin.prototype.resetBadge = function() {
+  if (this.isPlatformIOS()) {
+    this.callNative("resetBadge", [], null);
+  }
+};
+
+JPushPlugin.prototype.setDebugModeFromIos = function() {
+  if (this.isPlatformIOS()) {
+    this.callNative("setDebugModeFromIos", [], null);
+  }
+};
+
+JPushPlugin.prototype.setLogOFF = function() {
+  if (this.isPlatformIOS()) {
+    this.callNative("setLogOFF", [], null);
+  }
+};
+
+JPushPlugin.prototype.setCrashLogON = function() {
+  if (this.isPlatformIOS()) {
+    this.callNative("crashLogON", [], null);
+  }
+};
+
+JPushPlugin.prototype.addLocalNotificationForIOS = function(
+  delayTime,
+  content,
+  badge,
+  notificationID,
+  extras
+) {
+  if (this.isPlatformIOS()) {
+    this.callNative(
+      "setLocalNotification",
+      [delayTime, content, badge, notificationID, extras],
+      null
+    );
+  }
+};
+
+JPushPlugin.prototype.deleteLocalNotificationWithIdentifierKeyInIOS = function(
+  identifierKey
+) {
+  if (this.isPlatformIOS()) {
+    this.callNative(
+      "deleteLocalNotificationWithIdentifierKey",
+      [identifierKey],
+      null
+    );
+  }
+};
+
+JPushPlugin.prototype.clearAllLocalNotifications = function() {
+  if (this.isPlatformIOS()) {
+    this.callNative("clearAllLocalNotifications", [], null);
+  }
+};
+
+JPushPlugin.prototype.setLocation = function(latitude, longitude) {
+  if (this.isPlatformIOS()) {
+    this.callNative("setLocation", [latitude, longitude], null);
+  }
+};
+
+JPushPlugin.prototype.startLogPageView = function(pageName) {
+  if (this.isPlatformIOS()) {
+    this.callNative("startLogPageView", [pageName], null);
+  }
+};
+
+JPushPlugin.prototype.stopLogPageView = function(pageName) {
+  if (this.isPlatformIOS()) {
+    this.callNative("stopLogPageView", [pageName], null);
+  }
+};
+
+JPushPlugin.prototype.beginLogPageView = function(pageName, duration) {
+  if (this.isPlatformIOS()) {
+    this.callNative("beginLogPageView", [pageName, duration], null);
+  }
+};
+
+JPushPlugin.prototype.setApplicationIconBadgeNumber = function(badge) {
+  if (this.isPlatformIOS()) {
+    this.callNative("setApplicationIconBadgeNumber", [badge], null);
+  }
+};
+
+JPushPlugin.prototype.getApplicationIconBadgeNumber = function(callback) {
+  if (this.isPlatformIOS()) {
+    this.callNative("getApplicationIconBadgeNumber", [], callback);
+  }
+};
+
+JPushPlugin.prototype.addDismissActions = function(actions, categoryId) {
+  this.callNative("addDismissActions", [actions, categoryId]);
+};
+
+JPushPlugin.prototype.addNotificationActions = function(actions, categoryId) {
+  this.callNative("addNotificationActions", [actions, categoryId]);
+};
+
+// Android methods
+JPushPlugin.prototype.getConnectionState = function(successCallback) {
+  if (device.platform === "Android") {
+    this.callNative("getConnectionState", [], successCallback);
+  }
+};
+
+JPushPlugin.prototype.setBasicPushNotificationBuilder = function() {
+  if (device.platform === "Android") {
+    this.callNative("setBasicPushNotificationBuilder", [], null);
+  }
+};
+
+JPushPlugin.prototype.setCustomPushNotificationBuilder = function() {
+  if (device.platform === "Android") {
+    this.callNative("setCustomPushNotificationBuilder", [], null);
+  }
+};
+
+JPushPlugin.prototype.receiveRegistrationIdInAndroidCallback = function(data) {
+  if (device.platform === "Android") {
+    data = JSON.stringify(data);
+    var event = JSON.parse(data);
+    cordova.fireDocumentEvent("jpush.receiveRegistrationId", event);
+  }
+};
+
+JPushPlugin.prototype.receiveMessageInAndroidCallback = function(data) {
+  data = JSON.stringify(data);
+  this.receiveMessage = JSON.parse(data);
+  cordova.fireDocumentEvent("jpush.receiveMessage", this.receiveMessage);
+};
+
+JPushPlugin.prototype.openNotificationInAndroidCallback = function(data) {
+  data = JSON.stringify(data);
+  this.openNotification = JSON.parse(data);
+  cordova.fireDocumentEvent("jpush.openNotification", this.openNotification);
+};
+
+JPushPlugin.prototype.receiveNotificationInAndroidCallback = function(data) {
+  data = JSON.stringify(data);
+  this.receiveNotification = JSON.parse(data);
+  cordova.fireDocumentEvent(
+    "jpush.receiveNotification",
+    this.receiveNotification
+  );
+};
+
+JPushPlugin.prototype.clearAllNotification = function() {
+  if (device.platform === "Android") {
+    this.callNative("clearAllNotification", [], null);
+  }
+};
+
+JPushPlugin.prototype.clearNotificationById = function(id) {
+  if (device.platform === "Android") {
+    this.callNative("clearNotificationById", [id], null);
+  }
+};
+
+JPushPlugin.prototype.setLatestNotificationNum = function(num) {
+  if (device.platform === "Android") {
+    this.callNative("setLatestNotificationNum", [num], null);
+  }
+};
+
+JPushPlugin.prototype.addLocalNotification = function(
+  builderId,
+  content,
+  title,
+  notificationID,
+  broadcastTime,
+  extras
+) {
+  if (device.platform === "Android") {
+    this.callNative(
+      "addLocalNotification",
+      [builderId, content, title, notificationID, broadcastTime, extras],
+      null
+    );
+  }
+};
+
+JPushPlugin.prototype.removeLocalNotification = function(notificationID) {
+  if (device.platform === "Android") {
+    this.callNative("removeLocalNotification", [notificationID], null);
+  }
+};
+
+JPushPlugin.prototype.reportNotificationOpened = function(msgID) {
+  if (device.platform === "Android") {
+    this.callNative("reportNotificationOpened", [msgID], null);
+  }
+};
+
+/**
+ * 用于在 Android 6.0 及以上系统,申请一些权限
+ * 具体可看:http://docs.jpush.io/client/android_api/#android-60
+ */
+JPushPlugin.prototype.requestPermission = function() {
+  if (device.platform === "Android") {
+    this.callNative("requestPermission", [], null);
+  }
+};
+
+JPushPlugin.prototype.setSilenceTime = function(
+  startHour,
+  startMinute,
+  endHour,
+  endMinute
+) {
+  if (device.platform === "Android") {
+    this.callNative(
+      "setSilenceTime",
+      [startHour, startMinute, endHour, endMinute],
+      null
+    );
+  }
+};
+
+JPushPlugin.prototype.setPushTime = function(weekdays, startHour, endHour) {
+  if (device.platform === "Android") {
+    this.callNative("setPushTime", [weekdays, startHour, endHour], null);
+  }
+};
+
+JPushPlugin.prototype.setGeofenceInterval = function(interval) {
+  if (device.platform === "Android") {
+    this.callNative("setGeofenceInterval", [interval], null);
+  }
+};
+
+JPushPlugin.prototype.setMaxGeofenceNumber = function(maxNumber) {
+  if (device.platform === "Android") {
+    this.callNative("setMaxGeofenceNumber", [maxNumber], null);
+  }
+};
+
+if (!window.plugins) {
+  window.plugins = {};
+}
+
+if (!window.plugins.jPushPlugin) {
+  window.plugins.jPushPlugin = new JPushPlugin();
+}
+
+module.exports = new JPushPlugin();
+
+});
diff --git a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/www/qrcode.html b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/www/qrcode.html
index 3391537..ca6cb07 100644
--- a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/www/qrcode.html
+++ b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/www/qrcode.html
@@ -23,10 +23,10 @@
     <div style="display: flex;flex-direction: row;justify-content: center;align-items: center;margin-top: 50px;">
         <div style="background: #fff;text-align: center;" id="qrcode"></div>
     </div>
-    <p style="text-align: center;margin-top:20px;color:#999">请将二维码对准扫描设备</p>
-    <div style="padding: 30px;">
-        <div class="aui-btn aui-btn-block aui-btn-info" tapmode onclick="app.refresh()">手动刷新二维码</div>
-    </div>
+    <p style="text-align: center;margin-top:40px;color:#999">请将二维码对准扫描设备</p>
+    <!--<div style="padding: 30px;">
+        <div class="aui-btn aui-btn-block aui-btn-info" tapmode onclick="window.location.reload();">刷新二维码</div>
+    </div>-->
 </body>
 </html>
 <script type="text/javascript" src="cordova.js"></script>
diff --git a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/www/register.html b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/www/register.html
index 640b3ee..34e5998 100644
--- a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/www/register.html
+++ b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/www/register.html
@@ -15,7 +15,7 @@
 </head>
 <body>
     <header class="aui-bar aui-bar-nav" style="padding-top:25px;">
-        <a class="aui-pull-left" href="javascript:window.history.back()">
+        <a class="aui-pull-left" href="login.html">
             <span class="aui-iconfont aui-icon-left"></span>
         </a>
         <div class="aui-title">注册</div>
diff --git a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/www/security.html b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/www/security.html
index 6994b22..39a40ca 100644
--- a/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/www/security.html
+++ b/platforms/ios/dlapp.xcarchive/Products/Applications/dlapp.app/www/security.html
@@ -31,6 +31,15 @@
                     <div class="aui-list-item-right"></div>
                 </div>
             </li>
+            <!--<li class="aui-list-item" onclick="app.loginByTouchId()">
+                <div class="aui-list-item-label-icon">
+                    <i class="aui-iconfont aui-icon-lock aui-text-info"></i>
+                </div>
+                <div class="aui-list-item-inner ">
+                    <div class="aui-list-item-title">指纹\人脸登录</div>
+                    <div class="aui-list-item-right"><input type="checkbox" id="login" class="aui-switch" ></div>
+                </div>
+            </li>-->
             <li class="aui-list-item" onclick="app.toPayPwd()">
                 <div class="aui-list-item-label-icon">
                     <i class="aui-iconfont aui-icon-pencil aui-text-danger"></i>
@@ -41,7 +50,7 @@
                 </div>
             </li>
         </ul>
-         <div style="padding: 20px;margin-top: 40px;">
+        <div style="padding: 20px;margin-top: 40px;">
             <a href="javascript:app.logout();" class="weui-btn weui-btn_warn">退出登录</a>
         </div>
     </section>
diff --git a/platforms/ios/dlapp.xcodeproj/project.pbxproj b/platforms/ios/dlapp.xcodeproj/project.pbxproj
index 6560ea3..88f42ff 100644
--- a/platforms/ios/dlapp.xcodeproj/project.pbxproj
+++ b/platforms/ios/dlapp.xcodeproj/project.pbxproj
@@ -7,6 +7,7 @@
 	objects = {
 /* Begin PBXBuildFile section */
 		0207DA581B56EA530066E2B4 /* Images.xcassets in Resources */ = {isa = PBXBuildFile; fileRef = 0207DA571B56EA530066E2B4 /* Images.xcassets */; };
+		04347BD0ABAC4EE0B4CDDDB6 /* jcore-ios-2.1.1.a in Frameworks */ = {isa = PBXBuildFile; fileRef = 444DBF371D8346D7BC7EE35D /* jcore-ios-2.1.1.a */; };
 		0FBFC45D12B44FF79785B959 /* UIImage+CropScaleOrientation.m in Sources */ = {isa = PBXBuildFile; fileRef = 281DF600F6B747808087E4FC /* UIImage+CropScaleOrientation.m */; };
 		1D3623260D0F684500981E51 /* AppDelegate.m in Sources */ = {isa = PBXBuildFile; fileRef = 1D3623250D0F684500981E51 /* AppDelegate.m */; };
 		1D60589B0D05DD56006BFB54 /* main.m in Sources */ = {isa = PBXBuildFile; fileRef = 29B97316FDCFA39411CA2CEA /* main.m */; };
@@ -15,6 +16,10 @@
 		302D95F114D2391D003F00A1 /* MainViewController.m in Sources */ = {isa = PBXBuildFile; fileRef = 302D95EF14D2391D003F00A1 /* MainViewController.m */; };
 		302D95F214D2391D003F00A1 /* MainViewController.xib in Resources */ = {isa = PBXBuildFile; fileRef = 302D95F014D2391D003F00A1 /* MainViewController.xib */; };
 		3772C27945674D8D9D6BA455 /* AFURLRequestSerialization.m in Sources */ = {isa = PBXBuildFile; fileRef = 4BF1AE7251084FD2876E0BF5 /* AFURLRequestSerialization.m */; };
+		3BE6767AAFDC4926A08E6690 /* JPushConfig.plist in Resources */ = {isa = PBXBuildFile; fileRef = E9D260B7FB6C49A3AE6CD0DB /* JPushConfig.plist */; };
+		3C00FC06B74E49CFBABD0CFF /* libresolv.tbd in Frameworks */ = {isa = PBXBuildFile; fileRef = CBD6EA74C612474DA862E146 /* libresolv.tbd */; settings = {ATTRIBUTES = (Weak, ); }; };
+		3EBABAA2209349F6AF91DF03 /* JPushPlugin.m in Sources */ = {isa = PBXBuildFile; fileRef = CD3E9CB7CBA54989AB62BA7F /* JPushPlugin.m */; };
+		432FFA418F2F4247BE9C8472 /* CoreTelephony.framework in Frameworks */ = {isa = PBXBuildFile; fileRef = B1F790D5B00B4F178F835DE1 /* CoreTelephony.framework */; settings = {ATTRIBUTES = (Weak, ); }; };
 		4F83621E48F143429B20FB3A /* CDVThemeableBrowser.m in Sources */ = {isa = PBXBuildFile; fileRef = 28B91F31B6FD410AAF87BBDC /* CDVThemeableBrowser.m */; };
 		5E2BDB8CFE4E41F39241956C /* CordovaHttpPlugin.m in Sources */ = {isa = PBXBuildFile; fileRef = 07B9D06BD3024E0FBFF74967 /* CordovaHttpPlugin.m */; };
 		5F67F2BDBB534EF4A4F1F319 /* BinaryResponseSerializer.m in Sources */ = {isa = PBXBuildFile; fileRef = E9F753C8AE424EAE851FA1FD /* BinaryResponseSerializer.m */; };
@@ -22,63 +27,63 @@
 		6561A2871EB1420892CDE701 /* AFHTTPSessionManager.m in Sources */ = {isa = PBXBuildFile; fileRef = 04B5E1A8BB504B8FB8CE9627 /* AFHTTPSessionManager.m */; };
 		6F6B3ADF72094BF58EF5C4AC /* CDVJpegHeaderWriter.m in Sources */ = {isa = PBXBuildFile; fileRef = 1836D178C8A74923B944A79E /* CDVJpegHeaderWriter.m */; };
 		6FB343627AC8409CB2AA79B7 /* CDVInAppBrowser.m in Sources */ = {isa = PBXBuildFile; fileRef = 607F51FCFC7C4062A93BD011 /* CDVInAppBrowser.m */; };
+		7352A67D82B2499FBFFF8A2A /* Foundation.framework in Frameworks */ = {isa = PBXBuildFile; fileRef = 9B080F410C164D6582A23E36 /* Foundation.framework */; settings = {ATTRIBUTES = (Weak, ); }; };
 		74A56CC7F6724870ABD136F2 /* AVFoundation.framework in Frameworks */ = {isa = PBXBuildFile; fileRef = 11A34CB026314A2AA98A0044 /* AVFoundation.framework */; };
 		74C07CC128F9457AB281916E /* TextRequestSerializer.m in Sources */ = {isa = PBXBuildFile; fileRef = DBDBB5C64D17465C9452AF28 /* TextRequestSerializer.m */; };
+		77CDF61132F44B81B0064744 /* UserNotifications.framework in Frameworks */ = {isa = PBXBuildFile; fileRef = 59D1F618C1ED464283B7B2E6 /* UserNotifications.framework */; settings = {ATTRIBUTES = (Weak, ); }; };
 		78A785FAE16943908BA7B6DB /* CDVFile.m in Sources */ = {isa = PBXBuildFile; fileRef = DD3651F245114E52ABEB9060 /* CDVFile.m */; };
 		7D8430D010A848FBBA5FB7ED /* ImageIO.framework in Frameworks */ = {isa = PBXBuildFile; fileRef = 5192EB17EA164DFD80D433E4 /* ImageIO.framework */; settings = {ATTRIBUTES = (Weak, ); }; };
+		7EC1B4999B2E48C098BA1BBB /* CoreFoundation.framework in Frameworks */ = {isa = PBXBuildFile; fileRef = C44E29C3B190445C98BBAB84 /* CoreFoundation.framework */; settings = {ATTRIBUTES = (Weak, ); }; };
+		8A202CA89E434389BBA0AD60 /* AppVersion.m in Sources */ = {isa = PBXBuildFile; fileRef = 1AAC7231E47A434EAF06A5B0 /* AppVersion.m */; };
 		8ABB6F36D85243238622D4F8 /* LocalAuthentication.framework in Frameworks */ = {isa = PBXBuildFile; fileRef = F3A85B8119074F699E1A15CD /* LocalAuthentication.framework */; };
 		8E2516CFE16944B8B9702955 /* AFSecurityPolicy.m in Sources */ = {isa = PBXBuildFile; fileRef = BA6C5B1A6A6A488790CA41EB /* AFSecurityPolicy.m */; };
 		90E2E49D3A2449AB8D4D82D0 /* TextResponseSerializer.m in Sources */ = {isa = PBXBuildFile; fileRef = 57E66D7A151D45828ED66B7F /* TextResponseSerializer.m */; };
 		9224D3CE70AE4072BBEB170D /* CDVLocalFilesystem.m in Sources */ = {isa = PBXBuildFile; fileRef = 8A8DD2DDC8694A97A56F9FA7 /* CDVLocalFilesystem.m */; };
 		94868B10923A4508B06A4310 /* CDVAssetLibraryFilesystem.m in Sources */ = {isa = PBXBuildFile; fileRef = A719A69FD70D4CC9B8104FF6 /* CDVAssetLibraryFilesystem.m */; };
+		A15A414BEE7A48538C758317 /* UIKit.framework in Frameworks */ = {isa = PBXBuildFile; fileRef = 6D5F2FFCAD8E4A4392B781A3 /* UIKit.framework */; settings = {ATTRIBUTES = (Weak, ); }; };
 		A42AE846FF7B482FB889AAEB /* QRScanner.swift in Sources */ = {isa = PBXBuildFile; fileRef = C8478FFD487C4004A1CEFCA8 /* QRScanner.swift */; };
 		A50EB04ADB24A5CBB680802F /* libPods-dlapp.a in Frameworks */ = {isa = PBXBuildFile; fileRef = D992375F52889311A88544EF /* libPods-dlapp.a */; };
+		A54A9FED843144C887EA4286 /* AppDelegate+JPush.m in Sources */ = {isa = PBXBuildFile; fileRef = 91E044FC8377488C886C818B /* AppDelegate+JPush.m */; };
 		B69FF513D1EE4772AFF6050B /* Fingerprint.swift in Sources */ = {isa = PBXBuildFile; fileRef = C2099240B64744E08C91C285 /* Fingerprint.swift */; };
 		B8EFB66D03A44372A240B05B /* CDVCamera.m in Sources */ = {isa = PBXBuildFile; fileRef = 80B448E71F8941268B78692C /* CDVCamera.m */; };
 		BC39BA77AF0D4F94BC27666A /* CDVDevice.m in Sources */ = {isa = PBXBuildFile; fileRef = A50DE9801E5E4302A78D569C /* CDVDevice.m */; };
 		BC998F935D174204820F4015 /* AFURLSessionManager.m in Sources */ = {isa = PBXBuildFile; fileRef = 22AE2683802B4CB1BAF69ABF /* AFURLSessionManager.m */; };
+		BFA0CF013EEC44F9B2C6FA6E /* CFNetwork.framework in Frameworks */ = {isa = PBXBuildFile; fileRef = 0162975BB3964038A51EDED4 /* CFNetwork.framework */; settings = {ATTRIBUTES = (Weak, ); }; };
+		C04B4EC2FAAD4D328ABA0C95 /* jpush-ios-3.2.1.a in Frameworks */ = {isa = PBXBuildFile; fileRef = CCDEFB0C0632436FA86F0F31 /* jpush-ios-3.2.1.a */; };
 		C61263FC7FE642E9B25A81E5 /* DisableStatusbar.m in Sources */ = {isa = PBXBuildFile; fileRef = 61106E22F1D348DDBDC4DC0B /* DisableStatusbar.m */; };
 		CAE5A91F948A472F9D872EC8 /* CDVStatusBar.m in Sources */ = {isa = PBXBuildFile; fileRef = 1ABBE12B040548F8909BFC7B /* CDVStatusBar.m */; };
+		CDD6F217CA274CF18EC146D3 /* AdSupport.framework in Frameworks */ = {isa = PBXBuildFile; fileRef = 048B6FC037E1479790969D83 /* AdSupport.framework */; settings = {ATTRIBUTES = (Weak, ); }; };
 		D2F2072984AE43BCBD0A430D /* CoreLocation.framework in Frameworks */ = {isa = PBXBuildFile; fileRef = 1D1F25845F964D87B880BFA9 /* CoreLocation.framework */; };
+		D3E822CFC71546E191C10DA7 /* libz.tbd in Frameworks */ = {isa = PBXBuildFile; fileRef = 22DF35565BBA44B1980FFAF5 /* libz.tbd */; settings = {ATTRIBUTES = (Weak, ); }; };
 		D404D18DD0114DA787E0BB43 /* SDNetworkActivityIndicator.m in Sources */ = {isa = PBXBuildFile; fileRef = 148A2122F3E242E4AF09A28D /* SDNetworkActivityIndicator.m */; };
 		D834895F80744E0F96D59047 /* TouchID.m in Sources */ = {isa = PBXBuildFile; fileRef = B3CE13EED96B44C0B06B1B2C /* TouchID.m */; };
 		F46AE1B50D8B4A81B05D4100 /* Security.framework in Frameworks */ = {isa = PBXBuildFile; fileRef = A673D8D8920E4086A9152FC4 /* Security.framework */; };
 		F939AD8D22BB769B006B371B /* libsqlite3.0.tbd in Frameworks */ = {isa = PBXBuildFile; fileRef = F939AD8C22BB769B006B371B /* libsqlite3.0.tbd */; };
 		FDE92C386167415E8040F8AB /* AFURLResponseSerialization.m in Sources */ = {isa = PBXBuildFile; fileRef = FDEE8379D7A34C55A616F700 /* AFURLResponseSerialization.m */; };
-		04347BD0ABAC4EE0B4CDDDB6 /* jcore-ios-2.1.1.a in Frameworks */ = {isa = PBXBuildFile; fileRef = 444DBF371D8346D7BC7EE35D /* jcore-ios-2.1.1.a */; };
-		3EBABAA2209349F6AF91DF03 /* JPushPlugin.m in Sources */ = {isa = PBXBuildFile; fileRef = CD3E9CB7CBA54989AB62BA7F /* JPushPlugin.m */; };
-		A54A9FED843144C887EA4286 /* AppDelegate+JPush.m in Sources */ = {isa = PBXBuildFile; fileRef = 91E044FC8377488C886C818B /* AppDelegate+JPush.m */; };
-		C04B4EC2FAAD4D328ABA0C95 /* jpush-ios-3.2.1.a in Frameworks */ = {isa = PBXBuildFile; fileRef = CCDEFB0C0632436FA86F0F31 /* jpush-ios-3.2.1.a */; };
-		3BE6767AAFDC4926A08E6690 /* JPushConfig.plist in Resources */ = {isa = PBXBuildFile; fileRef = E9D260B7FB6C49A3AE6CD0DB /* JPushConfig.plist */; };
-		BFA0CF013EEC44F9B2C6FA6E /* CFNetwork.framework in Frameworks */ = {isa = PBXBuildFile; fileRef = 0162975BB3964038A51EDED4 /* CFNetwork.framework */; settings = {ATTRIBUTES = (Weak, ); }; };
-		7EC1B4999B2E48C098BA1BBB /* CoreFoundation.framework in Frameworks */ = {isa = PBXBuildFile; fileRef = C44E29C3B190445C98BBAB84 /* CoreFoundation.framework */; settings = {ATTRIBUTES = (Weak, ); }; };
-		432FFA418F2F4247BE9C8472 /* CoreTelephony.framework in Frameworks */ = {isa = PBXBuildFile; fileRef = B1F790D5B00B4F178F835DE1 /* CoreTelephony.framework */; settings = {ATTRIBUTES = (Weak, ); }; };
-		7352A67D82B2499FBFFF8A2A /* Foundation.framework in Frameworks */ = {isa = PBXBuildFile; fileRef = 9B080F410C164D6582A23E36 /* Foundation.framework */; settings = {ATTRIBUTES = (Weak, ); }; };
-		A15A414BEE7A48538C758317 /* UIKit.framework in Frameworks */ = {isa = PBXBuildFile; fileRef = 6D5F2FFCAD8E4A4392B781A3 /* UIKit.framework */; settings = {ATTRIBUTES = (Weak, ); }; };
-		D3E822CFC71546E191C10DA7 /* libz.tbd in Frameworks */ = {isa = PBXBuildFile; fileRef = 22DF35565BBA44B1980FFAF5 /* libz.tbd */; settings = {ATTRIBUTES = (Weak, ); }; };
-		CDD6F217CA274CF18EC146D3 /* AdSupport.framework in Frameworks */ = {isa = PBXBuildFile; fileRef = 048B6FC037E1479790969D83 /* AdSupport.framework */; settings = {ATTRIBUTES = (Weak, ); }; };
-		77CDF61132F44B81B0064744 /* UserNotifications.framework in Frameworks */ = {isa = PBXBuildFile; fileRef = 59D1F618C1ED464283B7B2E6 /* UserNotifications.framework */; settings = {ATTRIBUTES = (Weak, ); }; };
-		3C00FC06B74E49CFBABD0CFF /* libresolv.tbd in Frameworks */ = {isa = PBXBuildFile; fileRef = CBD6EA74C612474DA862E146 /* libresolv.tbd */; settings = {ATTRIBUTES = (Weak, ); }; };
+		562D29FCB1FB4F86B95BB2BC /* CDVWKWebViewEngine.m in Sources */ = {isa = PBXBuildFile; fileRef = 59FDAA2CEE4540A3913846E4 /* CDVWKWebViewEngine.m */; };
+		F68EA21E51A3463A8FE2EE92 /* CDVWKWebViewUIDelegate.m in Sources */ = {isa = PBXBuildFile; fileRef = 3B73EA28E46846FF84E6AF02 /* CDVWKWebViewUIDelegate.m */; };
+		1F969D21D7EF4CF1A547A1DF /* CDVWKProcessPoolFactory.m in Sources */ = {isa = PBXBuildFile; fileRef = 473FEFEEBB2C4F5EAF594EBD /* CDVWKProcessPoolFactory.m */; };
+		8C09122A89C14C5FB0C28636 /* WebKit.framework in Frameworks */ = {isa = PBXBuildFile; fileRef = FE0B455916A4481681D59FE0 /* WebKit.framework */; settings = {ATTRIBUTES = (Weak, ); }; };
 /* End PBXBuildFile section */
 
 /* Begin PBXContainerItemProxy section */
 		301BF534109A57CC0062928A /* PBXContainerItemProxy */ = {
 			isa = PBXContainerItemProxy;
-			containerPortal = 301BF52D109A57CC0062928A /* CordovaLib.xcodeproj */;
+			containerPortal = 301BF52D109A57CC0062928A /* CordovaLib/CordovaLib.xcodeproj */;
 			proxyType = 2;
 			remoteGlobalIDString = D2AAC07E0554694100DB518D;
 			remoteInfo = CordovaLib;
 		};
 		301BF550109A68C00062928A /* PBXContainerItemProxy */ = {
 			isa = PBXContainerItemProxy;
-			containerPortal = 301BF52D109A57CC0062928A /* CordovaLib.xcodeproj */;
+			containerPortal = 301BF52D109A57CC0062928A /* CordovaLib/CordovaLib.xcodeproj */;
 			proxyType = 1;
 			remoteGlobalIDString = D2AAC07D0554694100DB518D;
 			remoteInfo = CordovaLib;
 		};
 		907D8123214C687600058A10 /* PBXContainerItemProxy */ = {
 			isa = PBXContainerItemProxy;
-			containerPortal = 301BF52D109A57CC0062928A /* CordovaLib.xcodeproj */;
+			containerPortal = 301BF52D109A57CC0062928A /* CordovaLib/CordovaLib.xcodeproj */;
 			proxyType = 2;
 			remoteGlobalIDString = C0C01EB21E3911D50056E6CB;
 			remoteInfo = Cordova;
@@ -86,30 +91,35 @@
 /* End PBXContainerItemProxy section */
 
 /* Begin PBXFileReference section */
+		0162975BB3964038A51EDED4 /* CFNetwork.framework */ = {isa = PBXFileReference; explicitFileType = undefined; fileEncoding = 9; includeInIndex = 0; lastKnownFileType = wrapper.framework; name = CFNetwork.framework; path = System/Library/Frameworks/CFNetwork.framework; sourceTree = SDKROOT; };
 		0207DA571B56EA530066E2B4 /* Images.xcassets */ = {isa = PBXFileReference; lastKnownFileType = folder.assetcatalog; name = Images.xcassets; path = dlapp/Images.xcassets; sourceTree = SOURCE_ROOT; };
+		048B6FC037E1479790969D83 /* AdSupport.framework */ = {isa = PBXFileReference; explicitFileType = undefined; fileEncoding = 9; includeInIndex = 0; lastKnownFileType = wrapper.framework; name = AdSupport.framework; path = System/Library/Frameworks/AdSupport.framework; sourceTree = SDKROOT; };
 		04B5E1A8BB504B8FB8CE9627 /* AFHTTPSessionManager.m */ = {isa = PBXFileReference; explicitFileType = undefined; fileEncoding = 4; includeInIndex = 0; lastKnownFileType = sourcecode.c.objc; name = AFHTTPSessionManager.m; path = "cordova-plugin-advanced-http/AFHTTPSessionManager.m"; sourceTree = "<group>"; };
 		07B9D06BD3024E0FBFF74967 /* CordovaHttpPlugin.m */ = {isa = PBXFileReference; explicitFileType = undefined; fileEncoding = 4; includeInIndex = 0; lastKnownFileType = sourcecode.c.objc; name = CordovaHttpPlugin.m; path = "cordova-plugin-advanced-http/CordovaHttpPlugin.m"; sourceTree = "<group>"; };
 		08B9BD113EDF4024B1F6D5CE /* AFURLRequestSerialization.h */ = {isa = PBXFileReference; explicitFileType = undefined; fileEncoding = 4; includeInIndex = 0; lastKnownFileType = sourcecode.c.h; name = AFURLRequestSerialization.h; path = "cordova-plugin-advanced-http/AFURLRequestSerialization.h"; sourceTree = "<group>"; };
 		09B4181C53154D9D8E1A2C4B /* AFHTTPSessionManager.h */ = {isa = PBXFileReference; explicitFileType = undefined; fileEncoding = 4; includeInIndex = 0; lastKnownFileType = sourcecode.c.h; name = AFHTTPSessionManager.h; path = "cordova-plugin-advanced-http/AFHTTPSessionManager.h"; sourceTree = "<group>"; };
+		0EFE153A83734473AE4D0E4C /* AppDelegate+JPush.h */ = {isa = PBXFileReference; explicitFileType = undefined; fileEncoding = 4; includeInIndex = 0; lastKnownFileType = sourcecode.c.h; name = "AppDelegate+JPush.h"; path = "jpush-phonegap-plugin/AppDelegate+JPush.h"; sourceTree = "<group>"; };
 		11A34CB026314A2AA98A0044 /* AVFoundation.framework */ = {isa = PBXFileReference; explicitFileType = undefined; fileEncoding = 9; includeInIndex = 0; lastKnownFileType = wrapper.framework; name = AVFoundation.framework; path = System/Library/Frameworks/AVFoundation.framework; sourceTree = SDKROOT; };
 		130AB7839C2A4FFF9F13C3DE /* CDVCamera.h */ = {isa = PBXFileReference; explicitFileType = undefined; fileEncoding = 4; includeInIndex = 0; lastKnownFileType = sourcecode.c.h; name = CDVCamera.h; path = "cordova-plugin-camera/CDVCamera.h"; sourceTree = "<group>"; };
 		148A2122F3E242E4AF09A28D /* SDNetworkActivityIndicator.m */ = {isa = PBXFileReference; explicitFileType = undefined; fileEncoding = 4; includeInIndex = 0; lastKnownFileType = sourcecode.c.objc; name = SDNetworkActivityIndicator.m; path = "cordova-plugin-advanced-http/SDNetworkActivityIndicator.m"; sourceTree = "<group>"; };
 		15879A58684B40158EC7A2CA /* CDVJpegHeaderWriter.h */ = {isa = PBXFileReference; explicitFileType = undefined; fileEncoding = 4; includeInIndex = 0; lastKnownFileType = sourcecode.c.h; name = CDVJpegHeaderWriter.h; path = "cordova-plugin-camera/CDVJpegHeaderWriter.h"; sourceTree = "<group>"; };
 		17FD8EDA2EC0424192F6CA79 /* AFSecurityPolicy.h */ = {isa = PBXFileReference; explicitFileType = undefined; fileEncoding = 4; includeInIndex = 0; lastKnownFileType = sourcecode.c.h; name = AFSecurityPolicy.h; path = "cordova-plugin-advanced-http/AFSecurityPolicy.h"; sourceTree = "<group>"; };
 		1836D178C8A74923B944A79E /* CDVJpegHeaderWriter.m */ = {isa = PBXFileReference; explicitFileType = undefined; fileEncoding = 4; includeInIndex = 0; lastKnownFileType = sourcecode.c.objc; name = CDVJpegHeaderWriter.m; path = "cordova-plugin-camera/CDVJpegHeaderWriter.m"; sourceTree = "<group>"; };
+		1AAC7231E47A434EAF06A5B0 /* AppVersion.m */ = {isa = PBXFileReference; explicitFileType = undefined; fileEncoding = 4; includeInIndex = 0; lastKnownFileType = sourcecode.c.objc; name = AppVersion.m; path = "cordova-plugin-app-version/AppVersion.m"; sourceTree = "<group>"; };
 		1ABBE12B040548F8909BFC7B /* CDVStatusBar.m */ = {isa = PBXFileReference; explicitFileType = undefined; fileEncoding = 4; includeInIndex = 0; lastKnownFileType = sourcecode.c.objc; name = CDVStatusBar.m; path = "cordova-plugin-statusbar/CDVStatusBar.m"; sourceTree = "<group>"; };
 		1D1F25845F964D87B880BFA9 /* CoreLocation.framework */ = {isa = PBXFileReference; explicitFileType = undefined; fileEncoding = 9; includeInIndex = 0; lastKnownFileType = wrapper.framework; name = CoreLocation.framework; path = System/Library/Frameworks/CoreLocation.framework; sourceTree = SDKROOT; };
 		1D3623240D0F684500981E51 /* AppDelegate.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; path = AppDelegate.h; sourceTree = "<group>"; };
 		1D3623250D0F684500981E51 /* AppDelegate.m */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.objc; path = AppDelegate.m; sourceTree = "<group>"; };
 		1D6058910D05DD3D006BFB54 /* dlapp.app */ = {isa = PBXFileReference; explicitFileType = wrapper.application; includeInIndex = 0; path = dlapp.app; sourceTree = BUILT_PRODUCTS_DIR; };
 		22AE2683802B4CB1BAF69ABF /* AFURLSessionManager.m */ = {isa = PBXFileReference; explicitFileType = undefined; fileEncoding = 4; includeInIndex = 0; lastKnownFileType = sourcecode.c.objc; name = AFURLSessionManager.m; path = "cordova-plugin-advanced-http/AFURLSessionManager.m"; sourceTree = "<group>"; };
+		22DF35565BBA44B1980FFAF5 /* libz.tbd */ = {isa = PBXFileReference; explicitFileType = undefined; fileEncoding = 9; includeInIndex = 0; lastKnownFileType = "sourcecode.text-based-dylib-definition"; name = libz.tbd; path = usr/lib/libz.tbd; sourceTree = SDKROOT; };
 		2625E3AABA8145E6901F06D3 /* SystemConfiguration.framework */ = {isa = PBXFileReference; explicitFileType = undefined; fileEncoding = 9; includeInIndex = 0; lastKnownFileType = wrapper.framework; name = SystemConfiguration.framework; path = System/Library/Frameworks/SystemConfiguration.framework; sourceTree = SDKROOT; };
 		265BE52D975B49ACA2F7B3FE /* CDVDevice.h */ = {isa = PBXFileReference; explicitFileType = undefined; fileEncoding = 4; includeInIndex = 0; lastKnownFileType = sourcecode.c.h; name = CDVDevice.h; path = "cordova-plugin-device/CDVDevice.h"; sourceTree = "<group>"; };
 		281DF600F6B747808087E4FC /* UIImage+CropScaleOrientation.m */ = {isa = PBXFileReference; explicitFileType = undefined; fileEncoding = 4; includeInIndex = 0; lastKnownFileType = sourcecode.c.objc; name = "UIImage+CropScaleOrientation.m"; path = "cordova-plugin-camera/UIImage+CropScaleOrientation.m"; sourceTree = "<group>"; };
 		28B91F31B6FD410AAF87BBDC /* CDVThemeableBrowser.m */ = {isa = PBXFileReference; explicitFileType = undefined; fileEncoding = 4; includeInIndex = 0; lastKnownFileType = sourcecode.c.objc; name = CDVThemeableBrowser.m; path = "cordova-plugin-themeablebrowser/CDVThemeableBrowser.m"; sourceTree = "<group>"; };
 		29B97316FDCFA39411CA2CEA /* main.m */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.objc; path = main.m; sourceTree = "<group>"; };
 		2F977C7D2E4448098AA27AE8 /* CDVAssetLibraryFilesystem.h */ = {isa = PBXFileReference; explicitFileType = undefined; fileEncoding = 4; includeInIndex = 0; lastKnownFileType = sourcecode.c.h; name = CDVAssetLibraryFilesystem.h; path = "cordova-plugin-file/CDVAssetLibraryFilesystem.h"; sourceTree = "<group>"; };
-		301BF52D109A57CC0062928A /* CordovaLib.xcodeproj */ = {isa = PBXFileReference; lastKnownFileType = "wrapper.pb-project"; path = CordovaLib/CordovaLib.xcodeproj; sourceTree = "<group>"; };
+		301BF52D109A57CC0062928A /* CordovaLib/CordovaLib.xcodeproj */ = {isa = PBXFileReference; lastKnownFileType = "wrapper.pb-project"; path = CordovaLib/CordovaLib.xcodeproj; sourceTree = "<group>"; };
 		301BF56E109A69640062928A /* www */ = {isa = PBXFileReference; lastKnownFileType = folder; path = www; sourceTree = SOURCE_ROOT; };
 		302D95EE14D2391D003F00A1 /* MainViewController.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; path = MainViewController.h; sourceTree = "<group>"; };
 		302D95EF14D2391D003F00A1 /* MainViewController.m */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.objc; path = MainViewController.m; sourceTree = "<group>"; };
@@ -117,18 +127,23 @@
 		3047A50F1AB8059700498E2A /* build-debug.xcconfig */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = text.xcconfig; name = "build-debug.xcconfig"; path = "cordova/build-debug.xcconfig"; sourceTree = SOURCE_ROOT; };
 		3047A5101AB8059700498E2A /* build-release.xcconfig */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = text.xcconfig; name = "build-release.xcconfig"; path = "cordova/build-release.xcconfig"; sourceTree = SOURCE_ROOT; };
 		3047A5111AB8059700498E2A /* build.xcconfig */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = text.xcconfig; name = build.xcconfig; path = cordova/build.xcconfig; sourceTree = SOURCE_ROOT; };
+		3291AEB63DCC45B58959915F /* JPushPlugin.h */ = {isa = PBXFileReference; explicitFileType = undefined; fileEncoding = 4; includeInIndex = 0; lastKnownFileType = sourcecode.c.h; name = JPushPlugin.h; path = "jpush-phonegap-plugin/JPushPlugin.h"; sourceTree = "<group>"; };
 		32CA4F630368D1EE00C91783 /* dlapp-Prefix.pch */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; path = "dlapp-Prefix.pch"; sourceTree = "<group>"; };
+		331EEE6AB06B4F35BFBC8120 /* AppVersion.h */ = {isa = PBXFileReference; explicitFileType = undefined; fileEncoding = 4; includeInIndex = 0; lastKnownFileType = sourcecode.c.h; name = AppVersion.h; path = "cordova-plugin-app-version/AppVersion.h"; sourceTree = "<group>"; };
 		3BE5364CD5E74AFDAB853364 /* AFURLResponseSerialization.h */ = {isa = PBXFileReference; explicitFileType = undefined; fileEncoding = 4; includeInIndex = 0; lastKnownFileType = sourcecode.c.h; name = AFURLResponseSerialization.h; path = "cordova-plugin-advanced-http/AFURLResponseSerialization.h"; sourceTree = "<group>"; };
 		3D1EDC804D3646E7BE4A92BF /* AFNetworking.h */ = {isa = PBXFileReference; explicitFileType = undefined; fileEncoding = 4; includeInIndex = 0; lastKnownFileType = sourcecode.c.h; name = AFNetworking.h; path = "cordova-plugin-advanced-http/AFNetworking.h"; sourceTree = "<group>"; };
 		3FD6ED94AE9243B29217547A /* CDVLocalFilesystem.h */ = {isa = PBXFileReference; explicitFileType = undefined; fileEncoding = 4; includeInIndex = 0; lastKnownFileType = sourcecode.c.h; name = CDVLocalFilesystem.h; path = "cordova-plugin-file/CDVLocalFilesystem.h"; sourceTree = "<group>"; };
 		41DFF309018A479EA8F43611 /* CDVInAppBrowser.h */ = {isa = PBXFileReference; explicitFileType = undefined; fileEncoding = 4; includeInIndex = 0; lastKnownFileType = sourcecode.c.h; name = CDVInAppBrowser.h; path = "cordova-plugin-inappbrowser/CDVInAppBrowser.h"; sourceTree = "<group>"; };
+		444DBF371D8346D7BC7EE35D /* jcore-ios-2.1.1.a */ = {isa = PBXFileReference; explicitFileType = undefined; fileEncoding = 9; includeInIndex = 0; lastKnownFileType = archive.ar; name = "jcore-ios-2.1.1.a"; path = "dlapp/Plugins/cordova-plugin-jcore/jcore-ios-2.1.1.a"; sourceTree = "<group>"; };
 		4BF1AE7251084FD2876E0BF5 /* AFURLRequestSerialization.m */ = {isa = PBXFileReference; explicitFileType = undefined; fileEncoding = 4; includeInIndex = 0; lastKnownFileType = sourcecode.c.objc; name = AFURLRequestSerialization.m; path = "cordova-plugin-advanced-http/AFURLRequestSerialization.m"; sourceTree = "<group>"; };
 		5192EB17EA164DFD80D433E4 /* ImageIO.framework */ = {isa = PBXFileReference; explicitFileType = undefined; fileEncoding = 9; includeInIndex = 0; lastKnownFileType = wrapper.framework; name = ImageIO.framework; path = System/Library/Frameworks/ImageIO.framework; sourceTree = SDKROOT; };
 		57E66D7A151D45828ED66B7F /* TextResponseSerializer.m */ = {isa = PBXFileReference; explicitFileType = undefined; fileEncoding = 4; includeInIndex = 0; lastKnownFileType = sourcecode.c.objc; name = TextResponseSerializer.m; path = "cordova-plugin-advanced-http/TextResponseSerializer.m"; sourceTree = "<group>"; };
+		59D1F618C1ED464283B7B2E6 /* UserNotifications.framework */ = {isa = PBXFileReference; explicitFileType = undefined; fileEncoding = 9; includeInIndex = 0; lastKnownFileType = wrapper.framework; name = UserNotifications.framework; path = System/Library/Frameworks/UserNotifications.framework; sourceTree = SDKROOT; };
 		607F51FCFC7C4062A93BD011 /* CDVInAppBrowser.m */ = {isa = PBXFileReference; explicitFileType = undefined; fileEncoding = 4; includeInIndex = 0; lastKnownFileType = sourcecode.c.objc; name = CDVInAppBrowser.m; path = "cordova-plugin-inappbrowser/CDVInAppBrowser.m"; sourceTree = "<group>"; };
 		61106E22F1D348DDBDC4DC0B /* DisableStatusbar.m */ = {isa = PBXFileReference; explicitFileType = undefined; fileEncoding = 4; includeInIndex = 0; lastKnownFileType = sourcecode.c.objc; name = DisableStatusbar.m; path = "cordova-plugin-disable-ios11-statusbar/DisableStatusbar.m"; sourceTree = "<group>"; };
 		62C24B1E8F294AC587C6D051 /* UIImage+CropScaleOrientation.h */ = {isa = PBXFileReference; explicitFileType = undefined; fileEncoding = 4; includeInIndex = 0; lastKnownFileType = sourcecode.c.h; name = "UIImage+CropScaleOrientation.h"; path = "cordova-plugin-camera/UIImage+CropScaleOrientation.h"; sourceTree = "<group>"; };
 		683645F69456461BB8712924 /* AFNetworkReachabilityManager.h */ = {isa = PBXFileReference; explicitFileType = undefined; fileEncoding = 4; includeInIndex = 0; lastKnownFileType = sourcecode.c.h; name = AFNetworkReachabilityManager.h; path = "cordova-plugin-advanced-http/AFNetworkReachabilityManager.h"; sourceTree = "<group>"; };
+		6D5F2FFCAD8E4A4392B781A3 /* UIKit.framework */ = {isa = PBXFileReference; explicitFileType = undefined; fileEncoding = 9; includeInIndex = 0; lastKnownFileType = wrapper.framework; name = UIKit.framework; path = System/Library/Frameworks/UIKit.framework; sourceTree = SDKROOT; };
 		6DC53FCFEEFD4EC89C2073E0 /* TextRequestSerializer.h */ = {isa = PBXFileReference; explicitFileType = undefined; fileEncoding = 4; includeInIndex = 0; lastKnownFileType = sourcecode.c.h; name = TextRequestSerializer.h; path = "cordova-plugin-advanced-http/TextRequestSerializer.h"; sourceTree = "<group>"; };
 		6FEED8E986814AC1AC60FC28 /* AFNetworkReachabilityManager.m */ = {isa = PBXFileReference; explicitFileType = undefined; fileEncoding = 4; includeInIndex = 0; lastKnownFileType = sourcecode.c.objc; name = AFNetworkReachabilityManager.m; path = "cordova-plugin-advanced-http/AFNetworkReachabilityManager.m"; sourceTree = "<group>"; };
 		7601E9450D7240078C98ED9D /* CordovaHttpPlugin.h */ = {isa = PBXFileReference; explicitFileType = undefined; fileEncoding = 4; includeInIndex = 0; lastKnownFileType = sourcecode.c.h; name = CordovaHttpPlugin.h; path = "cordova-plugin-advanced-http/CordovaHttpPlugin.h"; sourceTree = "<group>"; };
@@ -139,20 +154,29 @@
 		8BFF0D502E2241F0A89DF67F /* CDVStatusBar.h */ = {isa = PBXFileReference; explicitFileType = undefined; fileEncoding = 4; includeInIndex = 0; lastKnownFileType = sourcecode.c.h; name = CDVStatusBar.h; path = "cordova-plugin-statusbar/CDVStatusBar.h"; sourceTree = "<group>"; };
 		8D1107310486CEB800E47090 /* dlapp-Info.plist */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = text.plist.xml; name = "dlapp-Info.plist"; path = "dlapp/dlapp-Info.plist"; plistStructureDefinitionIdentifier = "com.apple.xcode.plist.structure-definition.iphone.info-plist"; sourceTree = SOURCE_ROOT; };
 		901AB970F8AB4CEF82C6DC1B /* BinaryResponseSerializer.h */ = {isa = PBXFileReference; explicitFileType = undefined; fileEncoding = 4; includeInIndex = 0; lastKnownFileType = sourcecode.c.h; name = BinaryResponseSerializer.h; path = "cordova-plugin-advanced-http/BinaryResponseSerializer.h"; sourceTree = "<group>"; };
+		91E044FC8377488C886C818B /* AppDelegate+JPush.m */ = {isa = PBXFileReference; explicitFileType = undefined; fileEncoding = 4; includeInIndex = 0; lastKnownFileType = sourcecode.c.objc; name = "AppDelegate+JPush.m"; path = "jpush-phonegap-plugin/AppDelegate+JPush.m"; sourceTree = "<group>"; };
+		9B080F410C164D6582A23E36 /* Foundation.framework */ = {isa = PBXFileReference; explicitFileType = undefined; fileEncoding = 9; includeInIndex = 0; lastKnownFileType = wrapper.framework; name = Foundation.framework; path = System/Library/Frameworks/Foundation.framework; sourceTree = SDKROOT; };
+		A32F7333BFEB461B9C84F6E5 /* JPUSHService.h */ = {isa = PBXFileReference; explicitFileType = undefined; fileEncoding = 4; includeInIndex = 0; lastKnownFileType = sourcecode.c.h; name = JPUSHService.h; path = "jpush-phonegap-plugin/JPUSHService.h"; sourceTree = "<group>"; };
 		A50DE9801E5E4302A78D569C /* CDVDevice.m */ = {isa = PBXFileReference; explicitFileType = undefined; fileEncoding = 4; includeInIndex = 0; lastKnownFileType = sourcecode.c.objc; name = CDVDevice.m; path = "cordova-plugin-device/CDVDevice.m"; sourceTree = "<group>"; };
 		A673D8D8920E4086A9152FC4 /* Security.framework */ = {isa = PBXFileReference; explicitFileType = undefined; fileEncoding = 9; includeInIndex = 0; lastKnownFileType = wrapper.framework; name = Security.framework; path = System/Library/Frameworks/Security.framework; sourceTree = SDKROOT; };
 		A719A69FD70D4CC9B8104FF6 /* CDVAssetLibraryFilesystem.m */ = {isa = PBXFileReference; explicitFileType = undefined; fileEncoding = 4; includeInIndex = 0; lastKnownFileType = sourcecode.c.objc; name = CDVAssetLibraryFilesystem.m; path = "cordova-plugin-file/CDVAssetLibraryFilesystem.m"; sourceTree = "<group>"; };
 		B19E413F59714C6285552E82 /* TouchID.h */ = {isa = PBXFileReference; explicitFileType = undefined; fileEncoding = 4; includeInIndex = 0; lastKnownFileType = sourcecode.c.h; name = TouchID.h; path = "cordova-plugin-touch-id/TouchID.h"; sourceTree = "<group>"; };
+		B1F790D5B00B4F178F835DE1 /* CoreTelephony.framework */ = {isa = PBXFileReference; explicitFileType = undefined; fileEncoding = 9; includeInIndex = 0; lastKnownFileType = wrapper.framework; name = CoreTelephony.framework; path = System/Library/Frameworks/CoreTelephony.framework; sourceTree = SDKROOT; };
 		B3CE13EED96B44C0B06B1B2C /* TouchID.m */ = {isa = PBXFileReference; explicitFileType = undefined; fileEncoding = 4; includeInIndex = 0; lastKnownFileType = sourcecode.c.objc; name = TouchID.m; path = "cordova-plugin-touch-id/TouchID.m"; sourceTree = "<group>"; };
 		B3F9D30FB27A4B26A445BA84 /* CDVExif.h */ = {isa = PBXFileReference; explicitFileType = undefined; fileEncoding = 4; includeInIndex = 0; lastKnownFileType = sourcecode.c.h; name = CDVExif.h; path = "cordova-plugin-camera/CDVExif.h"; sourceTree = "<group>"; };
 		BA6C5B1A6A6A488790CA41EB /* AFSecurityPolicy.m */ = {isa = PBXFileReference; explicitFileType = undefined; fileEncoding = 4; includeInIndex = 0; lastKnownFileType = sourcecode.c.objc; name = AFSecurityPolicy.m; path = "cordova-plugin-advanced-http/AFSecurityPolicy.m"; sourceTree = "<group>"; };
 		C2099240B64744E08C91C285 /* Fingerprint.swift */ = {isa = PBXFileReference; explicitFileType = undefined; fileEncoding = 4; includeInIndex = 0; lastKnownFileType = sourcecode.swift; name = Fingerprint.swift; path = "cordova-plugin-fingerprint-aio/Fingerprint.swift"; sourceTree = "<group>"; };
+		C44E29C3B190445C98BBAB84 /* CoreFoundation.framework */ = {isa = PBXFileReference; explicitFileType = undefined; fileEncoding = 9; includeInIndex = 0; lastKnownFileType = wrapper.framework; name = CoreFoundation.framework; path = System/Library/Frameworks/CoreFoundation.framework; sourceTree = SDKROOT; };
 		C8478FFD487C4004A1CEFCA8 /* QRScanner.swift */ = {isa = PBXFileReference; explicitFileType = undefined; fileEncoding = 4; includeInIndex = 0; lastKnownFileType = sourcecode.swift; name = QRScanner.swift; path = "cordova-plugin-qrscanner/QRScanner.swift"; sourceTree = "<group>"; };
+		CBD6EA74C612474DA862E146 /* libresolv.tbd */ = {isa = PBXFileReference; explicitFileType = undefined; fileEncoding = 9; includeInIndex = 0; lastKnownFileType = "sourcecode.text-based-dylib-definition"; name = libresolv.tbd; path = usr/lib/libresolv.tbd; sourceTree = SDKROOT; };
+		CCDEFB0C0632436FA86F0F31 /* jpush-ios-3.2.1.a */ = {isa = PBXFileReference; explicitFileType = undefined; fileEncoding = 9; includeInIndex = 0; lastKnownFileType = archive.ar; name = "jpush-ios-3.2.1.a"; path = "dlapp/Plugins/jpush-phonegap-plugin/jpush-ios-3.2.1.a"; sourceTree = "<group>"; };
+		CD3E9CB7CBA54989AB62BA7F /* JPushPlugin.m */ = {isa = PBXFileReference; explicitFileType = undefined; fileEncoding = 4; includeInIndex = 0; lastKnownFileType = sourcecode.c.objc; name = JPushPlugin.m; path = "jpush-phonegap-plugin/JPushPlugin.m"; sourceTree = "<group>"; };
 		D4DBE4512BAD4694B7EB5217 /* SDNetworkActivityIndicator.h */ = {isa = PBXFileReference; explicitFileType = undefined; fileEncoding = 4; includeInIndex = 0; lastKnownFileType = sourcecode.c.h; name = SDNetworkActivityIndicator.h; path = "cordova-plugin-advanced-http/SDNetworkActivityIndicator.h"; sourceTree = "<group>"; };
 		D992375F52889311A88544EF /* libPods-dlapp.a */ = {isa = PBXFileReference; explicitFileType = archive.ar; includeInIndex = 0; path = "libPods-dlapp.a"; sourceTree = BUILT_PRODUCTS_DIR; };
 		DBDBB5C64D17465C9452AF28 /* TextRequestSerializer.m */ = {isa = PBXFileReference; explicitFileType = undefined; fileEncoding = 4; includeInIndex = 0; lastKnownFileType = sourcecode.c.objc; name = TextRequestSerializer.m; path = "cordova-plugin-advanced-http/TextRequestSerializer.m"; sourceTree = "<group>"; };
 		DD3651F245114E52ABEB9060 /* CDVFile.m */ = {isa = PBXFileReference; explicitFileType = undefined; fileEncoding = 4; includeInIndex = 0; lastKnownFileType = sourcecode.c.objc; name = CDVFile.m; path = "cordova-plugin-file/CDVFile.m"; sourceTree = "<group>"; };
 		DE50527E757F47D08F4E076C /* CDVFile.h */ = {isa = PBXFileReference; explicitFileType = undefined; fileEncoding = 4; includeInIndex = 0; lastKnownFileType = sourcecode.c.h; name = CDVFile.h; path = "cordova-plugin-file/CDVFile.h"; sourceTree = "<group>"; };
+		E9D260B7FB6C49A3AE6CD0DB /* JPushConfig.plist */ = {isa = PBXFileReference; explicitFileType = undefined; fileEncoding = 4; includeInIndex = 0; lastKnownFileType = text.plist.xml; path = JPushConfig.plist; sourceTree = "<group>"; };
 		E9F753C8AE424EAE851FA1FD /* BinaryResponseSerializer.m */ = {isa = PBXFileReference; explicitFileType = undefined; fileEncoding = 4; includeInIndex = 0; lastKnownFileType = sourcecode.c.objc; name = BinaryResponseSerializer.m; path = "cordova-plugin-advanced-http/BinaryResponseSerializer.m"; sourceTree = "<group>"; };
 		EB87FDF31871DA8E0020F90C /* www */ = {isa = PBXFileReference; lastKnownFileType = folder; name = www; path = ../../www; sourceTree = "<group>"; };
 		EB87FDF41871DAF40020F90C /* config.xml */ = {isa = PBXFileReference; lastKnownFileType = text.xml; name = config.xml; path = ../../config.xml; sourceTree = "<group>"; };
@@ -161,26 +185,16 @@
 		F3A85B8119074F699E1A15CD /* LocalAuthentication.framework */ = {isa = PBXFileReference; explicitFileType = undefined; fileEncoding = 9; includeInIndex = 0; lastKnownFileType = wrapper.framework; name = LocalAuthentication.framework; path = System/Library/Frameworks/LocalAuthentication.framework; sourceTree = SDKROOT; };
 		F840E1F0165FE0F500CFE078 /* config.xml */ = {isa = PBXFileReference; lastKnownFileType = text.xml; name = config.xml; path = dlapp/config.xml; sourceTree = "<group>"; };
 		F939AD8C22BB769B006B371B /* libsqlite3.0.tbd */ = {isa = PBXFileReference; lastKnownFileType = "sourcecode.text-based-dylib-definition"; name = libsqlite3.0.tbd; path = usr/lib/libsqlite3.0.tbd; sourceTree = SDKROOT; };
+		FC8EA7F3637547AD8BC62127 /* JPushDefine.h */ = {isa = PBXFileReference; explicitFileType = undefined; fileEncoding = 4; includeInIndex = 0; lastKnownFileType = sourcecode.c.h; name = JPushDefine.h; path = "jpush-phonegap-plugin/JPushDefine.h"; sourceTree = "<group>"; };
 		FCC7E279D80D4FB9BCF2530A /* Bridging-Header.h */ = {isa = PBXFileReference; explicitFileType = undefined; fileEncoding = 4; includeInIndex = 0; lastKnownFileType = sourcecode.c.h; name = "Bridging-Header.h"; path = "cordova-plugin-fingerprint-aio/Bridging-Header.h"; sourceTree = "<group>"; };
 		FDEE8379D7A34C55A616F700 /* AFURLResponseSerialization.m */ = {isa = PBXFileReference; explicitFileType = undefined; fileEncoding = 4; includeInIndex = 0; lastKnownFileType = sourcecode.c.objc; name = AFURLResponseSerialization.m; path = "cordova-plugin-advanced-http/AFURLResponseSerialization.m"; sourceTree = "<group>"; };
-		444DBF371D8346D7BC7EE35D /* jcore-ios-2.1.1.a */ = {isa = PBXFileReference; name = "jcore-ios-2.1.1.a"; path = "dlapp/Plugins/cordova-plugin-jcore/jcore-ios-2.1.1.a"; sourceTree = "<group>"; fileEncoding = undefined; lastKnownFileType = archive.ar; explicitFileType = undefined; includeInIndex = 0; };
-		CD3E9CB7CBA54989AB62BA7F /* JPushPlugin.m */ = {isa = PBXFileReference; name = "JPushPlugin.m"; path = "jpush-phonegap-plugin/JPushPlugin.m"; sourceTree = "<group>"; fileEncoding = 4; lastKnownFileType = sourcecode.c.objc; explicitFileType = undefined; includeInIndex = 0; };
-		91E044FC8377488C886C818B /* AppDelegate+JPush.m */ = {isa = PBXFileReference; name = "AppDelegate+JPush.m"; path = "jpush-phonegap-plugin/AppDelegate+JPush.m"; sourceTree = "<group>"; fileEncoding = 4; lastKnownFileType = sourcecode.c.objc; explicitFileType = undefined; includeInIndex = 0; };
-		CCDEFB0C0632436FA86F0F31 /* jpush-ios-3.2.1.a */ = {isa = PBXFileReference; name = "jpush-ios-3.2.1.a"; path = "dlapp/Plugins/jpush-phonegap-plugin/jpush-ios-3.2.1.a"; sourceTree = "<group>"; fileEncoding = undefined; lastKnownFileType = archive.ar; explicitFileType = undefined; includeInIndex = 0; };
-		FC8EA7F3637547AD8BC62127 /* JPushDefine.h */ = {isa = PBXFileReference; name = "JPushDefine.h"; path = "jpush-phonegap-plugin/JPushDefine.h"; sourceTree = "<group>"; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; explicitFileType = undefined; includeInIndex = 0; };
-		3291AEB63DCC45B58959915F /* JPushPlugin.h */ = {isa = PBXFileReference; name = "JPushPlugin.h"; path = "jpush-phonegap-plugin/JPushPlugin.h"; sourceTree = "<group>"; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; explicitFileType = undefined; includeInIndex = 0; };
-		0EFE153A83734473AE4D0E4C /* AppDelegate+JPush.h */ = {isa = PBXFileReference; name = "AppDelegate+JPush.h"; path = "jpush-phonegap-plugin/AppDelegate+JPush.h"; sourceTree = "<group>"; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; explicitFileType = undefined; includeInIndex = 0; };
-		A32F7333BFEB461B9C84F6E5 /* JPUSHService.h */ = {isa = PBXFileReference; name = "JPUSHService.h"; path = "jpush-phonegap-plugin/JPUSHService.h"; sourceTree = "<group>"; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; explicitFileType = undefined; includeInIndex = 0; };
-		E9D260B7FB6C49A3AE6CD0DB /* JPushConfig.plist */ = {isa = PBXFileReference; name = "JPushConfig.plist"; path = "JPushConfig.plist"; sourceTree = "<group>"; fileEncoding = 4; lastKnownFileType = text.plist.xml; explicitFileType = undefined; includeInIndex = 0; };
-		0162975BB3964038A51EDED4 /* CFNetwork.framework */ = {isa = PBXFileReference; name = "CFNetwork.framework"; path = "System/Library/Frameworks/CFNetwork.framework"; sourceTree = SDKROOT; fileEncoding = undefined; lastKnownFileType = wrapper.framework; explicitFileType = undefined; includeInIndex = 0; };
-		C44E29C3B190445C98BBAB84 /* CoreFoundation.framework */ = {isa = PBXFileReference; name = "CoreFoundation.framework"; path = "System/Library/Frameworks/CoreFoundation.framework"; sourceTree = SDKROOT; fileEncoding = undefined; lastKnownFileType = wrapper.framework; explicitFileType = undefined; includeInIndex = 0; };
-		B1F790D5B00B4F178F835DE1 /* CoreTelephony.framework */ = {isa = PBXFileReference; name = "CoreTelephony.framework"; path = "System/Library/Frameworks/CoreTelephony.framework"; sourceTree = SDKROOT; fileEncoding = undefined; lastKnownFileType = wrapper.framework; explicitFileType = undefined; includeInIndex = 0; };
-		9B080F410C164D6582A23E36 /* Foundation.framework */ = {isa = PBXFileReference; name = "Foundation.framework"; path = "System/Library/Frameworks/Foundation.framework"; sourceTree = SDKROOT; fileEncoding = undefined; lastKnownFileType = wrapper.framework; explicitFileType = undefined; includeInIndex = 0; };
-		6D5F2FFCAD8E4A4392B781A3 /* UIKit.framework */ = {isa = PBXFileReference; name = "UIKit.framework"; path = "System/Library/Frameworks/UIKit.framework"; sourceTree = SDKROOT; fileEncoding = undefined; lastKnownFileType = wrapper.framework; explicitFileType = undefined; includeInIndex = 0; };
-		22DF35565BBA44B1980FFAF5 /* libz.tbd */ = {isa = PBXFileReference; name = "libz.tbd"; path = "usr/lib/libz.tbd"; sourceTree = SDKROOT; fileEncoding = undefined; lastKnownFileType = sourcecode.text-based-dylib-definition; explicitFileType = undefined; includeInIndex = 0; };
-		048B6FC037E1479790969D83 /* AdSupport.framework */ = {isa = PBXFileReference; name = "AdSupport.framework"; path = "System/Library/Frameworks/AdSupport.framework"; sourceTree = SDKROOT; fileEncoding = undefined; lastKnownFileType = wrapper.framework; explicitFileType = undefined; includeInIndex = 0; };
-		59D1F618C1ED464283B7B2E6 /* UserNotifications.framework */ = {isa = PBXFileReference; name = "UserNotifications.framework"; path = "System/Library/Frameworks/UserNotifications.framework"; sourceTree = SDKROOT; fileEncoding = undefined; lastKnownFileType = wrapper.framework; explicitFileType = undefined; includeInIndex = 0; };
-		CBD6EA74C612474DA862E146 /* libresolv.tbd */ = {isa = PBXFileReference; name = "libresolv.tbd"; path = "usr/lib/libresolv.tbd"; sourceTree = SDKROOT; fileEncoding = undefined; lastKnownFileType = sourcecode.text-based-dylib-definition; explicitFileType = undefined; includeInIndex = 0; };
+		59FDAA2CEE4540A3913846E4 /* CDVWKWebViewEngine.m */ = {isa = PBXFileReference; name = "CDVWKWebViewEngine.m"; path = "cordova-plugin-wkwebview-engine/CDVWKWebViewEngine.m"; sourceTree = "<group>"; fileEncoding = 4; lastKnownFileType = sourcecode.c.objc; explicitFileType = undefined; includeInIndex = 0; };
+		3B73EA28E46846FF84E6AF02 /* CDVWKWebViewUIDelegate.m */ = {isa = PBXFileReference; name = "CDVWKWebViewUIDelegate.m"; path = "cordova-plugin-wkwebview-engine/CDVWKWebViewUIDelegate.m"; sourceTree = "<group>"; fileEncoding = 4; lastKnownFileType = sourcecode.c.objc; explicitFileType = undefined; includeInIndex = 0; };
+		473FEFEEBB2C4F5EAF594EBD /* CDVWKProcessPoolFactory.m */ = {isa = PBXFileReference; name = "CDVWKProcessPoolFactory.m"; path = "cordova-plugin-wkwebview-engine/CDVWKProcessPoolFactory.m"; sourceTree = "<group>"; fileEncoding = 4; lastKnownFileType = sourcecode.c.objc; explicitFileType = undefined; includeInIndex = 0; };
+		648BD3182CD64A77AD2D447B /* CDVWKWebViewEngine.h */ = {isa = PBXFileReference; name = "CDVWKWebViewEngine.h"; path = "cordova-plugin-wkwebview-engine/CDVWKWebViewEngine.h"; sourceTree = "<group>"; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; explicitFileType = undefined; includeInIndex = 0; };
+		1E5CB6025B2E4D14ABFDB037 /* CDVWKWebViewUIDelegate.h */ = {isa = PBXFileReference; name = "CDVWKWebViewUIDelegate.h"; path = "cordova-plugin-wkwebview-engine/CDVWKWebViewUIDelegate.h"; sourceTree = "<group>"; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; explicitFileType = undefined; includeInIndex = 0; };
+		7DC7711D3C76485B9E422E3A /* CDVWKProcessPoolFactory.h */ = {isa = PBXFileReference; name = "CDVWKProcessPoolFactory.h"; path = "cordova-plugin-wkwebview-engine/CDVWKProcessPoolFactory.h"; sourceTree = "<group>"; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; explicitFileType = undefined; includeInIndex = 0; };
+		FE0B455916A4481681D59FE0 /* WebKit.framework */ = {isa = PBXFileReference; name = "WebKit.framework"; path = "System/Library/Frameworks/WebKit.framework"; sourceTree = SDKROOT; fileEncoding = undefined; lastKnownFileType = wrapper.framework; explicitFileType = undefined; includeInIndex = 0; };
 /* End PBXFileReference section */
 
 /* Begin PBXFrameworksBuildPhase section */
@@ -208,6 +222,7 @@
 				CDD6F217CA274CF18EC146D3 /* AdSupport.framework in Frameworks */,
 				77CDF61132F44B81B0064744 /* UserNotifications.framework in Frameworks */,
 				3C00FC06B74E49CFBABD0CFF /* libresolv.tbd in Frameworks */,
+				8C09122A89C14C5FB0C28636 /* WebKit.framework in Frameworks */,
 			);
 			runOnlyForDeploymentPostprocessing = 0;
 		};
@@ -235,13 +250,13 @@
 			name = Products;
 			sourceTree = "<group>";
 		};
-		29B97314FDCFA39411CA2CEA = {
+		29B97314FDCFA39411CA2CEA /* CustomTemplate */ = {
 			isa = PBXGroup;
 			children = (
 				EB87FDF41871DAF40020F90C /* config.xml */,
 				EB87FDF31871DA8E0020F90C /* www */,
 				EB87FDF11871DA420020F90C /* Staging */,
-				301BF52D109A57CC0062928A /* CordovaLib.xcodeproj */,
+				301BF52D109A57CC0062928A /* CordovaLib/CordovaLib.xcodeproj */,
 				080E96DDFE201D6D7F000001 /* Classes */,
 				307C750510C5A3420062BCA9 /* Plugins */,
 				29B97315FDCFA39411CA2CEA /* Other Sources */,
@@ -298,6 +313,7 @@
 				048B6FC037E1479790969D83 /* AdSupport.framework */,
 				59D1F618C1ED464283B7B2E6 /* UserNotifications.framework */,
 				CBD6EA74C612474DA862E146 /* libresolv.tbd */,
+				FE0B455916A4481681D59FE0 /* WebKit.framework */,
 			);
 			name = Frameworks;
 			sourceTree = "<group>";
@@ -380,6 +396,14 @@
 				3291AEB63DCC45B58959915F /* JPushPlugin.h */,
 				0EFE153A83734473AE4D0E4C /* AppDelegate+JPush.h */,
 				A32F7333BFEB461B9C84F6E5 /* JPUSHService.h */,
+				1AAC7231E47A434EAF06A5B0 /* AppVersion.m */,
+				331EEE6AB06B4F35BFBC8120 /* AppVersion.h */,
+				59FDAA2CEE4540A3913846E4 /* CDVWKWebViewEngine.m */,
+				3B73EA28E46846FF84E6AF02 /* CDVWKWebViewUIDelegate.m */,
+				473FEFEEBB2C4F5EAF594EBD /* CDVWKProcessPoolFactory.m */,
+				648BD3182CD64A77AD2D447B /* CDVWKWebViewEngine.h */,
+				1E5CB6025B2E4D14ABFDB037 /* CDVWKWebViewUIDelegate.h */,
+				7DC7711D3C76485B9E422E3A /* CDVWKProcessPoolFactory.h */,
 			);
 			name = Plugins;
 			path = dlapp/Plugins;
@@ -433,8 +457,13 @@
 				LastUpgradeCheck = 510;
 				TargetAttributes = {
 					1D6058900D05DD3D006BFB54 = {
-						DevelopmentTeam = 74UNETA6B2;
+						DevelopmentTeam = 58ZC23SH57;
 						ProvisioningStyle = Automatic;
+						SystemCapabilities = {
+							com.apple.Push = {
+								enabled = 1;
+							};
+						};
 					};
 				};
 			};
@@ -446,13 +475,13 @@
 				English,
 				en,
 			);
-			mainGroup = 29B97314FDCFA39411CA2CEA;
+			mainGroup = 29B97314FDCFA39411CA2CEA /* CustomTemplate */;
 			productRefGroup = 19C28FACFE9D520D11CA2CBB /* Products */;
 			projectDirPath = "";
 			projectReferences = (
 				{
 					ProductGroup = 301BF52E109A57CC0062928A /* Products */;
-					ProjectRef = 301BF52D109A57CC0062928A /* CordovaLib.xcodeproj */;
+					ProjectRef = 301BF52D109A57CC0062928A /* CordovaLib/CordovaLib.xcodeproj */;
 				},
 			);
 			projectRoot = "";
@@ -563,6 +592,10 @@
 				4F83621E48F143429B20FB3A /* CDVThemeableBrowser.m in Sources */,
 				3EBABAA2209349F6AF91DF03 /* JPushPlugin.m in Sources */,
 				A54A9FED843144C887EA4286 /* AppDelegate+JPush.m in Sources */,
+				8A202CA89E434389BBA0AD60 /* AppVersion.m in Sources */,
+				562D29FCB1FB4F86B95BB2BC /* CDVWKWebViewEngine.m in Sources */,
+				F68EA21E51A3463A8FE2EE92 /* CDVWKWebViewUIDelegate.m in Sources */,
+				1F969D21D7EF4CF1A547A1DF /* CDVWKProcessPoolFactory.m in Sources */,
 			);
 			runOnlyForDeploymentPostprocessing = 0;
 		};
@@ -587,8 +620,10 @@
 				ASSETCATALOG_COMPILER_LAUNCHIMAGE_NAME = LaunchImage;
 				CLANG_ENABLE_MODULES = YES;
 				CLANG_ENABLE_OBJC_ARC = YES;
+				CODE_SIGN_IDENTITY = "iPhone Developer";
+				CODE_SIGN_STYLE = Automatic;
 				COPY_PHASE_STRIP = NO;
-				DEVELOPMENT_TEAM = 74UNETA6B2;
+				DEVELOPMENT_TEAM = 58ZC23SH57;
 				GCC_DYNAMIC_NO_PIC = NO;
 				GCC_OPTIMIZATION_LEVEL = 0;
 				GCC_PRECOMPILE_PREFIX_HEADER = YES;
@@ -598,17 +633,18 @@
 				INFOPLIST_FILE = "dlapp/dlapp-Info.plist";
 				IPHONEOS_DEPLOYMENT_TARGET = 10.0;
 				LD_RUNPATH_SEARCH_PATHS = "@executable_path/Frameworks";
-				PRODUCT_BUNDLE_IDENTIFIER = com.supwisdom.dlapp;
-				PRODUCT_NAME = "$(TARGET_NAME)";
-				SWIFT_OBJC_BRIDGING_HEADER = "$(PROJECT_DIR)/$(PROJECT_NAME)/Bridging-Header.h";
-				SWIFT_OPTIMIZATION_LEVEL = "-Onone";
-				SWIFT_VERSION = 4.0;
-				TARGETED_DEVICE_FAMILY = 1;
 				LIBRARY_SEARCH_PATHS = (
 					"$(inherited)",
 					"\"$(SRCROOT)/$(TARGET_NAME)/Plugins/cordova-plugin-jcore\"",
 					"\"$(SRCROOT)/$(TARGET_NAME)/Plugins/jpush-phonegap-plugin\"",
 				);
+				PRODUCT_BUNDLE_IDENTIFIER = com.dalicitycard.app;
+				PRODUCT_NAME = "$(TARGET_NAME)";
+				PROVISIONING_PROFILE_SPECIFIER = "";
+				SWIFT_OBJC_BRIDGING_HEADER = "$(PROJECT_DIR)/$(PROJECT_NAME)/Bridging-Header.h";
+				SWIFT_OPTIMIZATION_LEVEL = "-Onone";
+				SWIFT_VERSION = 4.0;
+				TARGETED_DEVICE_FAMILY = 1;
 			};
 			name = Debug;
 		};
@@ -622,8 +658,10 @@
 				ASSETCATALOG_COMPILER_LAUNCHIMAGE_NAME = LaunchImage;
 				CLANG_ENABLE_MODULES = YES;
 				CLANG_ENABLE_OBJC_ARC = YES;
+				CODE_SIGN_IDENTITY = "iPhone Developer";
+				CODE_SIGN_STYLE = Automatic;
 				COPY_PHASE_STRIP = YES;
-				DEVELOPMENT_TEAM = 74UNETA6B2;
+				DEVELOPMENT_TEAM = 58ZC23SH57;
 				GCC_PRECOMPILE_PREFIX_HEADER = YES;
 				GCC_PREFIX_HEADER = "dlapp/dlapp-Prefix.pch";
 				GCC_THUMB_SUPPORT = NO;
@@ -631,16 +669,17 @@
 				INFOPLIST_FILE = "dlapp/dlapp-Info.plist";
 				IPHONEOS_DEPLOYMENT_TARGET = 10.0;
 				LD_RUNPATH_SEARCH_PATHS = "@executable_path/Frameworks";
-				PRODUCT_BUNDLE_IDENTIFIER = com.supwisdom.dlapp;
-				PRODUCT_NAME = "$(TARGET_NAME)";
-				SWIFT_OBJC_BRIDGING_HEADER = "$(PROJECT_DIR)/$(PROJECT_NAME)/Bridging-Header.h";
-				SWIFT_VERSION = 4.0;
-				TARGETED_DEVICE_FAMILY = 1;
 				LIBRARY_SEARCH_PATHS = (
 					"$(inherited)",
 					"\"$(SRCROOT)/$(TARGET_NAME)/Plugins/cordova-plugin-jcore\"",
 					"\"$(SRCROOT)/$(TARGET_NAME)/Plugins/jpush-phonegap-plugin\"",
 				);
+				PRODUCT_BUNDLE_IDENTIFIER = com.dalicitycard.app;
+				PRODUCT_NAME = "$(TARGET_NAME)";
+				PROVISIONING_PROFILE_SPECIFIER = "";
+				SWIFT_OBJC_BRIDGING_HEADER = "$(PROJECT_DIR)/$(PROJECT_NAME)/Bridging-Header.h";
+				SWIFT_VERSION = 4.0;
+				TARGETED_DEVICE_FAMILY = 1;
 			};
 			name = Release;
 		};
@@ -682,7 +721,7 @@
 				GCC_WARN_UNUSED_FUNCTION = YES;
 				GCC_WARN_UNUSED_VARIABLE = YES;
 				ONLY_ACTIVE_ARCH = YES;
-				PRODUCT_BUNDLE_IDENTIFIER = com.supwisdom.dlapp;
+				PRODUCT_BUNDLE_IDENTIFIER = com.dalicitycard.app;
 				SDKROOT = iphoneos;
 				SKIP_INSTALL = NO;
 				SWIFT_OBJC_BRIDGING_HEADER = "$(PROJECT_DIR)/$(PROJECT_NAME)/Bridging-Header.h";
@@ -727,7 +766,7 @@
 				GCC_WARN_UNINITIALIZED_AUTOS = YES;
 				GCC_WARN_UNUSED_FUNCTION = YES;
 				GCC_WARN_UNUSED_VARIABLE = YES;
-				PRODUCT_BUNDLE_IDENTIFIER = com.supwisdom.dlapp;
+				PRODUCT_BUNDLE_IDENTIFIER = com.dalicitycard.app;
 				SDKROOT = iphoneos;
 				SKIP_INSTALL = NO;
 				SWIFT_OBJC_BRIDGING_HEADER = "$(PROJECT_DIR)/$(PROJECT_NAME)/Bridging-Header.h";
diff --git a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/AppIcon24x24@2x.png b/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/AppIcon24x24@2x.png
deleted file mode 100644
index ed81661..0000000
--- a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/AppIcon24x24@2x.png
+++ /dev/null
Binary files differ
diff --git a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/AppIcon27.5x27.5@2x.png b/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/AppIcon27.5x27.5@2x.png
deleted file mode 100644
index ec313ad..0000000
--- a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/AppIcon27.5x27.5@2x.png
+++ /dev/null
Binary files differ
diff --git a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/AppIcon29x29@2x.png b/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/AppIcon29x29@2x.png
deleted file mode 100644
index d9c5f4b..0000000
--- a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/AppIcon29x29@2x.png
+++ /dev/null
Binary files differ
diff --git a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/AppIcon29x29@3x.png b/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/AppIcon29x29@3x.png
deleted file mode 100644
index ba532dd..0000000
--- a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/AppIcon29x29@3x.png
+++ /dev/null
Binary files differ
diff --git a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/AppIcon40x40@2x.png b/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/AppIcon40x40@2x.png
deleted file mode 100644
index 678fba0..0000000
--- a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/AppIcon40x40@2x.png
+++ /dev/null
Binary files differ
diff --git a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/AppIcon44x44@2x.png b/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/AppIcon44x44@2x.png
deleted file mode 100644
index b6fbccf..0000000
--- a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/AppIcon44x44@2x.png
+++ /dev/null
Binary files differ
diff --git a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/AppIcon86x86@2x.png b/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/AppIcon86x86@2x.png
deleted file mode 100644
index b0f903c..0000000
--- a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/AppIcon86x86@2x.png
+++ /dev/null
Binary files differ
diff --git a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/AppIcon98x98@2x.png b/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/AppIcon98x98@2x.png
deleted file mode 100644
index 3bca15b..0000000
--- a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/AppIcon98x98@2x.png
+++ /dev/null
Binary files differ
diff --git a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/Contents.json b/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/Contents.json
old mode 100644
new mode 100755
index 2ce78c1..99f7a0c
--- a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/Contents.json
+++ b/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/Contents.json
@@ -1,241 +1,128 @@
 {
-  "images" : [
-    {
-      "size" : "20x20",
-      "idiom" : "iphone",
-      "filename" : "icon-20@2x.png",
-      "scale" : "2x"
-    },
-    {
-      "size" : "20x20",
-      "idiom" : "iphone",
-      "filename" : "icon-20@3x.png",
-      "scale" : "3x"
-    },
-    {
-      "size" : "29x29",
-      "idiom" : "iphone",
-      "filename" : "icon-29.png",
-      "scale" : "1x"
-    },
-    {
-      "size" : "29x29",
-      "idiom" : "iphone",
-      "filename" : "icon-29@2x.png",
-      "scale" : "2x"
-    },
-    {
-      "size" : "29x29",
-      "idiom" : "iphone",
-      "filename" : "icon-29@3x.png",
-      "scale" : "3x"
-    },
-    {
-      "size" : "40x40",
-      "idiom" : "iphone",
-      "filename" : "icon-40@2x.png",
-      "scale" : "2x"
-    },
-    {
-      "size" : "40x40",
-      "idiom" : "iphone",
-      "filename" : "icon-60@2x.png",
-      "scale" : "3x"
-    },
-    {
-      "size" : "57x57",
-      "idiom" : "iphone",
-      "filename" : "icon.png",
-      "scale" : "1x"
-    },
-    {
-      "size" : "57x57",
-      "idiom" : "iphone",
-      "filename" : "icon@2x.png",
-      "scale" : "2x"
-    },
-    {
-      "size" : "60x60",
-      "idiom" : "iphone",
-      "filename" : "icon-60@2x.png",
-      "scale" : "2x"
-    },
-    {
-      "size" : "60x60",
-      "idiom" : "iphone",
-      "filename" : "icon-60@3x.png",
-      "scale" : "3x"
-    },
-    {
-      "size" : "20x20",
-      "idiom" : "ipad",
-      "filename" : "icon-20.png",
-      "scale" : "1x"
-    },
-    {
-      "size" : "20x20",
-      "idiom" : "ipad",
-      "filename" : "icon-20@2x.png",
-      "scale" : "2x"
-    },
-    {
-      "size" : "29x29",
-      "idiom" : "ipad",
-      "filename" : "icon-29.png",
-      "scale" : "1x"
-    },
-    {
-      "size" : "29x29",
-      "idiom" : "ipad",
-      "filename" : "icon-29@2x.png",
-      "scale" : "2x"
-    },
-    {
-      "size" : "40x40",
-      "idiom" : "ipad",
-      "filename" : "icon-40.png",
-      "scale" : "1x"
-    },
-    {
-      "size" : "40x40",
-      "idiom" : "ipad",
-      "filename" : "icon-40@2x.png",
-      "scale" : "2x"
-    },
-    {
-      "size" : "50x50",
-      "idiom" : "ipad",
-      "filename" : "icon-50.png",
-      "scale" : "1x"
-    },
-    {
-      "size" : "50x50",
-      "idiom" : "ipad",
-      "filename" : "icon-50@2x.png",
-      "scale" : "2x"
-    },
-    {
-      "size" : "72x72",
-      "idiom" : "ipad",
-      "filename" : "icon-72.png",
-      "scale" : "1x"
-    },
-    {
-      "size" : "72x72",
-      "idiom" : "ipad",
-      "filename" : "icon-72@2x.png",
-      "scale" : "2x"
-    },
-    {
-      "size" : "76x76",
-      "idiom" : "ipad",
-      "filename" : "icon-76.png",
-      "scale" : "1x"
-    },
-    {
-      "size" : "76x76",
-      "idiom" : "ipad",
-      "filename" : "icon-76@2x.png",
-      "scale" : "2x"
-    },
-    {
-      "size" : "83.5x83.5",
-      "idiom" : "ipad",
-      "filename" : "icon-83.5@2x.png",
-      "scale" : "2x"
-    },
-    {
-      "size" : "1024x1024",
-      "idiom" : "ios-marketing",
-      "filename" : "icon-1024.png",
-      "scale" : "1x"
-    },
-    {
-      "size" : "24x24",
-      "idiom" : "watch",
-      "filename" : "icon-24@2x.png",
-      "scale" : "2x",
-      "role" : "notificationCenter",
-      "subtype" : "38mm"
-    },
-    {
-      "size" : "27.5x27.5",
-      "idiom" : "watch",
-      "filename" : "icon-27.5@2x.png",
-      "scale" : "2x",
-      "role" : "notificationCenter",
-      "subtype" : "42mm"
-    },
-    {
-      "size" : "29x29",
-      "idiom" : "watch",
-      "filename" : "icon-29@2x.png",
-      "role" : "companionSettings",
-      "scale" : "2x"
-    },
-    {
-      "size" : "29x29",
-      "idiom" : "watch",
-      "filename" : "icon-29@3x.png",
-      "role" : "companionSettings",
-      "scale" : "3x"
-    },
-    {
-      "size" : "40x40",
-      "idiom" : "watch",
-      "filename" : "icon-40@2x.png",
-      "scale" : "2x",
-      "role" : "appLauncher",
-      "subtype" : "38mm"
-    },
-    {
-      "size" : "44x44",
-      "idiom" : "watch",
-      "filename" : "icon-44@2x.png",
-      "scale" : "2x",
-      "role" : "appLauncher",
-      "subtype" : "40mm"
-    },
-    {
-      "size" : "50x50",
-      "idiom" : "watch",
-      "filename" : "icon-50@2x.png",
-      "scale" : "2x",
-      "role" : "appLauncher",
-      "subtype" : "44mm"
-    },
-    {
-      "size" : "86x86",
-      "idiom" : "watch",
-      "filename" : "icon-86@2x.png",
-      "scale" : "2x",
-      "role" : "quickLook",
-      "subtype" : "38mm"
-    },
-    {
-      "size" : "98x98",
-      "idiom" : "watch",
-      "filename" : "icon-98@2x.png",
-      "scale" : "2x",
-      "role" : "quickLook",
-      "subtype" : "42mm"
-    },
-    {
-      "size" : "108x108",
-      "idiom" : "watch",
-      "scale" : "2x",
-      "role" : "quickLook",
-      "subtype" : "44mm"
-    },
-    {
-      "size" : "1024x1024",
-      "idiom" : "watch-marketing",
-      "filename" : "icon-1024.png",
-      "scale" : "1x"
+    "images":[
+        {
+            "idiom":"iphone",
+            "size":"20x20",
+            "scale":"2x",
+            "filename":"Icon-App-20x20@2x.png"
+        },
+        {
+            "idiom":"iphone",
+            "size":"20x20",
+            "scale":"3x",
+            "filename":"Icon-App-20x20@3x.png"
+        },
+        {
+            "idiom":"iphone",
+            "size":"29x29",
+            "scale":"1x",
+            "filename":"Icon-App-29x29@1x.png"
+        },
+        {
+            "idiom":"iphone",
+            "size":"29x29",
+            "scale":"2x",
+            "filename":"Icon-App-29x29@2x.png"
+        },
+        {
+            "idiom":"iphone",
+            "size":"29x29",
+            "scale":"3x",
+            "filename":"Icon-App-29x29@3x.png"
+        },
+        {
+            "idiom":"iphone",
+            "size":"40x40",
+            "scale":"2x",
+            "filename":"Icon-App-40x40@2x.png"
+        },
+        {
+            "idiom":"iphone",
+            "size":"40x40",
+            "scale":"3x",
+            "filename":"Icon-App-40x40@3x.png"
+        },
+        {
+            "idiom":"iphone",
+            "size":"60x60",
+            "scale":"2x",
+            "filename":"Icon-App-60x60@2x.png"
+        },
+        {
+            "idiom":"iphone",
+            "size":"60x60",
+            "scale":"3x",
+            "filename":"Icon-App-60x60@3x.png"
+        },
+        {
+            "idiom":"iphone",
+            "size":"76x76",
+            "scale":"2x",
+            "filename":"Icon-App-76x76@2x.png"
+        },
+        {
+            "idiom":"ipad",
+            "size":"20x20",
+            "scale":"1x",
+            "filename":"Icon-App-20x20@1x.png"
+        },
+        {
+            "idiom":"ipad",
+            "size":"20x20",
+            "scale":"2x",
+            "filename":"Icon-App-20x20@2x.png"
+        },
+        {
+            "idiom":"ipad",
+            "size":"29x29",
+            "scale":"1x",
+            "filename":"Icon-App-29x29@1x.png"
+        },
+        {
+            "idiom":"ipad",
+            "size":"29x29",
+            "scale":"2x",
+            "filename":"Icon-App-29x29@2x.png"
+        },
+        {
+            "idiom":"ipad",
+            "size":"40x40",
+            "scale":"1x",
+            "filename":"Icon-App-40x40@1x.png"
+        },
+        {
+            "idiom":"ipad",
+            "size":"40x40",
+            "scale":"2x",
+            "filename":"Icon-App-40x40@2x.png"
+        },
+        {
+            "idiom":"ipad",
+            "size":"76x76",
+            "scale":"1x",
+            "filename":"Icon-App-76x76@1x.png"
+        },
+        {
+            "idiom":"ipad",
+            "size":"76x76",
+            "scale":"2x",
+            "filename":"Icon-App-76x76@2x.png"
+        },
+        {
+            "idiom":"ipad",
+            "size":"83.5x83.5",
+            "scale":"2x",
+            "filename":"Icon-App-83.5x83.5@2x.png"
+        },
+        {
+          "size" : "1024x1024",
+          "idiom" : "ios-marketing",
+          "scale" : "1x",
+          "filename" : "ItunesArtwork@2x.png"
+        }
+    ],
+    "info":{
+        "version":1,
+        "author":"makeappicon"
     }
-  ],
-  "info" : {
-    "version" : 1,
-    "author" : "xcode"
-  }
-}
\ No newline at end of file
+}
diff --git a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/Icon-App-20x20@1x.png b/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/Icon-App-20x20@1x.png
new file mode 100644
index 0000000..ccdc491
--- /dev/null
+++ b/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/Icon-App-20x20@1x.png
Binary files differ
diff --git a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/Icon-App-20x20@2x.png b/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/Icon-App-20x20@2x.png
new file mode 100644
index 0000000..5b1a340
--- /dev/null
+++ b/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/Icon-App-20x20@2x.png
Binary files differ
diff --git a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/Icon-App-20x20@3x.png b/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/Icon-App-20x20@3x.png
new file mode 100644
index 0000000..d233176
--- /dev/null
+++ b/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/Icon-App-20x20@3x.png
Binary files differ
diff --git a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/Icon-App-29x29@1x.png b/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/Icon-App-29x29@1x.png
new file mode 100644
index 0000000..908f73c
--- /dev/null
+++ b/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/Icon-App-29x29@1x.png
Binary files differ
diff --git a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/Icon-App-29x29@2x.png b/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/Icon-App-29x29@2x.png
new file mode 100644
index 0000000..7716580
--- /dev/null
+++ b/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/Icon-App-29x29@2x.png
Binary files differ
diff --git a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/Icon-App-29x29@3x.png b/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/Icon-App-29x29@3x.png
new file mode 100644
index 0000000..0d3a8dc
--- /dev/null
+++ b/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/Icon-App-29x29@3x.png
Binary files differ
diff --git a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/Icon-App-40x40@1x.png b/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/Icon-App-40x40@1x.png
new file mode 100644
index 0000000..5b1a340
--- /dev/null
+++ b/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/Icon-App-40x40@1x.png
Binary files differ
diff --git a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/Icon-App-40x40@2x.png b/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/Icon-App-40x40@2x.png
new file mode 100644
index 0000000..d0ec9ec
--- /dev/null
+++ b/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/Icon-App-40x40@2x.png
Binary files differ
diff --git a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/Icon-App-40x40@3x.png b/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/Icon-App-40x40@3x.png
new file mode 100644
index 0000000..35bb3ba
--- /dev/null
+++ b/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/Icon-App-40x40@3x.png
Binary files differ
diff --git a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/Icon-App-60x60@2x.png b/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/Icon-App-60x60@2x.png
new file mode 100644
index 0000000..35bb3ba
--- /dev/null
+++ b/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/Icon-App-60x60@2x.png
Binary files differ
diff --git a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/Icon-App-60x60@3x.png b/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/Icon-App-60x60@3x.png
new file mode 100644
index 0000000..cb4580a
--- /dev/null
+++ b/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/Icon-App-60x60@3x.png
Binary files differ
diff --git a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/Icon-App-76x76@1x.png b/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/Icon-App-76x76@1x.png
new file mode 100644
index 0000000..65bf622
--- /dev/null
+++ b/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/Icon-App-76x76@1x.png
Binary files differ
diff --git a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/Icon-App-76x76@2x.png b/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/Icon-App-76x76@2x.png
new file mode 100644
index 0000000..6b6e1b1
--- /dev/null
+++ b/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/Icon-App-76x76@2x.png
Binary files differ
diff --git a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/Icon-App-83.5x83.5@2x.png b/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/Icon-App-83.5x83.5@2x.png
new file mode 100644
index 0000000..3a0d3be
--- /dev/null
+++ b/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/Icon-App-83.5x83.5@2x.png
Binary files differ
diff --git a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/ItunesArtwork@2x.png b/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/ItunesArtwork@2x.png
new file mode 100644
index 0000000..e347795
--- /dev/null
+++ b/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/ItunesArtwork@2x.png
Binary files differ
diff --git a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon-1024.png b/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon-1024.png
deleted file mode 100644
index ab1a5c0..0000000
--- a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon-1024.png
+++ /dev/null
Binary files differ
diff --git a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon-20.png b/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon-20.png
deleted file mode 100644
index 256350a..0000000
--- a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon-20.png
+++ /dev/null
Binary files differ
diff --git a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon-20@2x.png b/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon-20@2x.png
deleted file mode 100644
index cb6b99f..0000000
--- a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon-20@2x.png
+++ /dev/null
Binary files differ
diff --git a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon-20@3x.png b/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon-20@3x.png
deleted file mode 100644
index 5d8dbc8..0000000
--- a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon-20@3x.png
+++ /dev/null
Binary files differ
diff --git a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon-24@2x.png b/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon-24@2x.png
deleted file mode 100644
index f0babf9..0000000
--- a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon-24@2x.png
+++ /dev/null
Binary files differ
diff --git a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon-27.5@2x.png b/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon-27.5@2x.png
deleted file mode 100644
index 78f21bb..0000000
--- a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon-27.5@2x.png
+++ /dev/null
Binary files differ
diff --git a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon-29.png b/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon-29.png
deleted file mode 100644
index 5dff98e..0000000
--- a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon-29.png
+++ /dev/null
Binary files differ
diff --git a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon-29@2x.png b/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon-29@2x.png
deleted file mode 100644
index 34b3908..0000000
--- a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon-29@2x.png
+++ /dev/null
Binary files differ
diff --git a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon-29@3x.png b/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon-29@3x.png
deleted file mode 100644
index c63fd77..0000000
--- a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon-29@3x.png
+++ /dev/null
Binary files differ
diff --git a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon-40.png b/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon-40.png
deleted file mode 100644
index cb6b99f..0000000
--- a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon-40.png
+++ /dev/null
Binary files differ
diff --git a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon-40@2x.png b/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon-40@2x.png
deleted file mode 100644
index 678fba0..0000000
--- a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon-40@2x.png
+++ /dev/null
Binary files differ
diff --git a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon-44@2x.png b/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon-44@2x.png
deleted file mode 100644
index 01c5af7..0000000
--- a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon-44@2x.png
+++ /dev/null
Binary files differ
diff --git a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon-50.png b/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon-50.png
deleted file mode 100644
index 49fd544..0000000
--- a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon-50.png
+++ /dev/null
Binary files differ
diff --git a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon-50@2x.png b/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon-50@2x.png
deleted file mode 100644
index e0a0caa..0000000
--- a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon-50@2x.png
+++ /dev/null
Binary files differ
diff --git a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon-60@2x.png b/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon-60@2x.png
deleted file mode 100644
index a723c4a..0000000
--- a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon-60@2x.png
+++ /dev/null
Binary files differ
diff --git a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon-60@3x.png b/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon-60@3x.png
deleted file mode 100644
index 8649aad..0000000
--- a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon-60@3x.png
+++ /dev/null
Binary files differ
diff --git a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon-72.png b/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon-72.png
deleted file mode 100644
index 4edb4c6..0000000
--- a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon-72.png
+++ /dev/null
Binary files differ
diff --git a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon-72@2x.png b/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon-72@2x.png
deleted file mode 100644
index 3c7efa4..0000000
--- a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon-72@2x.png
+++ /dev/null
Binary files differ
diff --git a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon-76.png b/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon-76.png
deleted file mode 100644
index a2630ad..0000000
--- a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon-76.png
+++ /dev/null
Binary files differ
diff --git a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon-76@2x.png b/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon-76@2x.png
deleted file mode 100644
index a0335db..0000000
--- a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon-76@2x.png
+++ /dev/null
Binary files differ
diff --git a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon-83.5@2x.png b/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon-83.5@2x.png
deleted file mode 100644
index 2dd5230..0000000
--- a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon-83.5@2x.png
+++ /dev/null
Binary files differ
diff --git a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon-86@2x.png b/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon-86@2x.png
deleted file mode 100644
index f32a034..0000000
--- a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon-86@2x.png
+++ /dev/null
Binary files differ
diff --git a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon-98@2x.png b/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon-98@2x.png
deleted file mode 100644
index 85ec9e3..0000000
--- a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon-98@2x.png
+++ /dev/null
Binary files differ
diff --git a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon-small.png b/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon-small.png
deleted file mode 100644
index 3a3ba64..0000000
--- a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon-small.png
+++ /dev/null
Binary files differ
diff --git a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon-small@2x.png b/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon-small@2x.png
deleted file mode 100644
index d9c5f4b..0000000
--- a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon-small@2x.png
+++ /dev/null
Binary files differ
diff --git a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon-small@3x.png b/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon-small@3x.png
deleted file mode 100644
index ba532dd..0000000
--- a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon-small@3x.png
+++ /dev/null
Binary files differ
diff --git a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon.png b/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon.png
deleted file mode 100644
index 051cfb3..0000000
--- a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon.png
+++ /dev/null
Binary files differ
diff --git a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon@2x.png b/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon@2x.png
deleted file mode 100644
index dcb403f..0000000
--- a/platforms/ios/dlapp/Images.xcassets/AppIcon.appiconset/icon@2x.png
+++ /dev/null
Binary files differ
diff --git a/platforms/ios/dlapp/Plugins/cordova-plugin-app-version/AppVersion.h b/platforms/ios/dlapp/Plugins/cordova-plugin-app-version/AppVersion.h
new file mode 100644
index 0000000..87c0330
--- /dev/null
+++ b/platforms/ios/dlapp/Plugins/cordova-plugin-app-version/AppVersion.h
@@ -0,0 +1,13 @@
+#import <Cordova/CDVPlugin.h>
+
+@interface AppVersion : CDVPlugin
+
+- (void)getAppName:(CDVInvokedUrlCommand*)command;
+
+- (void)getPackageName:(CDVInvokedUrlCommand*)command;
+
+- (void)getVersionNumber:(CDVInvokedUrlCommand*)command;
+
+- (void)getVersionCode:(CDVInvokedUrlCommand*)command;
+
+@end
diff --git a/platforms/ios/dlapp/Plugins/cordova-plugin-app-version/AppVersion.m b/platforms/ios/dlapp/Plugins/cordova-plugin-app-version/AppVersion.m
new file mode 100644
index 0000000..a73c78f
--- /dev/null
+++ b/platforms/ios/dlapp/Plugins/cordova-plugin-app-version/AppVersion.m
@@ -0,0 +1,47 @@
+#import "AppVersion.h"
+#import <Cordova/CDVPluginResult.h>
+
+@implementation AppVersion
+
+- (void)getAppName : (CDVInvokedUrlCommand *)command
+{
+    NSString * callbackId = command.callbackId;
+    NSString * version =[[[NSBundle mainBundle]infoDictionary]objectForKey :@"CFBundleDisplayName"];
+    CDVPluginResult * pluginResult =[CDVPluginResult resultWithStatus : CDVCommandStatus_OK messageAsString : version];
+    [self.commandDelegate sendPluginResult : pluginResult callbackId : callbackId];
+}
+
+- (void)getPackageName:(CDVInvokedUrlCommand*)command
+{
+    NSString* callbackId = command.callbackId;
+    NSString* packageName = [[[NSBundle mainBundle] infoDictionary] objectForKey:@"CFBundleIdentifier"];
+    CDVPluginResult* pluginResult = [CDVPluginResult resultWithStatus:CDVCommandStatus_OK messageAsString:packageName];
+    [self.commandDelegate sendPluginResult:pluginResult callbackId:callbackId];
+}
+
+- (void)getVersionNumber:(CDVInvokedUrlCommand*)command
+{
+    NSString* callbackId = command.callbackId;
+    NSString* version = [[[NSBundle mainBundle] infoDictionary] objectForKey:@"CFBundleShortVersionString"];
+    if (version == nil) {
+      NSLog(@"CFBundleShortVersionString was nil, attempting CFBundleVersion");
+      version = [[[NSBundle mainBundle] infoDictionary] objectForKey:@"CFBundleVersion"];
+      if (version == nil) {
+        NSLog(@"CFBundleVersion was also nil, giving up");
+        // not calling error callback here to maintain backward compatibility
+      }
+    }
+
+    CDVPluginResult* pluginResult = [CDVPluginResult resultWithStatus:CDVCommandStatus_OK messageAsString:version];
+    [self.commandDelegate sendPluginResult:pluginResult callbackId:callbackId];
+}
+
+- (void)getVersionCode:(CDVInvokedUrlCommand*)command
+{
+    NSString* callbackId = command.callbackId;
+    NSString* version = [[[NSBundle mainBundle] infoDictionary] objectForKey:@"CFBundleVersion"];
+    CDVPluginResult* pluginResult = [CDVPluginResult resultWithStatus:CDVCommandStatus_OK messageAsString:version];
+    [self.commandDelegate sendPluginResult:pluginResult callbackId:callbackId];
+}
+
+@end
diff --git a/platforms/ios/dlapp/Plugins/cordova-plugin-wkwebview-engine/CDVWKProcessPoolFactory.h b/platforms/ios/dlapp/Plugins/cordova-plugin-wkwebview-engine/CDVWKProcessPoolFactory.h
new file mode 100644
index 0000000..f4f8816
--- /dev/null
+++ b/platforms/ios/dlapp/Plugins/cordova-plugin-wkwebview-engine/CDVWKProcessPoolFactory.h
@@ -0,0 +1,27 @@
+/*
+ Licensed to the Apache Software Foundation (ASF) under one
+ or more contributor license agreements.  See the NOTICE file
+ distributed with this work for additional information
+ regarding copyright ownership.  The ASF licenses this file
+ to you under the Apache License, Version 2.0 (the
+ "License"); you may not use this file except in compliance
+ with the License.  You may obtain a copy of the License at
+ 
+ http://www.apache.org/licenses/LICENSE-2.0
+ 
+ Unless required by applicable law or agreed to in writing,
+ software distributed under the License is distributed on an
+ "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+ KIND, either express or implied.  See the License for the
+ specific language governing permissions and limitations
+ under the License.
+ */
+
+#import <WebKit/WebKit.h>
+
+@interface CDVWKProcessPoolFactory : NSObject
+@property (nonatomic, retain) WKProcessPool* sharedPool;
+
++(instancetype) sharedFactory;
+-(WKProcessPool*) sharedProcessPool;
+@end
diff --git a/platforms/ios/dlapp/Plugins/cordova-plugin-wkwebview-engine/CDVWKProcessPoolFactory.m b/platforms/ios/dlapp/Plugins/cordova-plugin-wkwebview-engine/CDVWKProcessPoolFactory.m
new file mode 100644
index 0000000..48ac09e
--- /dev/null
+++ b/platforms/ios/dlapp/Plugins/cordova-plugin-wkwebview-engine/CDVWKProcessPoolFactory.m
@@ -0,0 +1,49 @@
+/*
+ Licensed to the Apache Software Foundation (ASF) under one
+ or more contributor license agreements.  See the NOTICE file
+ distributed with this work for additional information
+ regarding copyright ownership.  The ASF licenses this file
+ to you under the Apache License, Version 2.0 (the
+ "License"); you may not use this file except in compliance
+ with the License.  You may obtain a copy of the License at
+ 
+ http://www.apache.org/licenses/LICENSE-2.0
+ 
+ Unless required by applicable law or agreed to in writing,
+ software distributed under the License is distributed on an
+ "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+ KIND, either express or implied.  See the License for the
+ specific language governing permissions and limitations
+ under the License.
+ */
+
+#import <Foundation/Foundation.h>
+#import <WebKit/WebKit.h>
+#import "CDVWKProcessPoolFactory.h"
+
+static CDVWKProcessPoolFactory *factory = nil;
+
+@implementation CDVWKProcessPoolFactory
+
++ (instancetype)sharedFactory
+{
+    static dispatch_once_t onceToken;
+    dispatch_once(&onceToken, ^{
+        factory = [[CDVWKProcessPoolFactory alloc] init];
+    });
+    
+    return factory;
+}
+
+- (instancetype)init
+{
+    if (self = [super init]) {
+        _sharedPool = [[WKProcessPool alloc] init];
+    }
+    return self;
+}
+
+- (WKProcessPool*) sharedProcessPool {
+    return _sharedPool;
+}
+@end
diff --git a/platforms/ios/dlapp/Plugins/cordova-plugin-wkwebview-engine/CDVWKWebViewEngine.h b/platforms/ios/dlapp/Plugins/cordova-plugin-wkwebview-engine/CDVWKWebViewEngine.h
new file mode 100644
index 0000000..c71f4e2
--- /dev/null
+++ b/platforms/ios/dlapp/Plugins/cordova-plugin-wkwebview-engine/CDVWKWebViewEngine.h
@@ -0,0 +1,29 @@
+/*
+ Licensed to the Apache Software Foundation (ASF) under one
+ or more contributor license agreements.  See the NOTICE file
+ distributed with this work for additional information
+ regarding copyright ownership.  The ASF licenses this file
+ to you under the Apache License, Version 2.0 (the
+ "License"); you may not use this file except in compliance
+ with the License.  You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+ Unless required by applicable law or agreed to in writing,
+ software distributed under the License is distributed on an
+ "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+ KIND, either express or implied.  See the License for the
+ specific language governing permissions and limitations
+ under the License.
+ */
+
+#import <WebKit/WebKit.h>
+#import <Cordova/CDV.h>
+
+@interface CDVWKWebViewEngine : CDVPlugin <CDVWebViewEngineProtocol, WKScriptMessageHandler, WKNavigationDelegate>
+
+@property (nonatomic, strong, readonly) id <WKUIDelegate> uiDelegate;
+
+- (void)allowsBackForwardNavigationGestures:(CDVInvokedUrlCommand*)command;
+
+@end
diff --git a/platforms/ios/dlapp/Plugins/cordova-plugin-wkwebview-engine/CDVWKWebViewEngine.m b/platforms/ios/dlapp/Plugins/cordova-plugin-wkwebview-engine/CDVWKWebViewEngine.m
new file mode 100644
index 0000000..16a0cb7
--- /dev/null
+++ b/platforms/ios/dlapp/Plugins/cordova-plugin-wkwebview-engine/CDVWKWebViewEngine.m
@@ -0,0 +1,494 @@
+/*
+ Licensed to the Apache Software Foundation (ASF) under one
+ or more contributor license agreements.  See the NOTICE file
+ distributed with this work for additional information
+ regarding copyright ownership.  The ASF licenses this file
+ to you under the Apache License, Version 2.0 (the
+ "License"); you may not use this file except in compliance
+ with the License.  You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+ Unless required by applicable law or agreed to in writing,
+ software distributed under the License is distributed on an
+ "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+ KIND, either express or implied.  See the License for the
+ specific language governing permissions and limitations
+ under the License.
+ */
+
+#import "CDVWKWebViewEngine.h"
+#import "CDVWKWebViewUIDelegate.h"
+#import "CDVWKProcessPoolFactory.h"
+#import <Cordova/NSDictionary+CordovaPreferences.h>
+
+#import <objc/message.h>
+
+#define CDV_BRIDGE_NAME @"cordova"
+#define CDV_WKWEBVIEW_FILE_URL_LOAD_SELECTOR @"loadFileURL:allowingReadAccessToURL:"
+
+@interface CDVWKWeakScriptMessageHandler : NSObject <WKScriptMessageHandler>
+
+@property (nonatomic, weak, readonly) id<WKScriptMessageHandler>scriptMessageHandler;
+
+- (instancetype)initWithScriptMessageHandler:(id<WKScriptMessageHandler>)scriptMessageHandler;
+
+@end
+
+
+@interface CDVWKWebViewEngine ()
+
+@property (nonatomic, strong, readwrite) UIView* engineWebView;
+@property (nonatomic, strong, readwrite) id <WKUIDelegate> uiDelegate;
+@property (nonatomic, weak) id <WKScriptMessageHandler> weakScriptMessageHandler;
+
+@end
+
+// see forwardingTargetForSelector: selector comment for the reason for this pragma
+#pragma clang diagnostic ignored "-Wprotocol"
+
+@implementation CDVWKWebViewEngine
+
+@synthesize engineWebView = _engineWebView;
+
+- (instancetype)initWithFrame:(CGRect)frame
+{
+    self = [super init];
+    if (self) {
+        if (NSClassFromString(@"WKWebView") == nil) {
+            return nil;
+        }
+
+        self.engineWebView = [[WKWebView alloc] initWithFrame:frame];
+    }
+
+    return self;
+}
+
+- (WKWebViewConfiguration*) createConfigurationFromSettings:(NSDictionary*)settings
+{
+    WKWebViewConfiguration* configuration = [[WKWebViewConfiguration alloc] init];
+    configuration.processPool = [[CDVWKProcessPoolFactory sharedFactory] sharedProcessPool];
+    if (settings == nil) {
+        return configuration;
+    }
+
+    configuration.allowsInlineMediaPlayback = [settings cordovaBoolSettingForKey:@"AllowInlineMediaPlayback" defaultValue:NO];
+    configuration.mediaPlaybackRequiresUserAction = [settings cordovaBoolSettingForKey:@"MediaPlaybackRequiresUserAction" defaultValue:YES];
+    configuration.suppressesIncrementalRendering = [settings cordovaBoolSettingForKey:@"SuppressesIncrementalRendering" defaultValue:NO];
+    configuration.mediaPlaybackAllowsAirPlay = [settings cordovaBoolSettingForKey:@"MediaPlaybackAllowsAirPlay" defaultValue:YES];
+    return configuration;
+}
+
+- (void)pluginInitialize
+{
+    // viewController would be available now. we attempt to set all possible delegates to it, by default
+    NSDictionary* settings = self.commandDelegate.settings;
+
+    self.uiDelegate = [[CDVWKWebViewUIDelegate alloc] initWithTitle:[[NSBundle mainBundle] objectForInfoDictionaryKey:@"CFBundleDisplayName"]];
+
+    CDVWKWeakScriptMessageHandler *weakScriptMessageHandler = [[CDVWKWeakScriptMessageHandler alloc] initWithScriptMessageHandler:self];
+
+    WKUserContentController* userContentController = [[WKUserContentController alloc] init];
+    [userContentController addScriptMessageHandler:weakScriptMessageHandler name:CDV_BRIDGE_NAME];
+
+    WKWebViewConfiguration* configuration = [self createConfigurationFromSettings:settings];
+    configuration.userContentController = userContentController;
+
+    // re-create WKWebView, since we need to update configuration
+    WKWebView* wkWebView = [[WKWebView alloc] initWithFrame:self.engineWebView.frame configuration:configuration];
+    wkWebView.UIDelegate = self.uiDelegate;
+    self.engineWebView = wkWebView;
+
+    if (IsAtLeastiOSVersion(@"9.0") && [self.viewController isKindOfClass:[CDVViewController class]]) {
+        wkWebView.customUserAgent = ((CDVViewController*) self.viewController).userAgent;
+    }
+
+    if ([self.viewController conformsToProtocol:@protocol(WKUIDelegate)]) {
+        wkWebView.UIDelegate = (id <WKUIDelegate>)self.viewController;
+    }
+
+    if ([self.viewController conformsToProtocol:@protocol(WKNavigationDelegate)]) {
+        wkWebView.navigationDelegate = (id <WKNavigationDelegate>)self.viewController;
+    } else {
+        wkWebView.navigationDelegate = (id <WKNavigationDelegate>)self;
+    }
+
+    if ([self.viewController conformsToProtocol:@protocol(WKScriptMessageHandler)]) {
+        [wkWebView.configuration.userContentController addScriptMessageHandler:(id < WKScriptMessageHandler >)self.viewController name:CDV_BRIDGE_NAME];
+    }
+
+    [self updateSettings:settings];
+
+    // check if content thread has died on resume
+    NSLog(@"%@", @"CDVWKWebViewEngine will reload WKWebView if required on resume");
+    [[NSNotificationCenter defaultCenter]
+        addObserver:self
+           selector:@selector(onAppWillEnterForeground:)
+               name:UIApplicationWillEnterForegroundNotification object:nil];
+
+    NSLog(@"Using WKWebView");
+
+    [self addURLObserver];
+}
+
+- (void)onReset {
+    [self addURLObserver];
+}
+
+static void * KVOContext = &KVOContext;
+
+- (void)addURLObserver {
+    if(!IsAtLeastiOSVersion(@"9.0")){
+        [self.webView addObserver:self forKeyPath:@"URL" options:0 context:KVOContext];
+    }
+}
+
+- (void)observeValueForKeyPath:(NSString *)keyPath ofObject:(id)object change:(NSDictionary<NSString *,id> *)change context:(void *)context
+{
+    if (context == KVOContext) {
+        if (object == [self webView] && [keyPath isEqualToString: @"URL"] && [object valueForKeyPath:keyPath] == nil){
+            NSLog(@"URL is nil. Reloading WKWebView");
+            [(WKWebView*)_engineWebView reload];
+        }
+    } else {
+        [super observeValueForKeyPath:keyPath ofObject:object change:change context:context];
+    }
+}
+
+- (void) onAppWillEnterForeground:(NSNotification*)notification {
+    if ([self shouldReloadWebView]) {
+        NSLog(@"%@", @"CDVWKWebViewEngine reloading!");
+        [(WKWebView*)_engineWebView reload];
+    }
+}
+
+- (BOOL)shouldReloadWebView
+{
+    WKWebView* wkWebView = (WKWebView*)_engineWebView;
+    return [self shouldReloadWebView:wkWebView.URL title:wkWebView.title];
+}
+
+- (BOOL)shouldReloadWebView:(NSURL*)location title:(NSString*)title
+{
+    BOOL title_is_nil = (title == nil);
+    BOOL location_is_blank = [[location absoluteString] isEqualToString:@"about:blank"];
+
+    BOOL reload = (title_is_nil || location_is_blank);
+
+#ifdef DEBUG
+    NSLog(@"%@", @"CDVWKWebViewEngine shouldReloadWebView::");
+    NSLog(@"CDVWKWebViewEngine shouldReloadWebView title: %@", title);
+    NSLog(@"CDVWKWebViewEngine shouldReloadWebView location: %@", [location absoluteString]);
+    NSLog(@"CDVWKWebViewEngine shouldReloadWebView reload: %u", reload);
+#endif
+
+    return reload;
+}
+
+
+- (id)loadRequest:(NSURLRequest*)request
+{
+    if ([self canLoadRequest:request]) { // can load, differentiate between file urls and other schemes
+        if (request.URL.fileURL) {
+            SEL wk_sel = NSSelectorFromString(CDV_WKWEBVIEW_FILE_URL_LOAD_SELECTOR);
+            NSURL* readAccessUrl = [request.URL URLByDeletingLastPathComponent];
+            return ((id (*)(id, SEL, id, id))objc_msgSend)(_engineWebView, wk_sel, request.URL, readAccessUrl);
+        } else {
+            return [(WKWebView*)_engineWebView loadRequest:request];
+        }
+    } else { // can't load, print out error
+        NSString* errorHtml = [NSString stringWithFormat:
+                               @"<!doctype html>"
+                               @"<title>Error</title>"
+                               @"<div style='font-size:2em'>"
+                               @"   <p>The WebView engine '%@' is unable to load the request: %@</p>"
+                               @"   <p>Most likely the cause of the error is that the loading of file urls is not supported in iOS %@.</p>"
+                               @"</div>",
+                               NSStringFromClass([self class]),
+                               [request.URL description],
+                               [[UIDevice currentDevice] systemVersion]
+                               ];
+        return [self loadHTMLString:errorHtml baseURL:nil];
+    }
+}
+
+- (id)loadHTMLString:(NSString*)string baseURL:(NSURL*)baseURL
+{
+    return [(WKWebView*)_engineWebView loadHTMLString:string baseURL:baseURL];
+}
+
+- (NSURL*) URL
+{
+    return [(WKWebView*)_engineWebView URL];
+}
+
+- (BOOL) canLoadRequest:(NSURLRequest*)request
+{
+    // See: https://issues.apache.org/jira/browse/CB-9636
+    SEL wk_sel = NSSelectorFromString(CDV_WKWEBVIEW_FILE_URL_LOAD_SELECTOR);
+
+    // if it's a file URL, check whether WKWebView has the selector (which is in iOS 9 and up only)
+    if (request.URL.fileURL) {
+        return [_engineWebView respondsToSelector:wk_sel];
+    } else {
+        return YES;
+    }
+}
+
+- (void)updateSettings:(NSDictionary*)settings
+{
+    WKWebView* wkWebView = (WKWebView*)_engineWebView;
+
+    wkWebView.configuration.preferences.minimumFontSize = [settings cordovaFloatSettingForKey:@"MinimumFontSize" defaultValue:0.0];
+
+    /*
+     wkWebView.configuration.preferences.javaScriptEnabled = [settings cordovaBoolSettingForKey:@"JavaScriptEnabled" default:YES];
+     wkWebView.configuration.preferences.javaScriptCanOpenWindowsAutomatically = [settings cordovaBoolSettingForKey:@"JavaScriptCanOpenWindowsAutomatically" default:NO];
+     */
+
+    // By default, DisallowOverscroll is false (thus bounce is allowed)
+    BOOL bounceAllowed = !([settings cordovaBoolSettingForKey:@"DisallowOverscroll" defaultValue:NO]);
+
+    // prevent webView from bouncing
+    if (!bounceAllowed) {
+        if ([wkWebView respondsToSelector:@selector(scrollView)]) {
+            ((UIScrollView*)[wkWebView scrollView]).bounces = NO;
+        } else {
+            for (id subview in wkWebView.subviews) {
+                if ([[subview class] isSubclassOfClass:[UIScrollView class]]) {
+                    ((UIScrollView*)subview).bounces = NO;
+                }
+            }
+        }
+    }
+
+    NSString* decelerationSetting = [settings cordovaSettingForKey:@"WKWebViewDecelerationSpeed"];
+    if (!decelerationSetting) {
+        // Fallback to the UIWebView-named preference
+        decelerationSetting = [settings cordovaSettingForKey:@"UIWebViewDecelerationSpeed"];
+    }
+
+    if (![@"fast" isEqualToString:decelerationSetting]) {
+        [wkWebView.scrollView setDecelerationRate:UIScrollViewDecelerationRateNormal];
+    } else {
+        [wkWebView.scrollView setDecelerationRate:UIScrollViewDecelerationRateFast];
+    }
+
+    wkWebView.allowsBackForwardNavigationGestures = [settings cordovaBoolSettingForKey:@"AllowBackForwardNavigationGestures" defaultValue:NO];
+    wkWebView.allowsLinkPreview = [settings cordovaBoolSettingForKey:@"Allow3DTouchLinkPreview" defaultValue:YES];
+}
+
+- (void)updateWithInfo:(NSDictionary*)info
+{
+    NSDictionary* scriptMessageHandlers = [info objectForKey:kCDVWebViewEngineScriptMessageHandlers];
+    NSDictionary* settings = [info objectForKey:kCDVWebViewEngineWebViewPreferences];
+    id navigationDelegate = [info objectForKey:kCDVWebViewEngineWKNavigationDelegate];
+    id uiDelegate = [info objectForKey:kCDVWebViewEngineWKUIDelegate];
+
+    WKWebView* wkWebView = (WKWebView*)_engineWebView;
+
+    if (scriptMessageHandlers && [scriptMessageHandlers isKindOfClass:[NSDictionary class]]) {
+        NSArray* allKeys = [scriptMessageHandlers allKeys];
+
+        for (NSString* key in allKeys) {
+            id object = [scriptMessageHandlers objectForKey:key];
+            if ([object conformsToProtocol:@protocol(WKScriptMessageHandler)]) {
+                [wkWebView.configuration.userContentController addScriptMessageHandler:object name:key];
+            }
+        }
+    }
+
+    if (navigationDelegate && [navigationDelegate conformsToProtocol:@protocol(WKNavigationDelegate)]) {
+        wkWebView.navigationDelegate = navigationDelegate;
+    }
+
+    if (uiDelegate && [uiDelegate conformsToProtocol:@protocol(WKUIDelegate)]) {
+        wkWebView.UIDelegate = uiDelegate;
+    }
+
+    if (settings && [settings isKindOfClass:[NSDictionary class]]) {
+        [self updateSettings:settings];
+    }
+}
+
+// This forwards the methods that are in the header that are not implemented here.
+// Both WKWebView and UIWebView implement the below:
+//     loadHTMLString:baseURL:
+//     loadRequest:
+- (id)forwardingTargetForSelector:(SEL)aSelector
+{
+    return _engineWebView;
+}
+
+- (UIView*)webView
+{
+    return self.engineWebView;
+}
+
+#pragma mark WKScriptMessageHandler implementation
+
+- (void)userContentController:(WKUserContentController*)userContentController didReceiveScriptMessage:(WKScriptMessage*)message
+{
+    if (![message.name isEqualToString:CDV_BRIDGE_NAME]) {
+        return;
+    }
+
+    CDVViewController* vc = (CDVViewController*)self.viewController;
+
+    NSArray* jsonEntry = message.body; // NSString:callbackId, NSString:service, NSString:action, NSArray:args
+    CDVInvokedUrlCommand* command = [CDVInvokedUrlCommand commandFromJson:jsonEntry];
+    CDV_EXEC_LOG(@"Exec(%@): Calling %@.%@", command.callbackId, command.className, command.methodName);
+
+    if (![vc.commandQueue execute:command]) {
+#ifdef DEBUG
+        NSError* error = nil;
+        NSString* commandJson = nil;
+        NSData* jsonData = [NSJSONSerialization dataWithJSONObject:jsonEntry
+                                                           options:0
+                                                             error:&error];
+
+        if (error == nil) {
+            commandJson = [[NSString alloc] initWithData:jsonData encoding:NSUTF8StringEncoding];
+        }
+
+            static NSUInteger maxLogLength = 1024;
+            NSString* commandString = ([commandJson length] > maxLogLength) ?
+                [NSString stringWithFormat : @"%@[...]", [commandJson substringToIndex:maxLogLength]] :
+                commandJson;
+
+            NSLog(@"FAILED pluginJSON = %@", commandString);
+#endif
+    }
+}
+
+#pragma mark WKNavigationDelegate implementation
+
+- (void)webView:(WKWebView*)webView didStartProvisionalNavigation:(WKNavigation*)navigation
+{
+    [[NSNotificationCenter defaultCenter] postNotification:[NSNotification notificationWithName:CDVPluginResetNotification object:webView]];
+}
+
+- (void)webView:(WKWebView*)webView didFinishNavigation:(WKNavigation*)navigation
+{
+    CDVViewController* vc = (CDVViewController*)self.viewController;
+    [CDVUserAgentUtil releaseLock:vc.userAgentLockToken];
+
+    [[NSNotificationCenter defaultCenter] postNotification:[NSNotification notificationWithName:CDVPageDidLoadNotification object:webView]];
+}
+
+- (void)webView:(WKWebView*)theWebView didFailProvisionalNavigation:(WKNavigation*)navigation withError:(NSError*)error
+{
+    [self webView:theWebView didFailNavigation:navigation withError:error];
+}
+
+- (void)webView:(WKWebView*)theWebView didFailNavigation:(WKNavigation*)navigation withError:(NSError*)error
+{
+    CDVViewController* vc = (CDVViewController*)self.viewController;
+    [CDVUserAgentUtil releaseLock:vc.userAgentLockToken];
+
+    NSString* message = [NSString stringWithFormat:@"Failed to load webpage with error: %@", [error localizedDescription]];
+    NSLog(@"%@", message);
+
+    NSURL* errorUrl = vc.errorURL;
+    if (errorUrl) {
+        errorUrl = [NSURL URLWithString:[NSString stringWithFormat:@"?error=%@", [message stringByAddingPercentEscapesUsingEncoding:NSUTF8StringEncoding]] relativeToURL:errorUrl];
+        NSLog(@"%@", [errorUrl absoluteString]);
+        [theWebView loadRequest:[NSURLRequest requestWithURL:errorUrl]];
+    }
+}
+
+- (void)webViewWebContentProcessDidTerminate:(WKWebView *)webView
+{
+    [webView reload];
+}
+
+- (BOOL)defaultResourcePolicyForURL:(NSURL*)url
+{
+    // all file:// urls are allowed
+    if ([url isFileURL]) {
+        return YES;
+    }
+
+    return NO;
+}
+
+- (void) webView: (WKWebView *) webView decidePolicyForNavigationAction: (WKNavigationAction*) navigationAction decisionHandler: (void (^)(WKNavigationActionPolicy)) decisionHandler
+{
+    NSURL* url = [navigationAction.request URL];
+    CDVViewController* vc = (CDVViewController*)self.viewController;
+
+    /*
+     * Give plugins the chance to handle the url
+     */
+    BOOL anyPluginsResponded = NO;
+    BOOL shouldAllowRequest = NO;
+
+    for (NSString* pluginName in vc.pluginObjects) {
+        CDVPlugin* plugin = [vc.pluginObjects objectForKey:pluginName];
+        SEL selector = NSSelectorFromString(@"shouldOverrideLoadWithRequest:navigationType:");
+        if ([plugin respondsToSelector:selector]) {
+            anyPluginsResponded = YES;
+            // https://issues.apache.org/jira/browse/CB-12497
+            int navType = (int)navigationAction.navigationType;
+            if (WKNavigationTypeOther == navigationAction.navigationType) {
+                navType = (int)UIWebViewNavigationTypeOther;
+            }
+            shouldAllowRequest = (((BOOL (*)(id, SEL, id, int))objc_msgSend)(plugin, selector, navigationAction.request, navType));
+            if (!shouldAllowRequest) {
+                break;
+            }
+        }
+    }
+
+    if (anyPluginsResponded) {
+        return decisionHandler(shouldAllowRequest);
+    }
+
+    /*
+     * Handle all other types of urls (tel:, sms:), and requests to load a url in the main webview.
+     */
+    BOOL shouldAllowNavigation = [self defaultResourcePolicyForURL:url];
+    if (shouldAllowNavigation) {
+        return decisionHandler(YES);
+    } else {
+        [[NSNotificationCenter defaultCenter] postNotification:[NSNotification notificationWithName:CDVPluginHandleOpenURLNotification object:url]];
+    }
+
+    return decisionHandler(NO);
+}
+
+#pragma mark - Plugin interface
+
+- (void)allowsBackForwardNavigationGestures:(CDVInvokedUrlCommand*)command;
+{
+    id value = [command argumentAtIndex:0];
+    if (!([value isKindOfClass:[NSNumber class]])) {
+        value = [NSNumber numberWithBool:NO];
+    }
+
+    WKWebView* wkWebView = (WKWebView*)_engineWebView;
+    wkWebView.allowsBackForwardNavigationGestures = [value boolValue];
+}
+
+@end
+
+#pragma mark - CDVWKWeakScriptMessageHandler
+
+@implementation CDVWKWeakScriptMessageHandler
+
+- (instancetype)initWithScriptMessageHandler:(id<WKScriptMessageHandler>)scriptMessageHandler
+{
+    self = [super init];
+    if (self) {
+        _scriptMessageHandler = scriptMessageHandler;
+    }
+    return self;
+}
+
+- (void)userContentController:(WKUserContentController *)userContentController didReceiveScriptMessage:(WKScriptMessage *)message
+{
+    [self.scriptMessageHandler userContentController:userContentController didReceiveScriptMessage:message];
+}
+
+@end
diff --git a/platforms/ios/dlapp/Plugins/cordova-plugin-wkwebview-engine/CDVWKWebViewUIDelegate.h b/platforms/ios/dlapp/Plugins/cordova-plugin-wkwebview-engine/CDVWKWebViewUIDelegate.h
new file mode 100644
index 0000000..33a179b
--- /dev/null
+++ b/platforms/ios/dlapp/Plugins/cordova-plugin-wkwebview-engine/CDVWKWebViewUIDelegate.h
@@ -0,0 +1,28 @@
+/*
+ Licensed to the Apache Software Foundation (ASF) under one
+ or more contributor license agreements.  See the NOTICE file
+ distributed with this work for additional information
+ regarding copyright ownership.  The ASF licenses this file
+ to you under the Apache License, Version 2.0 (the
+ "License"); you may not use this file except in compliance
+ with the License.  You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+ Unless required by applicable law or agreed to in writing,
+ software distributed under the License is distributed on an
+ "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+ KIND, either express or implied.  See the License for the
+ specific language governing permissions and limitations
+ under the License.
+ */
+
+#import <WebKit/WebKit.h>
+
+@interface CDVWKWebViewUIDelegate : NSObject <WKUIDelegate>
+
+@property (nonatomic, copy) NSString* title;
+
+- (instancetype)initWithTitle:(NSString*)title;
+
+@end
diff --git a/platforms/ios/dlapp/Plugins/cordova-plugin-wkwebview-engine/CDVWKWebViewUIDelegate.m b/platforms/ios/dlapp/Plugins/cordova-plugin-wkwebview-engine/CDVWKWebViewUIDelegate.m
new file mode 100644
index 0000000..a7a16f2
--- /dev/null
+++ b/platforms/ios/dlapp/Plugins/cordova-plugin-wkwebview-engine/CDVWKWebViewUIDelegate.m
@@ -0,0 +1,123 @@
+/*
+ Licensed to the Apache Software Foundation (ASF) under one
+ or more contributor license agreements.  See the NOTICE file
+ distributed with this work for additional information
+ regarding copyright ownership.  The ASF licenses this file
+ to you under the Apache License, Version 2.0 (the
+ "License"); you may not use this file except in compliance
+ with the License.  You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+ Unless required by applicable law or agreed to in writing,
+ software distributed under the License is distributed on an
+ "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+ KIND, either express or implied.  See the License for the
+ specific language governing permissions and limitations
+ under the License.
+ */
+
+#import "CDVWKWebViewUIDelegate.h"
+
+@implementation CDVWKWebViewUIDelegate
+
+- (instancetype)initWithTitle:(NSString*)title
+{
+    self = [super init];
+    if (self) {
+        self.title = title;
+    }
+
+    return self;
+}
+
+- (void)     webView:(WKWebView*)webView runJavaScriptAlertPanelWithMessage:(NSString*)message
+    initiatedByFrame:(WKFrameInfo*)frame completionHandler:(void (^)(void))completionHandler
+{
+    UIAlertController* alert = [UIAlertController alertControllerWithTitle:self.title
+                                                                   message:message
+                                                            preferredStyle:UIAlertControllerStyleAlert];
+
+    UIAlertAction* ok = [UIAlertAction actionWithTitle:NSLocalizedString(@"OK", @"OK")
+                                                 style:UIAlertActionStyleDefault
+                                               handler:^(UIAlertAction* action)
+        {
+            completionHandler();
+            [alert dismissViewControllerAnimated:YES completion:nil];
+        }];
+
+    [alert addAction:ok];
+
+    UIViewController* rootController = [UIApplication sharedApplication].delegate.window.rootViewController;
+
+    [rootController presentViewController:alert animated:YES completion:nil];
+}
+
+- (void)     webView:(WKWebView*)webView runJavaScriptConfirmPanelWithMessage:(NSString*)message
+    initiatedByFrame:(WKFrameInfo*)frame completionHandler:(void (^)(BOOL result))completionHandler
+{
+    UIAlertController* alert = [UIAlertController alertControllerWithTitle:self.title
+                                                                   message:message
+                                                            preferredStyle:UIAlertControllerStyleAlert];
+
+    UIAlertAction* ok = [UIAlertAction actionWithTitle:NSLocalizedString(@"OK", @"OK")
+                                                 style:UIAlertActionStyleDefault
+                                               handler:^(UIAlertAction* action)
+        {
+            completionHandler(YES);
+            [alert dismissViewControllerAnimated:YES completion:nil];
+        }];
+
+    [alert addAction:ok];
+
+    UIAlertAction* cancel = [UIAlertAction actionWithTitle:NSLocalizedString(@"Cancel", @"Cancel")
+                                                     style:UIAlertActionStyleDefault
+                                                   handler:^(UIAlertAction* action)
+        {
+            completionHandler(NO);
+            [alert dismissViewControllerAnimated:YES completion:nil];
+        }];
+    [alert addAction:cancel];
+
+    UIViewController* rootController = [UIApplication sharedApplication].delegate.window.rootViewController;
+
+    [rootController presentViewController:alert animated:YES completion:nil];
+}
+
+- (void)      webView:(WKWebView*)webView runJavaScriptTextInputPanelWithPrompt:(NSString*)prompt
+          defaultText:(NSString*)defaultText initiatedByFrame:(WKFrameInfo*)frame
+    completionHandler:(void (^)(NSString* result))completionHandler
+{
+    UIAlertController* alert = [UIAlertController alertControllerWithTitle:self.title
+                                                                   message:prompt
+                                                            preferredStyle:UIAlertControllerStyleAlert];
+
+    UIAlertAction* ok = [UIAlertAction actionWithTitle:NSLocalizedString(@"OK", @"OK")
+                                                 style:UIAlertActionStyleDefault
+                                               handler:^(UIAlertAction* action)
+        {
+            completionHandler(((UITextField*)alert.textFields[0]).text);
+            [alert dismissViewControllerAnimated:YES completion:nil];
+        }];
+
+    [alert addAction:ok];
+
+    UIAlertAction* cancel = [UIAlertAction actionWithTitle:NSLocalizedString(@"Cancel", @"Cancel")
+                                                     style:UIAlertActionStyleDefault
+                                                   handler:^(UIAlertAction* action)
+        {
+            completionHandler(nil);
+            [alert dismissViewControllerAnimated:YES completion:nil];
+        }];
+    [alert addAction:cancel];
+
+    [alert addTextFieldWithConfigurationHandler:^(UITextField* textField) {
+        textField.text = defaultText;
+    }];
+
+    UIViewController* rootController = [UIApplication sharedApplication].delegate.window.rootViewController;
+
+    [rootController presentViewController:alert animated:YES completion:nil];
+}
+
+@end
diff --git a/platforms/ios/dlapp/Resources/JPushConfig.plist b/platforms/ios/dlapp/Resources/JPushConfig.plist
index 8d4a326..58763e6 100644
--- a/platforms/ios/dlapp/Resources/JPushConfig.plist
+++ b/platforms/ios/dlapp/Resources/JPushConfig.plist
@@ -3,7 +3,7 @@
 <plist version="1.0">
 <dict>
 	<key>Appkey</key>
-	<string>your_jpush_appkey</string>
+	<string>d644d997f2cab0551ff704a3</string>
 	<key>Channel</key>
 	<string>channel name</string>
 	<key>IsProduction</key>
diff --git a/platforms/ios/dlapp/config.xml b/platforms/ios/dlapp/config.xml
index e4a0567..89c5991 100755
--- a/platforms/ios/dlapp/config.xml
+++ b/platforms/ios/dlapp/config.xml
@@ -1,5 +1,5 @@
 <?xml version='1.0' encoding='utf-8'?>
-<widget id="com.supwisdom.dlapp" version="1.0.0" xmlns="http://www.w3.org/ns/widgets" xmlns:cdv="http://cordova.apache.org/ns/1.0">
+<widget id="com.dalicitycard.app" version="1.0.4" xmlns="http://www.w3.org/ns/widgets" xmlns:cdv="http://cordova.apache.org/ns/1.0">
     <feature name="LocalStorage">
         <param name="ios-package" value="CDVLocalStorage" />
     </feature>
@@ -58,6 +58,12 @@
     <feature name="JPushPlugin">
         <param name="ios-package" value="JPushPlugin" />
     </feature>
+    <feature name="AppVersion">
+        <param name="ios-package" value="AppVersion" />
+    </feature>
+    <feature name="CDVWKWebViewEngine">
+        <param name="ios-package" value="CDVWKWebViewEngine" />
+    </feature>
     <name short="大理市民卡">dlapp</name>
     <description>
         A sample Apache Cordova application that responds to the deviceready event.
@@ -80,6 +86,9 @@
     <edit-config file="*-Info.plist" mode="merge" target="NSCameraUsageDescription">
         <string>APP需要使用您的相机权限,没有该权限将无法完成扫一扫功能</string>
     </edit-config>
+    <edit-config file="*-Info.plist" mode="merge" target="NSPhotoLibraryUsageDescription">
+        <string>APP需要使用您的相册权限,没有该权限将无法完成扫一扫功能</string>
+    </edit-config>
     <allow-intent href="itms:*" />
     <allow-intent href="itms-apps:*" />
     <preference name="AllowInlineMediaPlayback" value="false" />
@@ -105,4 +114,5 @@
     <preference name="Orientation" value="portrait" />
     <preference name="UseSwiftLanguageVersion" value="4.0" />
     <preference name="UIWebViewBounce" value="false" />
+    <preference name="CordovaWebViewEngine" value="CDVWKWebViewEngine" />
 </widget>
diff --git a/platforms/ios/dlapp/dlapp-Info.plist b/platforms/ios/dlapp/dlapp-Info.plist
index 67584e9..fc16293 100644
--- a/platforms/ios/dlapp/dlapp-Info.plist
+++ b/platforms/ios/dlapp/dlapp-Info.plist
@@ -17,11 +17,11 @@
 	<key>CFBundlePackageType</key>
 	<string>APPL</string>
 	<key>CFBundleShortVersionString</key>
-	<string>1.0.0</string>
+	<string>1.0.4</string>
 	<key>CFBundleSignature</key>
 	<string>????</string>
 	<key>CFBundleVersion</key>
-	<string>1.0.0</string>
+	<string>1.0.4</string>
 	<key>LSRequiresIPhoneOS</key>
 	<true/>
 	<key>NSAppTransportSecurity</key>
@@ -45,6 +45,10 @@
 	<string/>
 	<key>NSMainNibFile~ipad</key>
 	<string/>
+	<key>UIBackgroundModes</key>
+	<array>
+		<string>remote-notification</string>
+	</array>
 	<key>UIInterfaceOrientation</key>
 	<array>
 		<string>UIInterfaceOrientationPortrait</string>
@@ -63,9 +67,7 @@
 		<string>UIInterfaceOrientationPortrait</string>
 		<string>UIInterfaceOrientationPortraitUpsideDown</string>
 	</array>
-	<key>UIBackgroundModes</key>
-	<array>
-		<string>remote-notification</string>
-	</array>
+	<key>NSPhotoLibraryUsageDescription</key>
+	<string>APP需要使用您的相册权限,没有该权限将无法完成扫一扫功能</string>
 </dict>
 </plist>
\ No newline at end of file
diff --git a/platforms/ios/frameworks.json b/platforms/ios/frameworks.json
index d1a9e95..c15fc84 100644
--- a/platforms/ios/frameworks.json
+++ b/platforms/ios/frameworks.json
@@ -13,5 +13,6 @@
     "libz.tbd": 1,
     "AdSupport.framework": 1,
     "UserNotifications.framework": 1,
-    "libresolv.tbd": 1
+    "libresolv.tbd": 1,
+    "WebKit.framework": 1
 }
\ No newline at end of file
diff --git a/platforms/ios/ios.json b/platforms/ios/ios.json
index 8bd066d..3a70ab7 100644
--- a/platforms/ios/ios.json
+++ b/platforms/ios/ios.json
@@ -67,6 +67,18 @@
             {
               "xml": "<feature name=\"JPushPlugin\"><param name=\"ios-package\" value=\"JPushPlugin\" /></feature>",
               "count": 1
+            },
+            {
+              "xml": "<feature name=\"AppVersion\"><param name=\"ios-package\" value=\"AppVersion\" /></feature>",
+              "count": 1
+            },
+            {
+              "xml": "<feature name=\"CDVWKWebViewEngine\"><param name=\"ios-package\" value=\"CDVWKWebViewEngine\" /></feature>",
+              "count": 1
+            },
+            {
+              "xml": "<preference name=\"CordovaWebViewEngine\" value=\"CDVWKWebViewEngine\" />",
+              "count": 1
             }
           ]
         }
@@ -96,6 +108,14 @@
               "xml": "<array><string>remote-notification</string></array>",
               "count": 1
             }
+          ],
+          "NSPhotoLibraryUsageDescription": [
+            {
+              "xml": "<string>APP需要使用您的相册权限,没有该权限将无法完成扫一扫功能</string>",
+              "count": 1,
+              "mode": "merge",
+              "id": "config.xml"
+            }
           ]
         }
       },
@@ -123,7 +143,7 @@
         "parents": {
           "Appkey": [
             {
-              "xml": "<string>your_jpush_appkey</string>",
+              "xml": "<string>d644d997f2cab0551ff704a3</string>",
               "count": 1
             }
           ]
@@ -177,9 +197,15 @@
       "PACKAGE_NAME": "$(PRODUCT_BUNDLE_IDENTIFIER)"
     },
     "jpush-phonegap-plugin": {
-      "APP_KEY": "your_jpush_appkey",
+      "APP_KEY": "d644d997f2cab0551ff704a3",
       "CHANNEL": "developer-default",
       "PACKAGE_NAME": "$(PRODUCT_BUNDLE_IDENTIFIER)"
+    },
+    "cordova-plugin-app-version": {
+      "PACKAGE_NAME": "$(PRODUCT_BUNDLE_IDENTIFIER)"
+    },
+    "cordova-plugin-wkwebview-engine": {
+      "PACKAGE_NAME": "$(PRODUCT_BUNDLE_IDENTIFIER)"
     }
   },
   "dependent_plugins": {},
@@ -511,6 +537,30 @@
       "clobbers": [
         "JPush"
       ]
+    },
+    {
+      "id": "cordova-plugin-app-version.AppVersionPlugin",
+      "file": "plugins/cordova-plugin-app-version/www/AppVersionPlugin.js",
+      "pluginId": "cordova-plugin-app-version",
+      "clobbers": [
+        "cordova.getAppVersion"
+      ]
+    },
+    {
+      "id": "cordova-plugin-wkwebview-engine.ios-wkwebview-exec",
+      "file": "plugins/cordova-plugin-wkwebview-engine/src/www/ios/ios-wkwebview-exec.js",
+      "pluginId": "cordova-plugin-wkwebview-engine",
+      "clobbers": [
+        "cordova.exec"
+      ]
+    },
+    {
+      "id": "cordova-plugin-wkwebview-engine.ios-wkwebview",
+      "file": "plugins/cordova-plugin-wkwebview-engine/src/www/ios/ios-wkwebview.js",
+      "pluginId": "cordova-plugin-wkwebview-engine",
+      "clobbers": [
+        "window.WkWebView"
+      ]
     }
   ],
   "plugin_metadata": {
@@ -528,6 +578,8 @@
     "cordova-plugin-device": "2.0.2",
     "cordova-plugin-themeablebrowser": "0.2.17",
     "cordova-plugin-jcore": "1.3.0",
-    "jpush-phonegap-plugin": "3.7.2"
+    "jpush-phonegap-plugin": "3.7.2",
+    "cordova-plugin-app-version": "0.1.9",
+    "cordova-plugin-wkwebview-engine": "1.2.1"
   }
 }
diff --git a/platforms/ios/platform_www/cordova_plugins.js b/platforms/ios/platform_www/cordova_plugins.js
index 2a5d5a5..99f7689 100644
--- a/platforms/ios/platform_www/cordova_plugins.js
+++ b/platforms/ios/platform_www/cordova_plugins.js
@@ -327,6 +327,30 @@
       "clobbers": [
         "JPush"
       ]
+    },
+    {
+      "id": "cordova-plugin-app-version.AppVersionPlugin",
+      "file": "plugins/cordova-plugin-app-version/www/AppVersionPlugin.js",
+      "pluginId": "cordova-plugin-app-version",
+      "clobbers": [
+        "cordova.getAppVersion"
+      ]
+    },
+    {
+      "id": "cordova-plugin-wkwebview-engine.ios-wkwebview-exec",
+      "file": "plugins/cordova-plugin-wkwebview-engine/src/www/ios/ios-wkwebview-exec.js",
+      "pluginId": "cordova-plugin-wkwebview-engine",
+      "clobbers": [
+        "cordova.exec"
+      ]
+    },
+    {
+      "id": "cordova-plugin-wkwebview-engine.ios-wkwebview",
+      "file": "plugins/cordova-plugin-wkwebview-engine/src/www/ios/ios-wkwebview.js",
+      "pluginId": "cordova-plugin-wkwebview-engine",
+      "clobbers": [
+        "window.WkWebView"
+      ]
     }
   ];
   module.exports.metadata = {
@@ -344,6 +368,8 @@
     "cordova-plugin-device": "2.0.2",
     "cordova-plugin-themeablebrowser": "0.2.17",
     "cordova-plugin-jcore": "1.3.0",
-    "jpush-phonegap-plugin": "3.7.2"
+    "jpush-phonegap-plugin": "3.7.2",
+    "cordova-plugin-app-version": "0.1.9",
+    "cordova-plugin-wkwebview-engine": "1.2.1"
   };
 });
\ No newline at end of file
diff --git a/platforms/ios/platform_www/plugins/cordova-plugin-app-version/www/AppVersionPlugin.js b/platforms/ios/platform_www/plugins/cordova-plugin-app-version/www/AppVersionPlugin.js
new file mode 100644
index 0000000..430f50d
--- /dev/null
+++ b/platforms/ios/platform_www/plugins/cordova-plugin-app-version/www/AppVersionPlugin.js
@@ -0,0 +1,68 @@
+cordova.define("cordova-plugin-app-version.AppVersionPlugin", function(require, exports, module) {
+/*jslint indent: 2 */
+/*global window, jQuery, angular, cordova */
+"use strict";
+
+// Returns a jQuery or AngularJS deferred object, or pass a success and fail callbacks if you don't want to use jQuery or AngularJS
+var getPromisedCordovaExec = function (command, success, fail) {
+  var toReturn, deferred, injector, $q;
+  if (success === undefined) {
+    if (window.jQuery) {
+      deferred = jQuery.Deferred();
+      success = deferred.resolve;
+      fail = deferred.reject;
+      toReturn = deferred;
+    } else if (window.angular) {
+      injector = angular.injector(["ng"]);
+      $q = injector.get("$q");
+      deferred = $q.defer();
+      success = deferred.resolve;
+      fail = deferred.reject;
+      toReturn = deferred.promise;
+    } else if (window.when && window.when.promise) {
+      deferred = when.defer();
+      success = deferred.resolve;
+      fail = deferred.reject;
+      toReturn = deferred.promise;
+    } else if (window.Promise) {
+      toReturn = new Promise(function(c, e) {
+        success = c;
+        fail = e;
+      });
+    } else if (window.WinJS && window.WinJS.Promise) {
+      toReturn = new WinJS.Promise(function(c, e) {
+        success = c;
+        fail = e;
+      });
+    } else {
+      return console.error('AppVersion either needs a success callback, or jQuery/AngularJS/Promise/WinJS.Promise defined for using promises');
+    }
+  }
+  // 5th param is NOT optional. must be at least empty array
+  cordova.exec(success, fail, "AppVersion", command, []);
+  return toReturn;
+};
+
+var getAppVersion = function (success, fail) {
+  return getPromisedCordovaExec('getVersionNumber', success, fail);
+};
+
+getAppVersion.getAppName = function (success, fail) {
+  return getPromisedCordovaExec('getAppName', success, fail);
+};
+
+getAppVersion.getPackageName = function (success, fail) {
+  return getPromisedCordovaExec('getPackageName', success, fail);
+};
+
+getAppVersion.getVersionNumber = function (success, fail) {
+  return getPromisedCordovaExec('getVersionNumber', success, fail);
+};
+
+getAppVersion.getVersionCode = function (success, fail) {
+  return getPromisedCordovaExec('getVersionCode', success, fail);
+};
+
+module.exports = getAppVersion;
+
+});
diff --git a/platforms/ios/platform_www/plugins/cordova-plugin-wkwebview-engine/src/www/ios/ios-wkwebview-exec.js b/platforms/ios/platform_www/plugins/cordova-plugin-wkwebview-engine/src/www/ios/ios-wkwebview-exec.js
new file mode 100644
index 0000000..dc7595d
--- /dev/null
+++ b/platforms/ios/platform_www/plugins/cordova-plugin-wkwebview-engine/src/www/ios/ios-wkwebview-exec.js
@@ -0,0 +1,177 @@
+cordova.define("cordova-plugin-wkwebview-engine.ios-wkwebview-exec", function(require, exports, module) {
+/*
+ *
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ *
+ *   http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing,
+ * software distributed under the License is distributed on an
+ * "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+ * KIND, either express or implied.  See the License for the
+ * specific language governing permissions and limitations
+ * under the License.
+ *
+*/
+
+/**
+ * Creates the exec bridge used to notify the native code of
+ * commands.
+ */
+var cordova = require('cordova');
+var utils = require('cordova/utils');
+var base64 = require('cordova/base64');
+
+function massageArgsJsToNative (args) {
+    if (!args || utils.typeName(args) !== 'Array') {
+        return args;
+    }
+    var ret = [];
+    args.forEach(function (arg, i) {
+        if (utils.typeName(arg) === 'ArrayBuffer') {
+            ret.push({
+                'CDVType': 'ArrayBuffer',
+                'data': base64.fromArrayBuffer(arg)
+            });
+        } else {
+            ret.push(arg);
+        }
+    });
+    return ret;
+}
+
+function massageMessageNativeToJs (message) {
+    if (message.CDVType === 'ArrayBuffer') {
+        var stringToArrayBuffer = function (str) {
+            var ret = new Uint8Array(str.length);
+            for (var i = 0; i < str.length; i++) {
+                ret[i] = str.charCodeAt(i);
+            }
+            return ret.buffer;
+        };
+        var base64ToArrayBuffer = function (b64) {
+            return stringToArrayBuffer(atob(b64)); // eslint-disable-line no-undef
+        };
+        message = base64ToArrayBuffer(message.data);
+    }
+    return message;
+}
+
+function convertMessageToArgsNativeToJs (message) {
+    var args = [];
+    if (!message || !message.hasOwnProperty('CDVType')) {
+        args.push(message);
+    } else if (message.CDVType === 'MultiPart') {
+        message.messages.forEach(function (e) {
+            args.push(massageMessageNativeToJs(e));
+        });
+    } else {
+        args.push(massageMessageNativeToJs(message));
+    }
+    return args;
+}
+
+var iOSExec = function () {
+    // detect change in bridge, if there is a change, we forward to new bridge
+
+    // if (window.webkit && window.webkit.messageHandlers && window.webkit.messageHandlers.cordova && window.webkit.messageHandlers.cordova.postMessage) {
+    //     bridgeMode = jsToNativeModes.WK_WEBVIEW_BINDING;
+    // }
+
+    var successCallback, failCallback, service, action, actionArgs;
+    var callbackId = null;
+    if (typeof arguments[0] !== 'string') {
+        // FORMAT ONE
+        successCallback = arguments[0];
+        failCallback = arguments[1];
+        service = arguments[2];
+        action = arguments[3];
+        actionArgs = arguments[4];
+
+        // Since we need to maintain backwards compatibility, we have to pass
+        // an invalid callbackId even if no callback was provided since plugins
+        // will be expecting it. The Cordova.exec() implementation allocates
+        // an invalid callbackId and passes it even if no callbacks were given.
+        callbackId = 'INVALID';
+    } else {
+   	    throw new Error('The old format of this exec call has been removed (deprecated since 2.1). Change to: ' + // eslint-disable-line
+            'cordova.exec(null, null, \'Service\', \'action\', [ arg1, arg2 ]);');
+    }
+
+    // If actionArgs is not provided, default to an empty array
+    actionArgs = actionArgs || [];
+
+    // Register the callbacks and add the callbackId to the positional
+    // arguments if given.
+    if (successCallback || failCallback) {
+        callbackId = service + cordova.callbackId++;
+        cordova.callbacks[callbackId] =
+            {success: successCallback, fail: failCallback};
+    }
+
+    actionArgs = massageArgsJsToNative(actionArgs);
+
+    // CB-10133 DataClone DOM Exception 25 guard (fast function remover)
+    var command = [callbackId, service, action, JSON.parse(JSON.stringify(actionArgs))];
+    window.webkit.messageHandlers.cordova.postMessage(command);
+};
+
+iOSExec.nativeCallback = function (callbackId, status, message, keepCallback, debug) {
+    var success = status === 0 || status === 1;
+    var args = convertMessageToArgsNativeToJs(message);
+    Promise.resolve().then(function () {
+        cordova.callbackFromNative(callbackId, success, status, args, keepCallback); // eslint-disable-line
+    });
+};
+
+// for backwards compatibility
+iOSExec.nativeEvalAndFetch = function (func) {
+    try {
+        func();
+    } catch (e) {
+        console.log(e);
+    }
+};
+
+// Proxy the exec for bridge changes. See CB-10106
+
+function cordovaExec () {
+    var cexec = require('cordova/exec');
+    var cexec_valid = (typeof cexec.nativeFetchMessages === 'function') && (typeof cexec.nativeEvalAndFetch === 'function') && (typeof cexec.nativeCallback === 'function');
+    return (cexec_valid && execProxy !== cexec) ? cexec : iOSExec;
+}
+
+function execProxy () {
+    cordovaExec().apply(null, arguments);
+}
+
+execProxy.nativeFetchMessages = function () {
+    return cordovaExec().nativeFetchMessages.apply(null, arguments);
+};
+
+execProxy.nativeEvalAndFetch = function () {
+    return cordovaExec().nativeEvalAndFetch.apply(null, arguments);
+};
+
+execProxy.nativeCallback = function () {
+    return cordovaExec().nativeCallback.apply(null, arguments);
+};
+
+module.exports = execProxy;
+
+if (window.webkit && window.webkit.messageHandlers && window.webkit.messageHandlers.cordova && window.webkit.messageHandlers.cordova.postMessage) {
+    // unregister the old bridge
+    cordova.define.remove('cordova/exec');
+    // redefine bridge to our new bridge
+    cordova.define('cordova/exec', function (require, exports, module) {
+        module.exports = execProxy;
+    });
+}
+
+});
diff --git a/platforms/ios/platform_www/plugins/cordova-plugin-wkwebview-engine/src/www/ios/ios-wkwebview.js b/platforms/ios/platform_www/plugins/cordova-plugin-wkwebview-engine/src/www/ios/ios-wkwebview.js
new file mode 100644
index 0000000..0dac749
--- /dev/null
+++ b/platforms/ios/platform_www/plugins/cordova-plugin-wkwebview-engine/src/www/ios/ios-wkwebview.js
@@ -0,0 +1,33 @@
+cordova.define("cordova-plugin-wkwebview-engine.ios-wkwebview", function(require, exports, module) {
+/*
+ *
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ *
+ *   http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing,
+ * software distributed under the License is distributed on an
+ * "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+ * KIND, either express or implied.  See the License for the
+ * specific language governing permissions and limitations
+ * under the License.
+ *
+*/
+
+var exec = require('cordova/exec');
+
+var WkWebKit = {
+    allowsBackForwardNavigationGestures: function (allow) {
+        exec(null, null, 'CDVWKWebViewEngine', 'allowsBackForwardNavigationGestures', [allow]);
+    }
+};
+
+module.exports = WkWebKit;
+
+});